![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|---|
|
|---|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[ ]](/icons/unknown.gif) | a long way to go.s3m | 2008-07-07 04:55 | 192K | |
| another world.s3m | 2008-07-07 04:55 | 230K | |
| arctic traction reaction.s3m | 2008-07-07 04:55 | 241K | |
| a sweet 8-bit melody.s3m | 2008-07-07 04:55 | 24K | |
| a world of trouble.s3m | 2008-07-07 04:55 | 138K | |
| boss combat.s3m | 2008-07-07 04:55 | 55K | |
| boss duel.s3m | 2008-07-07 04:55 | 69K | |
| boss encounter.s3m | 2008-07-07 04:55 | 79K | |
| bubble poppin' action!.s3m | 2008-07-07 04:55 | 177K | |
| cannon bell canyon.s3m | 2008-07-07 04:55 | 206K | |
| cloaked wily machine.s3m | 2008-07-07 04:55 | 73K | |
| dr. cossack's skyworld.s3m | 2008-07-07 04:55 | 107K | |
| dream of the dawn.s3m | 2010-08-08 14:18 | 45K | |
| foundation aquatica.s3m | 2008-07-07 04:55 | 119K | |
| future's past present.s3m | 2008-07-07 04:55 | 193K | |
| groovyfunkyjammin'beat 1.s3m | 2008-07-07 04:55 | 40K | |
| hello i sell stuff.s3m | 2008-07-07 04:55 | 95K | |
| hidden palace zone(beta).s3m | 2008-07-07 04:55 | 168K | |
| hylian underworlds.s3m | 2008-07-07 04:55 | 147K | |
| hylian underworlds fc mix.s3m | 2008-07-07 04:55 | 8.6K | |
| icecap zone act 1.s3m | 2008-07-07 04:55 | 105K | |
| jamming the guitar.s3m | 2008-07-07 04:55 | 142K | |
| king dedede's bashfest.s3m | 2008-07-07 04:55 | 330K | |
| lava reef zone.s3m | 2008-07-07 04:55 | 88K | |
| metallic forest(v2.0).s3m | 2008-07-07 04:55 | 55K | |
| metropolis zone.s3m | 2010-08-08 14:18 | 104K | |
| overdrive.s3m | 2008-07-07 04:55 | 196K | |
| pondery of the existence.s3m | 2008-07-07 04:55 | 337K | |
| reverse caverns.s3m | 2008-07-07 04:55 | 527K | |
| six by six, red and blue.s3m | 2008-07-07 04:55 | 115K | |
| skull castle gamy.s3m | 2010-08-08 14:18 | 70K | |
| skull castle submerged.s3m | 2008-07-07 04:55 | 122K | |
| skull sea base.s3m | 2008-07-07 04:55 | 92K | |
| speed endurance tunnels.s3m | 2008-07-07 04:56 | 106K | |
| spiked aquaria.s3m | 2008-07-07 04:56 | 117K | |
| starlight zone.s3m | 2008-07-07 04:56 | 45K | |
| stratospheric pipeline.s3m | 2008-07-07 04:56 | 61K | |
| the deep mines.s3m | 2008-07-07 04:56 | 68K | |
| the desert between.s3m | 2008-07-07 04:56 | 237K | |
| the nails of lukifell.s3m | 2008-07-07 04:56 | 191K | |
| the wild west.s3m | 2008-07-07 04:56 | 265K | |
| they call me... gato.s3m | 2008-07-07 04:56 | 311K | |
| too hot.s3m | 2010-08-08 14:18 | 101K | |
| underground sewers.s3m | 2008-07-07 04:56 | 191K | |
| untitled boss melody.s3m | 2008-07-07 04:56 | 35K | |
|
|---|