![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|---|
|
|---|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[DIR]](/icons/folder.gif) | Dark Storm - Demon Crystal 3/ | 2008-07-07 01:03 | - | |
| Dark Storm - Demon Crystal 3 OPN/ | 2008-07-07 01:03 | - | |
| Dragon Slayer 2 - Xanadu/ | 2008-07-07 01:03 | - | |
| Dragon Slayer 2 - Xanadu 2/ | 2008-07-07 01:03 | - | |
| Dragon Slayer Jr - Romancia/ | 2008-07-07 01:03 | - | |
| Enix Quest/ | 2008-07-07 01:03 | - | |
| Manji Psy Kasoke Ki/ | 2008-07-07 01:04 | - | |
| Misty Blue/ | 2008-07-07 01:04 | - | |
| The Curse of Mars/ | 2008-07-07 01:04 | - | |
| The Curse of Mars OPN/ | 2008-07-07 01:04 | - | |
| The Gate of Labyrinth/ | 2008-07-07 01:04 | - | |
| The Gate of Labyrinth OPN/ | 2008-07-07 01:04 | - | |
| The Scheme (special sound version)/ | 2008-07-07 01:04 | - | |
| The Scheme/ | 2008-07-07 01:04 | - | |
|
|---|