![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| mua oksettaa-8.mod | 2008-07-06 14:27 | 12K | |
| mua oksettaa-6.mod | 2008-07-06 14:27 | 13K | |
| speech disorder.mod | 2008-07-06 14:27 | 20K | |
| trilobyte.mod | 2023-06-17 07:08 | 24K | |
| the lost sound-1.mod | 2008-07-06 14:27 | 36K | |
| chemical emotion.mod | 2008-07-06 14:27 | 55K | |
| intro urban.mod | 2008-07-06 14:27 | 58K | |
| banana ship.mod | 2008-07-06 14:27 | 60K | |
| atmosphere.mod | 2008-07-06 14:27 | 113K | |
| orgasm!.mod | 2008-07-06 14:27 | 127K | |
| a shining rainbow!.mod | 2008-07-06 14:27 | 130K | |
| hardcore intro.mod | 2008-07-06 14:27 | 133K | |
| condemnation.mod | 2008-07-06 14:27 | 143K | |
| heroism.mod | 2008-07-06 14:27 | 144K | |
| summernights.mod | 2008-07-06 14:27 | 164K | |
| timebomb.mod | 2008-07-06 14:27 | 190K | |
| happy tribulation!.mod | 2008-07-06 14:27 | 224K | |
| the seventh heaven.mod | 2008-07-06 14:27 | 284K | |