![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|---|
|
|---|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[ ]](/icons/unknown.gif) | gunbird1-01 - discover the dream.minipsf2 | 2018-08-26 11:14 | 1.3K | |
| gunbird1-02 - backstar's fortress.minipsf2 | 2018-08-26 11:14 | 2.2K | |
| gunbird1-03 - chase the case.minipsf2 | 2018-08-26 11:14 | 1.7K | |
| gunbird1-04 - pointed square.minipsf2 | 2018-08-26 11:14 | 3.3K | |
| gunbird1-05 - trick trump train.minipsf2 | 2018-08-26 11:14 | 3.2K | |
| gunbird1-06 - shot in the underground.minipsf2 | 2018-08-26 11:14 | 3.6K | |
| gunbird1-07 - high energy.minipsf2 | 2018-08-26 11:14 | 1.8K | |
| gunbird1-08 - we did it.minipsf2 | 2018-08-26 11:14 | 1.2K | |
| gunbird1-09 - aqua blue.minipsf2 | 2018-08-26 11:14 | 3.6K | |
| gunbird1-10 - unknown objects.minipsf2 | 2018-08-26 11:14 | 2.6K | |
| gunbird1-11 - mistery circle.minipsf2 | 2018-08-26 11:14 | 3.7K | |
| gunbird1-12 - the trap - from the ancient.minipsf2 | 2018-08-26 11:14 | 2.7K | |
| gunbird1-13 - reborn.minipsf2 | 2018-08-26 11:14 | 2.9K | |
| gunbird1-14 - the end of gunbird a.minipsf2 | 2018-08-26 11:14 | 927 | |
| gunbird1-15 - the end of gunbird b.minipsf2 | 2018-08-26 11:14 | 953 | |
| gunbird1-16 - the end of gunbird c.minipsf2 | 2018-08-26 11:14 | 678 | |
| gunbird1-17 - the end of gunbird d.minipsf2 | 2018-08-26 11:14 | 696 | |
| gunbird1-18 - dreamin' again.minipsf2 | 2018-08-26 11:14 | 938 | |
| gunbird1.psf2lib | 2018-08-26 11:14 | 292K | |
| gunbird2-01 - discover the dream.minipsf2 | 2018-08-26 11:14 | 1.3K | |
| gunbird2-02 - just fly, the dreamers.minipsf2 | 2018-08-26 11:14 | 3.3K | |
| gunbird2-03 - chase the case.minipsf2 | 2018-08-26 11:14 | 1.6K | |
| gunbird2-04 - type of essence.minipsf2 | 2018-08-26 11:14 | 2.8K | |
| gunbird2-05 - why do you wanna fly.minipsf2 | 2018-08-26 11:14 | 3.3K | |
| gunbird2-06 - gunbird.minipsf2 | 2018-08-26 11:14 | 3.5K | |
| gunbird2-07 - high energy.minipsf2 | 2018-08-26 11:14 | 1.7K | |
| gunbird2-08 - we did it.minipsf2 | 2018-08-26 11:14 | 1.0K | |
| gunbird2-09 - high speed reaction (trick tramp train).minipsf2 | 2018-08-26 11:14 | 2.7K | |
| gunbird2-10 - a cold new world.minipsf2 | 2018-08-26 11:14 | 2.7K | |
| gunbird2-11 - a minute to midnight.minipsf2 | 2018-08-26 11:14 | 1.3K | |
| gunbird2-12 - feel bad.minipsf2 | 2018-08-26 11:14 | 1.1K | |
| gunbird2-13 - unbelievable zone.minipsf2 | 2018-08-26 11:14 | 1.0K | |
| gunbird2-14 - the end of gunbird e.minipsf2 | 2018-08-26 11:14 | 1.1K | |
| gunbird2-15 - the end of gunbird f.minipsf2 | 2018-08-26 11:14 | 753 | |
| gunbird2-16 - dreamin' again.minipsf2 | 2018-08-26 11:14 | 908 | |
| gunbird2.psf2lib | 2018-08-26 11:14 | 201K | |
|
|---|