![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[SND]](/icons/sound2.gif) | 1995. the last song.psid | 2018-01-02 16:12 | 4.1K | |
![[SND]](/icons/sound2.gif) | agenda.psid | 2018-01-02 16:12 | 3.5K | |
![[SND]](/icons/sound2.gif) | ah. lust!!!.psid | 2018-01-02 16:12 | 3.3K | |
![[SND]](/icons/sound2.gif) | alphaflight mix.psid | 2018-01-02 16:12 | 2.9K | |
![[SND]](/icons/sound2.gif) | ambient try.psid | 2018-01-02 16:12 | 3.0K | |
![[SND]](/icons/sound2.gif) | another test.psid | 2018-01-02 16:12 | 3.5K | |
![[SND]](/icons/sound2.gif) | an sfx song.psid | 2018-01-02 16:12 | 3.4K | |
![[SND]](/icons/sound2.gif) | arcane rituals.psid | 2018-01-02 16:12 | 4.1K | |
![[SND]](/icons/sound2.gif) | a shortie 4 hysteric.psid | 2018-01-02 16:12 | 2.8K | |
![[SND]](/icons/sound2.gif) | atlast.psid | 2018-12-09 11:13 | 2.7K | |
![[SND]](/icons/sound2.gif) | axemohls.psid | 2018-01-02 16:12 | 3.7K | |
![[SND]](/icons/sound2.gif) | babysongs v3.0 final version.psid | 2018-01-02 16:12 | 4.6K | |
![[SND]](/icons/sound2.gif) | babysongsv3.0 final version.psid | 2008-07-05 15:14 | 4.6K | |
![[SND]](/icons/sound2.gif) | back from hell.psid | 2018-01-02 16:12 | 2.8K | |
![[SND]](/icons/sound2.gif) | bad taste.psid | 2018-01-02 16:12 | 2.8K | |
![[SND]](/icons/sound2.gif) | ballastaa.psid | 2018-01-02 16:12 | 3.9K | |
![[SND]](/icons/sound2.gif) | basic instinct.psid | 2018-01-02 16:12 | 4.3K | |
![[SND]](/icons/sound2.gif) | bass'n'role.psid | 2018-01-02 16:12 | 3.7K | |
![[SND]](/icons/sound2.gif) | bass attack.psid | 2018-01-02 16:12 | 3.3K | |
![[SND]](/icons/sound2.gif) | bass destruction.psid | 2018-01-02 16:12 | 3.5K | |
![[SND]](/icons/sound2.gif) | bended wave.psid | 2018-12-09 11:13 | 3.3K | |
![[SND]](/icons/sound2.gif) | boss-space.psid | 2018-01-02 16:12 | 3.3K | |
![[SND]](/icons/sound2.gif) | can you feel it.psid | 2018-01-02 16:12 | 3.2K | |
![[SND]](/icons/sound2.gif) | cd intro.psid | 2018-01-02 16:12 | 2.5K | |
![[SND]](/icons/sound2.gif) | cd intromusic.psid | 2008-07-05 15:14 | 2.5K | |
![[SND]](/icons/sound2.gif) | chain reaction game musics.psid | 2018-01-02 16:12 | 5.7K | |
![[SND]](/icons/sound2.gif) | changes.psid | 2018-01-02 16:12 | 3.4K | |
![[SND]](/icons/sound2.gif) | chechnobankh.psid | 2018-01-02 16:12 | 6.2K | |
![[SND]](/icons/sound2.gif) | chopper version. 2.psid | 2018-01-02 16:12 | 3.0K | |
![[SND]](/icons/sound2.gif) | click.psid | 2018-01-02 16:12 | 2.8K | |
![[SND]](/icons/sound2.gif) | clumsy.psid | 2018-01-02 16:12 | 2.6K | |
![[SND]](/icons/sound2.gif) | colours.psid | 2018-01-02 16:12 | 2.7K | |
![[SND]](/icons/sound2.gif) | compare.psid | 2008-07-05 15:14 | 3.5K | |
![[SND]](/icons/sound2.gif) | conserto.psid | 2018-01-02 16:12 | 3.2K | |
![[SND]](/icons/sound2.gif) | contaxia mix.psid | 2018-01-02 16:12 | 3.2K | |
![[SND]](/icons/sound2.gif) | crash-test.psid | 2018-01-02 16:12 | 3.5K | |
![[SND]](/icons/sound2.gif) | crazy.psid | 2018-01-02 16:12 | 2.5K | |
![[SND]](/icons/sound2.gif) | darkness.psid | 2018-01-02 16:12 | 3.5K | |
![[SND]](/icons/sound2.gif) | disco music.psid | 2018-01-02 16:12 | 3.2K | |
![[SND]](/icons/sound2.gif) | don't cry.psid | 2018-01-02 16:12 | 3.1K | |
![[SND]](/icons/sound2.gif) | double.psid | 2018-01-02 16:12 | 3.5K | |
![[SND]](/icons/sound2.gif) | downer.psid | 2018-01-02 16:12 | 3.4K | |
![[SND]](/icons/sound2.gif) | dream.psid | 2018-01-02 16:12 | 2.5K | |
![[SND]](/icons/sound2.gif) | dreams (part 1).psid | 2018-01-02 16:12 | 2.9K | |
![[SND]](/icons/sound2.gif) | dreams (part 2).psid | 2018-01-02 16:12 | 2.6K | |
![[SND]](/icons/sound2.gif) | dreams (part 3).psid | 2018-01-02 16:12 | 2.9K | |
![[SND]](/icons/sound2.gif) | dreams (part 6).psid | 2018-01-02 16:12 | 5.0K | |
![[SND]](/icons/sound2.gif) | dreams (part 7).psid | 2018-01-02 16:12 | 2.8K | |
![[SND]](/icons/sound2.gif) | drump (to the beat).psid | 2018-01-02 16:12 | 3.5K | |
![[SND]](/icons/sound2.gif) | echo effect.psid | 2018-01-02 16:12 | 2.7K | |
![[SND]](/icons/sound2.gif) | eclipse.psid | 2018-01-02 16:12 | 3.7K | |
![[SND]](/icons/sound2.gif) | el ende.psid | 2018-01-02 16:12 | 3.8K | |
![[SND]](/icons/sound2.gif) | enjoy.psid | 2018-01-02 16:12 | 3.0K | |
![[SND]](/icons/sound2.gif) | familiar.psid | 2018-01-02 16:12 | 3.3K | |
![[SND]](/icons/sound2.gif) | fast attack.psid | 2018-01-02 16:12 | 3.0K | |
![[SND]](/icons/sound2.gif) | fast overture.psid | 2018-01-02 16:12 | 2.9K | |
![[SND]](/icons/sound2.gif) | fast zak.psid | 2018-01-02 16:12 | 3.5K | |
![[SND]](/icons/sound2.gif) | fast zak 2.psid | 2019-08-24 07:23 | 2.3K | |
![[SND]](/icons/sound2.gif) | fast zak2.psid | 2008-07-05 15:14 | 2.3K | |
![[SND]](/icons/sound2.gif) | filename.psid | 2019-08-24 07:23 | 3.4K | |
![[SND]](/icons/sound2.gif) | filnames.psid | 2018-01-02 16:12 | 3.4K | |
![[SND]](/icons/sound2.gif) | filth.psid | 2018-01-02 16:12 | 2.7K | |
![[SND]](/icons/sound2.gif) | fixity.psid | 2018-01-02 16:12 | 3.5K | |
![[SND]](/icons/sound2.gif) | floppy.psid | 2018-01-02 16:12 | 3.3K | |
![[SND]](/icons/sound2.gif) | forma.psid | 2018-01-02 16:12 | 3.3K | |
![[SND]](/icons/sound2.gif) | for my eyes only.psid | 2018-01-02 16:12 | 3.2K | |
![[SND]](/icons/sound2.gif) | friends.psid | 2018-01-02 16:12 | 3.5K | |
![[SND]](/icons/sound2.gif) | fucking cool.psid | 2018-01-02 16:12 | 3.5K | |
![[SND]](/icons/sound2.gif) | full moon rock.psid | 2018-01-02 16:12 | 4.1K | |
![[SND]](/icons/sound2.gif) | fuzzy.psid | 2018-01-02 16:12 | 3.3K | |
![[SND]](/icons/sound2.gif) | geesh.psid | 2018-01-02 16:12 | 3.4K | |
![[SND]](/icons/sound2.gif) | givememore-jesterstyle.psid | 2018-01-02 16:12 | 3.8K | |
![[SND]](/icons/sound2.gif) | gladiator.psid | 2018-01-02 16:12 | 3.3K | |
![[SND]](/icons/sound2.gif) | going 2 rolf.psid | 2018-01-02 16:12 | 3.1K | |
![[SND]](/icons/sound2.gif) | goldkick.psid | 2018-01-02 16:12 | 3.6K | |
![[SND]](/icons/sound2.gif) | gold kupp.psid | 2008-07-05 15:14 | 3.6K | |
![[SND]](/icons/sound2.gif) | gone for sure.psid | 2018-01-02 16:12 | 2.7K | |
![[SND]](/icons/sound2.gif) | goodbye.psid | 2018-01-02 16:12 | 3.4K | |
![[SND]](/icons/sound2.gif) | graveyard.psid | 2018-12-09 11:13 | 3.4K | |
![[SND]](/icons/sound2.gif) | h-hardcore.psid | 2018-01-02 16:12 | 3.2K | |
![[SND]](/icons/sound2.gif) | hard & hard.psid | 2018-01-02 16:12 | 3.6K | |
![[SND]](/icons/sound2.gif) | hardcore.psid | 2018-01-02 16:12 | 3.4K | |
![[SND]](/icons/sound2.gif) | heart & soul.psid | 2018-01-02 16:12 | 3.3K | |
![[SND]](/icons/sound2.gif) | hip-dance.psid | 2008-07-05 15:14 | 3.2K | |
![[SND]](/icons/sound2.gif) | hot moves.psid | 2018-01-02 16:12 | 3.5K | |
![[SND]](/icons/sound2.gif) | hunting.psid | 2018-01-02 16:12 | 5.1K | |
![[SND]](/icons/sound2.gif) | i 'am' jch no. 2 - not.psid | 2018-01-02 16:12 | 3.2K | |
![[SND]](/icons/sound2.gif) | i'am'jch no.2-not.psid | 2008-07-05 15:14 | 3.2K | |
![[SND]](/icons/sound2.gif) | i know.psid | 2018-01-02 16:12 | 3.7K | |
![[SND]](/icons/sound2.gif) | immortal flash theme.psid | 2018-01-02 16:12 | 3.0K | |
![[SND]](/icons/sound2.gif) | impact #06 (intro).psid | 2018-01-02 16:12 | 3.7K | |
![[SND]](/icons/sound2.gif) | impact #06 (main).psid | 2018-01-02 16:12 | 3.2K | |
![[SND]](/icons/sound2.gif) | impact #06 (tune 4).psid | 2018-01-02 16:12 | 2.9K | |
![[SND]](/icons/sound2.gif) | impact #07 (intro).psid | 2018-01-02 16:12 | 2.9K | |
![[SND]](/icons/sound2.gif) | impact #07 (tune 4).psid | 2018-01-02 16:12 | 3.0K | |
![[SND]](/icons/sound2.gif) | impact #07 (tune 7).psid | 2018-01-02 16:12 | 3.6K | |
![[SND]](/icons/sound2.gif) | introtune.psid | 2008-07-05 15:14 | 3.4K | |
![[SND]](/icons/sound2.gif) | it's over.psid | 2018-01-02 16:12 | 2.7K | |
![[SND]](/icons/sound2.gif) | i want some more.psid | 2018-01-02 16:12 | 3.2K | |
![[SND]](/icons/sound2.gif) | jabbadidua.psid | 2018-01-02 16:12 | 2.8K | |
![[SND]](/icons/sound2.gif) | jch presets.psid | 2018-01-02 16:12 | 3.8K | |
![[SND]](/icons/sound2.gif) | jobbe.psid | 2018-01-02 16:12 | 2.7K | |
![[SND]](/icons/sound2.gif) | jungle all the way.psid | 2018-01-02 16:12 | 3.4K | |
![[SND]](/icons/sound2.gif) | just music.psid | 2018-01-02 16:12 | 3.1K | |
![[SND]](/icons/sound2.gif) | kill version2.psid | 2018-01-02 16:12 | 3.6K | |
![[SND]](/icons/sound2.gif) | kilmanjaro.psid | 2018-12-09 11:13 | 2.5K | |
![[SND]](/icons/sound2.gif) | klopetiklop.psid | 2018-01-02 16:12 | 2.7K | |
![[SND]](/icons/sound2.gif) | last ninja '94 remake.psid | 2018-01-02 16:12 | 3.5K | |
![[SND]](/icons/sound2.gif) | last song (in dmc-player).psid | 2018-01-02 16:12 | 4.1K | |
![[SND]](/icons/sound2.gif) | lead version1.psid | 2018-01-02 16:12 | 3.1K | |
![[SND]](/icons/sound2.gif) | let's boggie.psid | 2018-01-02 16:12 | 2.9K | |
![[SND]](/icons/sound2.gif) | let's dance.psid | 2018-01-02 16:12 | 3.4K | |
![[SND]](/icons/sound2.gif) | loadertheme.psid | 2018-01-02 16:12 | 2.7K | |
![[SND]](/icons/sound2.gif) | lock up.psid | 2018-01-02 16:12 | 3.5K | |
![[SND]](/icons/sound2.gif) | loff med sirup pa.psid | 2018-01-02 16:12 | 3.1K | |
![[SND]](/icons/sound2.gif) | lookoo.psid | 2018-01-02 16:12 | 3.1K | |
![[SND]](/icons/sound2.gif) | lost ninja 9 theme.psid | 2018-01-02 16:12 | 2.3K | |
![[SND]](/icons/sound2.gif) | lousey song.psid | 2018-01-02 16:12 | 2.6K | |
![[SND]](/icons/sound2.gif) | lovely.psid | 2018-01-02 16:12 | 3.0K | |
![[SND]](/icons/sound2.gif) | m.o.n. alike.psid | 2018-01-02 16:12 | 2.9K | |
![[SND]](/icons/sound2.gif) | major techno mix.psid | 2018-01-02 16:12 | 3.2K | |
![[SND]](/icons/sound2.gif) | maniacs of boys.psid | 2018-01-02 16:12 | 3.1K | |
![[SND]](/icons/sound2.gif) | megasad-preview.psid | 2018-01-02 16:12 | 3.0K | |
![[SND]](/icons/sound2.gif) | mirage theme.psid | 2018-01-02 16:12 | 2.7K | |
![[SND]](/icons/sound2.gif) | monster.psid | 2018-01-02 16:12 | 3.4K | |
![[SND]](/icons/sound2.gif) | moonshine.psid | 2018-01-02 16:12 | 3.5K | |
![[SND]](/icons/sound2.gif) | morphesus.psid | 2018-01-02 16:12 | 3.1K | |
![[SND]](/icons/sound2.gif) | mozikk.psid | 2018-01-02 16:12 | 3.1K | |
![[SND]](/icons/sound2.gif) | mozique.psid | 2018-01-02 16:12 | 3.6K | |
![[SND]](/icons/sound2.gif) | mr. average.psid | 2018-01-02 16:12 | 3.1K | |
![[SND]](/icons/sound2.gif) | musicoil.psid | 2018-01-02 16:12 | 3.6K | |
![[SND]](/icons/sound2.gif) | musketeers.psid | 2018-01-02 16:12 | 4.7K | |
![[SND]](/icons/sound2.gif) | my dear tamara (rip).psid | 2018-01-02 16:12 | 3.3K | |
![[SND]](/icons/sound2.gif) | mystify.psid | 2018-01-02 16:12 | 3.3K | |
![[SND]](/icons/sound2.gif) | no bass.psid | 2018-01-02 16:12 | 2.8K | |
![[SND]](/icons/sound2.gif) | noldus.psid | 2018-01-02 16:12 | 3.0K | |
![[SND]](/icons/sound2.gif) | no limit.psid | 2018-01-02 16:12 | 3.2K | |
![[SND]](/icons/sound2.gif) | noooooo limit.psid | 2008-07-05 15:14 | 3.2K | |
![[SND]](/icons/sound2.gif) | nothn' spooky here, or.psid | 2018-01-02 16:12 | 2.9K | |
![[SND]](/icons/sound2.gif) | not to be is the answer.psid | 2018-01-02 16:12 | 4.0K | |
![[SND]](/icons/sound2.gif) | obe to all.psid | 2018-01-02 16:12 | 3.5K | |
![[SND]](/icons/sound2.gif) | obe to sylvia-dreams-theme.psid | 2018-01-02 16:12 | 2.9K | |
![[SND]](/icons/sound2.gif) | old stuff.psid | 2018-01-02 16:12 | 3.2K | |
![[SND]](/icons/sound2.gif) | oprah.psid | 2018-01-02 16:12 | 3.6K | |
![[SND]](/icons/sound2.gif) | overdrive.psid | 2018-01-02 16:12 | 2.4K | |
![[SND]](/icons/sound2.gif) | overhead, over my head!.psid | 2018-01-02 16:12 | 3.9K | |
![[SND]](/icons/sound2.gif) | panastyle.psid | 2018-01-02 16:12 | 3.5K | |
![[SND]](/icons/sound2.gif) | panoramic style.psid | 2008-07-05 15:14 | 3.5K | |
![[SND]](/icons/sound2.gif) | pepola.psid | 2018-01-02 16:12 | 2.7K | |
![[SND]](/icons/sound2.gif) | phobic changes around.psid | 2018-12-09 11:13 | 3.8K | |
![[SND]](/icons/sound2.gif) | piano.psid | 2018-01-02 16:12 | 4.0K | |
![[SND]](/icons/sound2.gif) | play piano.psid | 2018-01-02 16:12 | 3.1K | |
![[SND]](/icons/sound2.gif) | practise.psid | 2018-01-02 16:12 | 2.5K | |
![[SND]](/icons/sound2.gif) | prologue end.psid | 2018-01-02 16:12 | 3.9K | |
![[SND]](/icons/sound2.gif) | prologue v2.psid | 2008-07-05 15:14 | 3.7K | |
![[SND]](/icons/sound2.gif) | pumpline-last heartbeat.psid | 2018-01-02 16:12 | 3.0K | |
![[SND]](/icons/sound2.gif) | quickwork (allright)!!!.psid | 2018-01-02 16:12 | 2.8K | |
![[SND]](/icons/sound2.gif) | rechnodrome.psid | 2018-01-02 16:12 | 3.2K | |
![[SND]](/icons/sound2.gif) | reggae trip.psid | 2018-01-02 16:12 | 2.8K | |
![[SND]](/icons/sound2.gif) | relax and enjoy.psid | 2018-01-02 16:12 | 2.8K | |
![[SND]](/icons/sound2.gif) | rhythm is a dancer.psid | 2018-12-09 11:13 | 4.0K | |
![[SND]](/icons/sound2.gif) | royalty.psid | 2018-01-02 16:12 | 3.0K | |
![[SND]](/icons/sound2.gif) | s.n.a.p.s'. t.h.e.m.e.psid | 2008-07-05 15:14 | 4.2K | |
![[SND]](/icons/sound2.gif) | sad end.psid | 2018-01-02 16:12 | 2.8K | |
![[SND]](/icons/sound2.gif) | saving.psid | 2018-01-02 16:12 | 3.0K | |
![[SND]](/icons/sound2.gif) | sensible.psid | 2018-01-02 16:12 | 4.8K | |
![[SND]](/icons/sound2.gif) | share a tear.psid | 2008-07-05 15:14 | 4.1K | |
![[SND]](/icons/sound2.gif) | shitty mix.psid | 2018-01-02 16:12 | 3.4K | |
![[SND]](/icons/sound2.gif) | shock.psid | 2018-01-02 16:12 | 3.8K | |
![[SND]](/icons/sound2.gif) | shoort jazz.psid | 2018-01-02 16:12 | 3.4K | |
![[SND]](/icons/sound2.gif) | short.psid | 2018-01-02 16:12 | 3.3K | |
![[SND]](/icons/sound2.gif) | shorts & shirts.psid | 2018-01-02 16:12 | 2.7K | |
![[SND]](/icons/sound2.gif) | show.psid | 2018-01-02 16:12 | 4.0K | |
![[SND]](/icons/sound2.gif) | sick opus.psid | 2018-01-02 16:12 | 3.2K | |
![[SND]](/icons/sound2.gif) | silence in the house.psid | 2018-01-02 16:12 | 3.1K | |
![[SND]](/icons/sound2.gif) | slasher.psid | 2018-01-02 16:12 | 3.5K | |
![[SND]](/icons/sound2.gif) | sleepless.psid | 2018-01-02 16:12 | 3.2K | |
![[SND]](/icons/sound2.gif) | sliderglider.psid | 2018-01-02 16:12 | 3.4K | |
![[SND]](/icons/sound2.gif) | slow.psid | 2018-01-02 16:12 | 3.1K | |
![[SND]](/icons/sound2.gif) | slow down please.psid | 2018-01-02 16:12 | 3.2K | |
![[SND]](/icons/sound2.gif) | smicksick i guess.psid | 2018-01-02 16:12 | 4.1K | |
![[SND]](/icons/sound2.gif) | snap's theme.psid | 2018-01-02 16:12 | 4.2K | |
![[SND]](/icons/sound2.gif) | snap 01.psid | 2009-05-26 03:44 | 3.7K | |
![[SND]](/icons/sound2.gif) | snap 02.psid | 2009-05-26 03:44 | 3.2K | |
![[SND]](/icons/sound2.gif) | snavling.psid | 2018-01-02 16:12 | 3.4K | |
![[SND]](/icons/sound2.gif) | soap.psid | 2018-01-02 16:12 | 3.3K | |
![[SND]](/icons/sound2.gif) | solution.psid | 2018-01-02 16:12 | 3.3K | |
![[SND]](/icons/sound2.gif) | some serious shit.psid | 2018-01-02 16:12 | 2.8K | |
![[SND]](/icons/sound2.gif) | speed.psid | 2018-01-02 16:12 | 3.1K | |
![[SND]](/icons/sound2.gif) | spooky version 6.1.psid | 2018-01-02 16:12 | 3.5K | |
![[SND]](/icons/sound2.gif) | ssschhh.psid | 2018-01-02 16:12 | 4.4K | |
![[SND]](/icons/sound2.gif) | sunshine.psid | 2018-01-02 16:12 | 3.2K | |
![[SND]](/icons/sound2.gif) | tales of the unknown.psid | 2018-01-02 16:12 | 3.2K | |
![[SND]](/icons/sound2.gif) | tandberg.psid | 2018-01-02 16:12 | 3.1K | |
![[SND]](/icons/sound2.gif) | tdu violation theme.psid | 2018-01-02 16:12 | 2.7K | |
![[SND]](/icons/sound2.gif) | tears.psid | 2018-01-02 16:12 | 2.7K | |
![[SND]](/icons/sound2.gif) | techno.psid | 2018-01-02 16:12 | 3.8K | |
![[SND]](/icons/sound2.gif) | terminator i+ii remix.psid | 2018-01-02 16:12 | 3.4K | |
![[SND]](/icons/sound2.gif) | test.psid | 2018-01-02 16:12 | 2.6K | |
![[SND]](/icons/sound2.gif) | test music.psid | 2018-01-02 16:12 | 2.6K | |
![[SND]](/icons/sound2.gif) | test rag.psid | 2018-01-02 16:12 | 2.6K | |
![[SND]](/icons/sound2.gif) | the endsong.psid | 2018-01-02 16:12 | 2.7K | |
![[SND]](/icons/sound2.gif) | the final agenda.psid | 2008-07-05 15:14 | 3.5K | |
![[SND]](/icons/sound2.gif) | the first song ever by snap.psid | 2018-01-02 16:12 | 2.8K | |
![[SND]](/icons/sound2.gif) | the fix.psid | 2018-01-02 16:12 | 4.6K | |
![[SND]](/icons/sound2.gif) | the greatest sacrifice.psid | 2018-01-02 16:12 | 5.1K | |
![[SND]](/icons/sound2.gif) | the intro.psid | 2018-01-02 16:12 | 3.0K | |
![[SND]](/icons/sound2.gif) | the jumbo.psid | 2018-01-02 16:12 | 3.6K | |
![[SND]](/icons/sound2.gif) | the magzone.psid | 2018-01-02 16:12 | 3.6K | |
![[SND]](/icons/sound2.gif) | the mature.psid | 2018-01-02 16:12 | 2.7K | |
![[SND]](/icons/sound2.gif) | the picadelly.psid | 2008-07-05 15:14 | 4.0K | |
![[SND]](/icons/sound2.gif) | the story.psid | 2008-07-05 15:14 | 3.0K | |
![[SND]](/icons/sound2.gif) | time is runnin.psid | 2018-01-02 16:12 | 3.8K | |
![[SND]](/icons/sound2.gif) | timertune final version.psid | 2018-01-02 16:12 | 4.4K | |
![[SND]](/icons/sound2.gif) | too early.psid | 2018-01-02 16:12 | 3.3K | |
![[SND]](/icons/sound2.gif) | too hot i guess.psid | 2018-01-02 16:12 | 3.1K | |
![[SND]](/icons/sound2.gif) | top cops gamesong main.psid | 2018-01-02 16:12 | 3.1K | |
![[SND]](/icons/sound2.gif) | top it.psid | 2018-01-02 16:12 | 2.6K | |
![[SND]](/icons/sound2.gif) | trip.psid | 2018-01-02 16:12 | 3.1K | |
![[SND]](/icons/sound2.gif) | true story.psid | 2018-01-02 16:12 | 3.0K | |
![[SND]](/icons/sound2.gif) | twosongs (first).psid | 2018-01-02 16:12 | 3.4K | |
![[SND]](/icons/sound2.gif) | unicrom.psid | 2018-01-02 16:12 | 2.9K | |
![[SND]](/icons/sound2.gif) | vain-mixed.psid | 2018-01-02 16:12 | 4.3K | |
![[SND]](/icons/sound2.gif) | vandalism news (issue #18).psid | 2018-01-02 16:12 | 4.1K | |
![[SND]](/icons/sound2.gif) | violation #5 (tune 6).psid | 2018-01-02 16:12 | 2.4K | |
![[SND]](/icons/sound2.gif) | violation #5 (tune 8).psid | 2018-01-02 16:12 | 2.8K | |
![[SND]](/icons/sound2.gif) | violation #5 (tune 10).psid | 2018-01-02 16:12 | 2.6K | |
![[SND]](/icons/sound2.gif) | violation #6 (main).psid | 2018-01-02 16:12 | 3.3K | |
![[SND]](/icons/sound2.gif) | violation #6 (tune 1).psid | 2018-01-02 16:12 | 3.6K | |
![[SND]](/icons/sound2.gif) | violation #6 (tune 3).psid | 2018-01-02 16:12 | 3.5K | |
![[SND]](/icons/sound2.gif) | violation #6 (tune 7).psid | 2018-01-02 16:12 | 3.0K | |
![[SND]](/icons/sound2.gif) | visual wonders.psid | 2018-01-02 16:12 | 3.5K | |
![[SND]](/icons/sound2.gif) | voyage maintheme.psid | 2018-01-02 16:12 | 3.3K | |
![[SND]](/icons/sound2.gif) | voyage part2.psid | 2018-01-02 16:12 | 3.3K | |
![[SND]](/icons/sound2.gif) | waste of time.psid | 2018-01-02 16:12 | 3.4K | |
![[SND]](/icons/sound2.gif) | welcome home.psid | 2018-01-02 16:12 | 4.1K | |
![[SND]](/icons/sound2.gif) | what is this.psid | 2018-01-02 16:12 | 3.7K | |
![[SND]](/icons/sound2.gif) | wheels are turnin'.psid | 2018-01-02 16:12 | 3.8K | |
![[SND]](/icons/sound2.gif) | why, let's philosoffa.psid | 2018-01-02 16:12 | 3.1K | |
![[SND]](/icons/sound2.gif) | x-mas spirit.psid | 2018-01-02 16:12 | 3.9K | |
![[SND]](/icons/sound2.gif) | yet another test.psid | 2008-07-05 15:14 | 3.5K | |
|