![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[SND]](/icons/sound2.gif) | ace ii.psid | 2018-01-02 16:12 | 3.4K | |
![[SND]](/icons/sound2.gif) | action biker.psid | 2018-01-02 16:12 | 3.1K | |
![[SND]](/icons/sound2.gif) | bangkok knights.psid | 2018-12-09 11:12 | 4.2K | |
![[SND]](/icons/sound2.gif) | battle of britain.psid | 2018-01-02 16:12 | 4.1K | |
![[SND]](/icons/sound2.gif) | bump set spike.psid | 2018-12-09 11:12 | 4.1K | |
![[SND]](/icons/sound2.gif) | chain reaction.psid | 2018-01-02 16:12 | 3.3K | |
![[SND]](/icons/sound2.gif) | chicken song.psid | 2018-01-02 16:12 | 3.6K | |
![[SND]](/icons/sound2.gif) | commando.psid | 2008-07-05 15:13 | 4.0K | |
![[SND]](/icons/sound2.gif) | confuzion.psid | 2018-12-09 11:12 | 2.6K | |
![[DIR]](/icons/folder.gif) | coop-Ben Daglish/ | 2018-12-16 11:13 | - | |
![[DIR]](/icons/folder.gif) | coop-John York/ | 2008-07-05 15:13 | - | |
![[DIR]](/icons/folder.gif) | coop-Simon Nicol/ | 2008-07-05 15:13 | - | |
![[DIR]](/icons/folder.gif) | coop-Yip/ | 2008-07-05 15:13 | - | |
![[SND]](/icons/sound2.gif) | cracker mix.psid | 2008-07-05 15:13 | 2.8K | |
![[SND]](/icons/sound2.gif) | crazy comets.psid | 2018-01-02 16:12 | 4.4K | |
![[SND]](/icons/sound2.gif) | deep strike.psid | 2018-12-09 11:12 | 3.0K | |
![[SND]](/icons/sound2.gif) | delta.psid | 2018-12-09 11:12 | 5.1K | |
![[SND]](/icons/sound2.gif) | delta mix-e-load (loader).psid | 2018-12-09 11:12 | 3.6K | |
![[SND]](/icons/sound2.gif) | dragon's lair part ii.psid | 2018-12-09 11:12 | 7.9K | |
![[SND]](/icons/sound2.gif) | final synth sample i.psid | 2018-01-02 16:12 | 7.8K | |
![[SND]](/icons/sound2.gif) | final synth sample ii.psid | 2018-01-02 16:12 | 12K | |
![[SND]](/icons/sound2.gif) | flash gordon.psid | 2018-01-02 16:12 | 3.9K | |
![[SND]](/icons/sound2.gif) | food feud.psid | 2018-12-16 11:13 | 3.4K | |
![[SND]](/icons/sound2.gif) | formula 1 simulator.psid | 2018-12-16 11:13 | 3.3K | |
![[SND]](/icons/sound2.gif) | formula one.psid | 2008-07-05 15:13 | 2.9K | |
![[SND]](/icons/sound2.gif) | game killer.psid | 2018-12-16 11:13 | 2.8K | |
![[SND]](/icons/sound2.gif) | geoff capes strongman challenge.psid | 2018-12-09 11:12 | 3.3K | |
![[SND]](/icons/sound2.gif) | gerry the germ.psid | 2018-12-09 11:12 | 6.6K | |
![[SND]](/icons/sound2.gif) | harvey smith showjumping.psid | 2008-07-05 15:13 | 4.1K | |
![[SND]](/icons/sound2.gif) | hollywood or bust.psid | 2018-12-09 11:12 | 4.9K | |
![[SND]](/icons/sound2.gif) | hunter patrol.psid | 2018-12-09 11:12 | 3.7K | |
![[SND]](/icons/sound2.gif) | ik+.psid | 2008-07-05 15:13 | 4.5K | |
![[SND]](/icons/sound2.gif) | international karate.psid | 2018-12-09 11:12 | 4.6K | |
![[SND]](/icons/sound2.gif) | kentilla.psid | 2018-12-09 11:12 | 4.4K | |
![[SND]](/icons/sound2.gif) | kings of the beach (ingame).psid | 2018-01-02 16:12 | 2.8K | |
![[SND]](/icons/sound2.gif) | knucklebusters.psid | 2018-12-09 11:12 | 7.0K | |
![[SND]](/icons/sound2.gif) | las vegas video poker.psid | 2018-12-16 11:13 | 3.5K | |
![[SND]](/icons/sound2.gif) | lightforce.psid | 2018-12-09 11:12 | 3.6K | |
![[SND]](/icons/sound2.gif) | monty on the run.psid | 2018-12-09 11:12 | 5.6K | |
![[SND]](/icons/sound2.gif) | mozart.psid | 2018-12-16 11:13 | 4.1K | |
![[SND]](/icons/sound2.gif) | nemesis the warlock.psid | 2018-12-09 11:12 | 4.5K | |
![[SND]](/icons/sound2.gif) | nineteen.psid | 2018-12-09 11:12 | 3.6K | |
![[SND]](/icons/sound2.gif) | ninja.psid | 2018-01-02 16:12 | 2.1K | |
![[SND]](/icons/sound2.gif) | one-on-one 2.psid | 2008-07-05 15:13 | 24K | |
![[SND]](/icons/sound2.gif) | one man & his droid.psid | 2018-01-02 16:12 | 4.0K | |
![[SND]](/icons/sound2.gif) | pandora.psid | 2018-12-09 11:12 | 3.1K | |
![[SND]](/icons/sound2.gif) | phantoms of the asteroid.psid | 2018-01-02 16:12 | 4.1K | |
![[SND]](/icons/sound2.gif) | proteus.psid | 2018-12-09 11:12 | 3.5K | |
![[SND]](/icons/sound2.gif) | rasputin.psid | 2018-12-09 11:12 | 4.1K | |
![[SND]](/icons/sound2.gif) | saboteur ii.psid | 2018-12-09 11:12 | 3.1K | |
![[SND]](/icons/sound2.gif) | sanxion.psid | 2018-12-09 11:12 | 7.4K | |
![[SND]](/icons/sound2.gif) | sanxion remix.psid | 2008-07-05 15:13 | 3.7K | |
![[SND]](/icons/sound2.gif) | shockway rider.psid | 2018-12-09 11:12 | 4.2K | |
![[SND]](/icons/sound2.gif) | sigma seven.psid | 2018-12-09 11:12 | 2.0K | |
![[SND]](/icons/sound2.gif) | spellbound.psid | 2018-12-09 11:12 | 4.1K | |
![[SND]](/icons/sound2.gif) | star paws.psid | 2018-12-09 11:12 | 3.4K | |
![[SND]](/icons/sound2.gif) | synth sample iii.psid | 2018-01-02 16:12 | 15K | |
![[SND]](/icons/sound2.gif) | thanatos.psid | 2008-07-05 15:13 | 2.0K | |
![[SND]](/icons/sound2.gif) | the chicken song.psid | 2018-12-09 11:12 | 3.6K | |
![[SND]](/icons/sound2.gif) | the human race.psid | 2018-01-02 16:12 | 4.5K | |
![[SND]](/icons/sound2.gif) | the master of magic.psid | 2018-12-09 11:12 | 3.1K | |
![[SND]](/icons/sound2.gif) | thing on a spring.psid | 2018-12-09 11:12 | 3.8K | |
![[SND]](/icons/sound2.gif) | thrust.psid | 2018-12-09 11:12 | 3.6K | |
![[SND]](/icons/sound2.gif) | thundercats.psid | 2008-07-05 15:13 | 4.7K | |
![[SND]](/icons/sound2.gif) | trans-atlantic balloon challenge.psid | 2018-12-16 11:13 | 4.4K | |
![[SND]](/icons/sound2.gif) | trans atlantic balloon challenge.psid | 2018-01-02 16:12 | 4.4K | |
![[SND]](/icons/sound2.gif) | trans atlantic balloon chlng.psid | 2008-07-05 15:13 | 4.4K | |
![[SND]](/icons/sound2.gif) | up, up & away!.psid | 2018-01-02 16:12 | 2.4K | |
![[SND]](/icons/sound2.gif) | video poker.psid | 2008-07-05 15:13 | 3.5K | |
![[SND]](/icons/sound2.gif) | w.a.r. preview.psid | 2018-01-02 16:12 | 3.1K | |
![[SND]](/icons/sound2.gif) | w.a.r.psid | 2018-01-02 16:12 | 5.8K | |
![[SND]](/icons/sound2.gif) | warhawk.psid | 2018-12-09 11:12 | 4.0K | |
![[SND]](/icons/sound2.gif) | wiz.psid | 2018-12-09 11:12 | 4.1K | |
![[SND]](/icons/sound2.gif) | zoids.psid | 2018-12-09 11:12 | 2.7K | |
![[SND]](/icons/sound2.gif) | zoolook.psid | 2018-01-02 16:12 | 3.2K | |
|