![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[SND]](/icons/sound2.gif) | 4 trawnik magazine.psid | 2008-07-05 15:12 | 4.1K | |
![[SND]](/icons/sound2.gif) | 10 sekund intro.psid | 2018-12-09 11:12 | 3.3K | |
![[SND]](/icons/sound2.gif) | alien cat.psid | 2018-12-09 11:12 | 6.1K | |
![[SND]](/icons/sound2.gif) | amiga cover.psid | 2008-07-05 15:12 | 3.6K | |
![[SND]](/icons/sound2.gif) | anthology intro.psid | 2018-12-09 11:12 | 3.6K | |
![[SND]](/icons/sound2.gif) | anything.psid | 2008-07-05 15:12 | 3.4K | |
![[SND]](/icons/sound2.gif) | aquality.psid | 2018-12-09 11:12 | 4.5K | |
![[SND]](/icons/sound2.gif) | basic process.psid | 2008-07-05 15:12 | 3.5K | |
![[SND]](/icons/sound2.gif) | beat it.psid | 2018-12-09 11:12 | 4.1K | |
![[SND]](/icons/sound2.gif) | big rocaille.psid | 2008-07-05 15:12 | 3.5K | |
![[SND]](/icons/sound2.gif) | big surprise.psid | 2008-07-05 15:12 | 6.0K | |
![[SND]](/icons/sound2.gif) | blind love.psid | 2008-07-05 15:12 | 3.5K | |
![[SND]](/icons/sound2.gif) | blocks.psid | 2018-12-09 11:12 | 18K | |
![[SND]](/icons/sound2.gif) | brain defect 2.psid | 2018-12-09 11:12 | 4.7K | |
![[SND]](/icons/sound2.gif) | break.psid | 2018-12-09 11:12 | 3.6K | |
![[SND]](/icons/sound2.gif) | breathe dead.psid | 2018-12-09 11:12 | 5.3K | |
![[SND]](/icons/sound2.gif) | breek house.psid | 2018-12-09 11:12 | 6.7K | |
![[SND]](/icons/sound2.gif) | breitbandkatze (tune 1).psid | 2018-12-09 11:12 | 6.5K | |
![[SND]](/icons/sound2.gif) | breitbandkatze (tune 2).psid | 2018-12-09 11:12 | 6.7K | |
![[SND]](/icons/sound2.gif) | breitbandkatze notemusic.psid | 2018-12-09 11:12 | 4.8K | |
![[SND]](/icons/sound2.gif) | chapter 7.psid | 2008-07-05 15:12 | 4.0K | |
![[SND]](/icons/sound2.gif) | clasic mix.psid | 2018-12-09 11:12 | 4.7K | |
![[SND]](/icons/sound2.gif) | clouds.psid | 2018-12-09 11:12 | 5.8K | |
![[SND]](/icons/sound2.gif) | cola remix.psid | 2018-12-09 11:12 | 3.4K | |
![[SND]](/icons/sound2.gif) | cold turkey (loader).psid | 2018-12-09 11:12 | 3.6K | |
![[SND]](/icons/sound2.gif) | commercial break.psid | 2018-12-09 11:12 | 4.4K | |
![[DIR]](/icons/folder.gif) | coop-Daf/ | 2008-07-05 15:12 | - | |
![[DIR]](/icons/folder.gif) | coop-Echo/ | 2008-07-05 15:12 | - | |
![[DIR]](/icons/folder.gif) | coop-Kordiaukis/ | 2018-12-16 11:13 | - | |
![[DIR]](/icons/folder.gif) | coop-Wacek/ | 2018-12-16 11:13 | - | |
![[SND]](/icons/sound2.gif) | crazy rider.psid | 2008-07-05 15:12 | 3.9K | |
![[SND]](/icons/sound2.gif) | crime story.psid | 2008-07-05 15:12 | 3.5K | |
![[SND]](/icons/sound2.gif) | cristen.psid | 2018-12-09 11:12 | 3.0K | |
![[SND]](/icons/sound2.gif) | danger zone.psid | 2018-12-09 11:12 | 5.9K | |
![[SND]](/icons/sound2.gif) | dark garden.psid | 2018-12-09 11:12 | 3.3K | |
![[SND]](/icons/sound2.gif) | deadly feeling.psid | 2008-07-05 15:12 | 3.4K | |
![[SND]](/icons/sound2.gif) | deep down.psid | 2018-12-09 11:12 | 3.8K | |
![[SND]](/icons/sound2.gif) | destiny.psid | 2008-07-05 15:12 | 3.5K | |
![[SND]](/icons/sound2.gif) | detector.psid | 2018-12-09 11:12 | 3.5K | |
![[SND]](/icons/sound2.gif) | disability.psid | 2008-07-05 15:12 | 6.4K | |
![[SND]](/icons/sound2.gif) | does it hurt.psid | 2008-07-05 15:12 | 4.6K | |
![[SND]](/icons/sound2.gif) | dolly music.psid | 2008-07-05 15:12 | 3.8K | |
![[SND]](/icons/sound2.gif) | domination #06 5.psid | 2008-07-05 15:12 | 4.1K | |
![[SND]](/icons/sound2.gif) | drug sixtyfour.psid | 2008-07-05 15:12 | 3.6K | |
![[SND]](/icons/sound2.gif) | dust.psid | 2018-12-09 11:12 | 3.4K | |
![[SND]](/icons/sound2.gif) | een da haus.psid | 2018-12-09 11:12 | 4.1K | |
![[SND]](/icons/sound2.gif) | elec.orchest.psid | 2018-12-09 11:12 | 4.5K | |
![[SND]](/icons/sound2.gif) | electric ice-breaker.psid | 2008-07-05 15:12 | 3.6K | |
![[SND]](/icons/sound2.gif) | emergency.psid | 2018-12-09 11:12 | 3.5K | |
![[SND]](/icons/sound2.gif) | epilog.psid | 2018-12-09 11:12 | 3.1K | |
![[SND]](/icons/sound2.gif) | erotic techno.psid | 2008-07-05 15:12 | 3.1K | |
![[SND]](/icons/sound2.gif) | eunuchy.psid | 2008-07-05 15:12 | 3.6K | |
![[SND]](/icons/sound2.gif) | evil is back.psid | 2018-12-09 11:12 | 3.7K | |
![[SND]](/icons/sound2.gif) | exclusive.psid | 2018-12-09 11:12 | 5.1K | |
![[SND]](/icons/sound2.gif) | fairy cino.psid | 2018-12-09 11:12 | 3.4K | |
![[SND]](/icons/sound2.gif) | falling down.psid | 2008-07-05 15:12 | 3.6K | |
![[SND]](/icons/sound2.gif) | far away.psid | 2018-12-09 11:12 | 5.6K | |
![[SND]](/icons/sound2.gif) | fast tracks.psid | 2008-07-05 15:12 | 3.5K | |
![[SND]](/icons/sound2.gif) | feel the groovy rythms.psid | 2018-12-09 11:12 | 5.3K | |
![[SND]](/icons/sound2.gif) | flames (tune 1).psid | 2008-07-05 15:12 | 3.6K | |
![[SND]](/icons/sound2.gif) | flash out.psid | 2018-12-09 11:12 | 4.5K | |
![[SND]](/icons/sound2.gif) | flower soundtrack.psid | 2018-12-09 11:12 | 6.5K | |
![[SND]](/icons/sound2.gif) | for zeor.psid | 2018-12-09 11:12 | 4.7K | |
![[SND]](/icons/sound2.gif) | from amiga.psid | 2018-12-09 11:12 | 4.1K | |
![[SND]](/icons/sound2.gif) | funky.psid | 2018-12-09 11:12 | 4.6K | |
![[SND]](/icons/sound2.gif) | funny techno.psid | 2008-07-05 15:12 | 4.4K | |
![[SND]](/icons/sound2.gif) | get away!.psid | 2018-12-09 11:12 | 3.7K | |
![[SND]](/icons/sound2.gif) | get ready.psid | 2018-12-09 11:12 | 3.3K | |
![[SND]](/icons/sound2.gif) | gfx phobia.psid | 2018-12-09 11:12 | 5.3K | |
![[SND]](/icons/sound2.gif) | give it to me.psid | 2018-12-09 11:12 | 3.6K | |
![[SND]](/icons/sound2.gif) | goodbay poland.psid | 2008-07-05 15:12 | 3.9K | |
![[SND]](/icons/sound2.gif) | grass.psid | 2018-12-09 11:12 | 4.7K | |
![[SND]](/icons/sound2.gif) | guesser.psid | 2018-12-16 11:13 | 7.9K | |
![[SND]](/icons/sound2.gif) | guesser intro.psid | 2008-07-05 15:12 | 2.9K | |
![[SND]](/icons/sound2.gif) | hard break.psid | 2008-07-05 15:12 | 3.1K | |
![[SND]](/icons/sound2.gif) | have fun.psid | 2018-12-09 11:12 | 4.2K | |
![[SND]](/icons/sound2.gif) | high level.psid | 2018-12-09 11:12 | 5.2K | |
![[SND]](/icons/sound2.gif) | homesick.psid | 2008-07-05 15:12 | 5.5K | |
![[SND]](/icons/sound2.gif) | honestly guy.psid | 2008-07-05 15:12 | 6.0K | |
![[SND]](/icons/sound2.gif) | house trance.psid | 2018-12-09 11:12 | 4.2K | |
![[SND]](/icons/sound2.gif) | i'm losing you.psid | 2018-12-09 11:12 | 4.1K | |
![[SND]](/icons/sound2.gif) | i gotta poison.psid | 2018-12-09 11:12 | 3.1K | |
![[SND]](/icons/sound2.gif) | indicator.psid | 2018-12-09 11:12 | 4.8K | |
![[SND]](/icons/sound2.gif) | in my head.psid | 2018-12-09 11:12 | 8.7K | |
![[SND]](/icons/sound2.gif) | innerspace.psid | 2018-12-09 11:12 | 21K | |
![[SND]](/icons/sound2.gif) | intro fraction.psid | 2018-12-09 11:12 | 3.4K | |
![[SND]](/icons/sound2.gif) | invention.psid | 2018-12-09 11:12 | 5.4K | |
![[SND]](/icons/sound2.gif) | j. s. bach.psid | 2008-07-05 15:12 | 3.3K | |
![[SND]](/icons/sound2.gif) | jungle fever.psid | 2018-12-09 11:12 | 6.2K | |
![[SND]](/icons/sound2.gif) | just walk along with your jazz.psid | 2018-12-09 11:12 | 4.0K | |
![[SND]](/icons/sound2.gif) | kick up.psid | 2008-07-05 15:12 | 3.7K | |
![[SND]](/icons/sound2.gif) | la fusiona de dangera.psid | 2018-12-09 11:12 | 3.7K | |
![[SND]](/icons/sound2.gif) | lazy head (part 1).psid | 2018-12-09 11:12 | 3.3K | |
![[SND]](/icons/sound2.gif) | lazy head (part 2).psid | 2018-12-09 11:12 | 3.6K | |
![[SND]](/icons/sound2.gif) | lazy heads (part 1).psid | 2008-07-05 15:12 | 3.3K | |
![[SND]](/icons/sound2.gif) | lazy heads (part 2).psid | 2008-07-05 15:12 | 3.6K | |
![[SND]](/icons/sound2.gif) | life plus.psid | 2018-12-09 11:12 | 5.1K | |
![[SND]](/icons/sound2.gif) | little tune.psid | 2018-12-09 11:12 | 3.5K | |
![[SND]](/icons/sound2.gif) | lojenie sake.psid | 2018-12-09 11:12 | 4.2K | |
![[SND]](/icons/sound2.gif) | longlife.psid | 2018-12-09 11:12 | 7.5K | |
![[SND]](/icons/sound2.gif) | loptuk gecik.psid | 2008-07-05 15:12 | 3.5K | |
![[SND]](/icons/sound2.gif) | lost fantasy.psid | 2018-12-09 11:12 | 5.5K | |
![[SND]](/icons/sound2.gif) | lost in minds.psid | 2018-12-09 11:12 | 3.6K | |
![[SND]](/icons/sound2.gif) | lovely face.psid | 2018-12-09 11:12 | 3.9K | |
![[SND]](/icons/sound2.gif) | main fraction.psid | 2008-07-05 15:12 | 5.4K | |
![[SND]](/icons/sound2.gif) | make a guess.psid | 2018-12-09 11:12 | 4.6K | |
![[SND]](/icons/sound2.gif) | make peace.psid | 2008-07-05 15:12 | 4.6K | |
![[SND]](/icons/sound2.gif) | manual vision.psid | 2018-12-09 11:12 | 4.3K | |
![[SND]](/icons/sound2.gif) | mega mix.psid | 2018-12-16 11:13 | 11K | |
![[SND]](/icons/sound2.gif) | melography end.psid | 2018-12-09 11:12 | 5.5K | |
![[SND]](/icons/sound2.gif) | melography main.psid | 2018-12-09 11:12 | 4.4K | |
![[SND]](/icons/sound2.gif) | memory.psid | 2008-07-05 15:12 | 5.5K | |
![[SND]](/icons/sound2.gif) | menchour.psid | 2018-12-09 11:12 | 3.7K | |
![[SND]](/icons/sound2.gif) | message unknown.psid | 2018-12-09 11:12 | 4.4K | |
![[SND]](/icons/sound2.gif) | micro tune.psid | 2008-07-05 15:12 | 3.3K | |
![[SND]](/icons/sound2.gif) | mindriot.psid | 2018-12-09 11:12 | 6.3K | |
![[SND]](/icons/sound2.gif) | modo cover.psid | 2018-12-09 11:12 | 3.3K | |
![[SND]](/icons/sound2.gif) | motherfucker.psid | 2018-12-09 11:12 | 5.5K | |
![[SND]](/icons/sound2.gif) | movie world (part 2).psid | 2018-12-09 11:12 | 7.4K | |
![[SND]](/icons/sound2.gif) | movie world (part 3).psid | 2018-12-09 11:12 | 6.8K | |
![[SND]](/icons/sound2.gif) | na co komu dzis.psid | 2018-12-09 11:12 | 4.2K | |
![[SND]](/icons/sound2.gif) | nearly minute of pure music.psid | 2018-12-09 11:12 | 4.1K | |
![[SND]](/icons/sound2.gif) | night scream.psid | 2008-07-05 15:12 | 3.9K | |
![[SND]](/icons/sound2.gif) | n of fear.psid | 2018-12-09 11:12 | 3.9K | |
![[SND]](/icons/sound2.gif) | no good.psid | 2018-12-09 11:12 | 6.1K | |
![[SND]](/icons/sound2.gif) | no i co jest kurwa.psid | 2018-12-09 11:12 | 4.0K | |
![[SND]](/icons/sound2.gif) | no mercy.psid | 2008-07-05 15:12 | 4.8K | |
![[SND]](/icons/sound2.gif) | no women no cry.psid | 2008-07-05 15:12 | 3.7K | |
![[SND]](/icons/sound2.gif) | ocean rythms.psid | 2008-07-05 15:12 | 4.4K | |
![[SND]](/icons/sound2.gif) | on the death track.psid | 2008-07-05 15:12 | 4.7K | |
![[SND]](/icons/sound2.gif) | orange sun.psid | 2018-12-09 11:12 | 4.9K | |
![[SND]](/icons/sound2.gif) | overfall.psid | 2008-07-05 15:12 | 5.2K | |
![[SND]](/icons/sound2.gif) | padge.psid | 2018-12-09 11:12 | 4.7K | |
![[SND]](/icons/sound2.gif) | petrov demo.psid | 2008-07-05 15:12 | 4.1K | |
![[SND]](/icons/sound2.gif) | phantom.psid | 2018-12-09 11:12 | 5.8K | |
![[SND]](/icons/sound2.gif) | pokemony sa wsrod nas.psid | 2018-12-09 11:12 | 5.3K | |
![[SND]](/icons/sound2.gif) | poolover.psid | 2018-12-09 11:12 | 5.0K | |
![[SND]](/icons/sound2.gif) | praiser 01.psid | 2018-01-02 16:12 | 4.0K | |
![[SND]](/icons/sound2.gif) | project 0-512.psid | 2018-12-09 11:12 | 4.4K | |
![[SND]](/icons/sound2.gif) | proof.psid | 2018-12-09 11:12 | 5.4K | |
![[SND]](/icons/sound2.gif) | psychodelic killer.psid | 2018-12-09 11:12 | 5.9K | |
![[SND]](/icons/sound2.gif) | pszczlka maja.psid | 2018-01-02 16:12 | 4.1K | |
![[SND]](/icons/sound2.gif) | pszczolka maja (5x).psid | 2018-12-09 11:12 | 3.7K | |
![[SND]](/icons/sound2.gif) | pszczolka maja.psid | 2018-12-09 11:12 | 4.1K | |
![[SND]](/icons/sound2.gif) | racer.psid | 2018-12-09 11:12 | 3.2K | |
![[SND]](/icons/sound2.gif) | raising sun.psid | 2008-07-05 15:12 | 3.8K | |
![[SND]](/icons/sound2.gif) | reggae.psid | 2008-07-05 15:12 | 3.2K | |
![[SND]](/icons/sound2.gif) | relaxed style.psid | 2008-07-05 15:12 | 4.1K | |
![[SND]](/icons/sound2.gif) | rendall.psid | 2018-12-09 11:12 | 4.0K | |
![[SND]](/icons/sound2.gif) | retted flax.psid | 2018-12-09 11:12 | 6.1K | |
![[SND]](/icons/sound2.gif) | reversi.psid | 2018-12-09 11:12 | 13K | |
![[SND]](/icons/sound2.gif) | run it.psid | 2018-12-09 11:12 | 6.1K | |
![[SND]](/icons/sound2.gif) | run me out.psid | 2018-12-09 11:12 | 3.5K | |
![[SND]](/icons/sound2.gif) | run out from the earth.psid | 2018-12-09 11:12 | 4.2K | |
![[SND]](/icons/sound2.gif) | ryan.psid | 2008-07-05 15:12 | 7.0K | |
![[SND]](/icons/sound2.gif) | sad man.psid | 2018-12-09 11:12 | 4.1K | |
![[SND]](/icons/sound2.gif) | sansui.psid | 2018-12-09 11:12 | 2.8K | |
![[SND]](/icons/sound2.gif) | saudi tune.psid | 2008-07-05 15:12 | 4.3K | |
![[SND]](/icons/sound2.gif) | short shit.psid | 2008-07-05 15:12 | 3.4K | |
![[SND]](/icons/sound2.gif) | sid extension.psid | 2018-12-09 11:12 | 3.0K | |
![[SND]](/icons/sound2.gif) | smach.psid | 2018-12-09 11:12 | 3.5K | |
![[SND]](/icons/sound2.gif) | soft string.psid | 2018-12-09 11:12 | 4.7K | |
![[SND]](/icons/sound2.gif) | soul.psid | 2018-12-09 11:12 | 4.6K | |
![[SND]](/icons/sound2.gif) | sound image.psid | 2018-12-09 11:12 | 3.6K | |
![[SND]](/icons/sound2.gif) | soundtrack (for domination #06).psid | 2008-07-05 15:12 | 3.5K | |
![[SND]](/icons/sound2.gif) | stay in crunch.psid | 2018-12-09 11:12 | 3.4K | |
![[SND]](/icons/sound2.gif) | strange.psid | 2008-07-05 15:12 | 3.3K | |
![[SND]](/icons/sound2.gif) | stunning view at the window.psid | 2018-12-09 11:12 | 4.6K | |
![[SND]](/icons/sound2.gif) | summer day.psid | 2018-12-09 11:12 | 5.5K | |
![[SND]](/icons/sound2.gif) | summer mix.psid | 2018-12-09 11:12 | 4.2K | |
![[SND]](/icons/sound2.gif) | sunday phobes.psid | 2018-12-09 11:12 | 7.2K | |
![[SND]](/icons/sound2.gif) | superb!.psid | 2018-12-09 11:12 | 6.6K | |
![[SND]](/icons/sound2.gif) | super gut.psid | 2008-07-05 15:12 | 2.9K | |
![[SND]](/icons/sound2.gif) | super nova.psid | 2018-12-09 11:12 | 3.5K | |
![[SND]](/icons/sound2.gif) | sweet noise (note).psid | 2018-12-16 11:13 | 4.1K | |
![[SND]](/icons/sound2.gif) | synth of sword.psid | 2018-12-09 11:12 | 3.9K | |
![[SND]](/icons/sound2.gif) | t.h. techno.psid | 2008-07-05 15:12 | 3.3K | |
![[SND]](/icons/sound2.gif) | tears in glory.psid | 2008-07-05 15:12 | 3.9K | |
![[SND]](/icons/sound2.gif) | technet 2.psid | 2008-07-05 15:12 | 2.6K | |
![[SND]](/icons/sound2.gif) | techno mix.psid | 2018-12-09 11:12 | 4.0K | |
![[SND]](/icons/sound2.gif) | technowave.psid | 2018-12-09 11:12 | 4.2K | |
![[SND]](/icons/sound2.gif) | the lands.psid | 2008-07-05 15:12 | 3.8K | |
![[SND]](/icons/sound2.gif) | theptak (end).psid | 2018-12-09 11:12 | 3.1K | |
![[SND]](/icons/sound2.gif) | theptak (part 2).psid | 2018-12-09 11:12 | 3.2K | |
![[SND]](/icons/sound2.gif) | theptak (the end).psid | 2008-07-05 15:12 | 3.1K | |
![[SND]](/icons/sound2.gif) | throw up.psid | 2008-07-05 15:12 | 4.0K | |
![[SND]](/icons/sound2.gif) | tiamat's theme.psid | 2008-07-05 15:12 | 5.8K | |
![[SND]](/icons/sound2.gif) | tico-tico.psid | 2008-07-05 15:12 | 4.5K | |
![[SND]](/icons/sound2.gif) | trithema.psid | 2008-07-05 15:12 | 4.2K | |
![[SND]](/icons/sound2.gif) | turn up.psid | 2018-12-09 11:12 | 3.2K | |
![[SND]](/icons/sound2.gif) | ucieczka.psid | 2018-12-09 11:12 | 2.8K | |
![[SND]](/icons/sound2.gif) | ucieczka z tropiku.psid | 2008-07-05 15:12 | 4.9K | |
![[SND]](/icons/sound2.gif) | unarmed.psid | 2008-07-05 15:12 | 4.4K | |
![[SND]](/icons/sound2.gif) | unnamed.psid | 2018-12-16 11:13 | 4.0K | |
![[SND]](/icons/sound2.gif) | unreality dreams.psid | 2018-12-09 11:12 | 4.6K | |
![[SND]](/icons/sound2.gif) | unreliable.psid | 2008-07-05 15:12 | 3.7K | |
![[SND]](/icons/sound2.gif) | upside down.psid | 2018-12-09 11:12 | 39K | |
![[SND]](/icons/sound2.gif) | uuhh... nie pierdol.psid | 2018-12-09 11:12 | 5.4K | |
![[SND]](/icons/sound2.gif) | vibrations.psid | 2008-07-05 15:12 | 4.4K | |
![[SND]](/icons/sound2.gif) | virtuous exhibition.psid | 2018-12-09 11:12 | 4.5K | |
![[SND]](/icons/sound2.gif) | vitality #2 (intro).psid | 2008-07-05 15:12 | 3.7K | |
![[SND]](/icons/sound2.gif) | wave back (intro).psid | 2008-07-05 15:12 | 3.7K | |
![[SND]](/icons/sound2.gif) | wave back (note).psid | 2018-12-09 11:12 | 3.8K | |
![[SND]](/icons/sound2.gif) | wave back.psid | 2018-12-09 11:12 | 6.6K | |
![[SND]](/icons/sound2.gif) | way of life.psid | 2018-12-09 11:12 | 4.0K | |
![[SND]](/icons/sound2.gif) | what happened to you.psid | 2018-12-09 11:12 | 4.0K | |
![[SND]](/icons/sound2.gif) | without wonder.psid | 2008-07-05 15:12 | 3.3K | |
![[SND]](/icons/sound2.gif) | x-mas.psid | 2018-12-09 11:12 | 3.8K | |
![[SND]](/icons/sound2.gif) | x.psid | 2018-12-09 11:12 | 4.1K | |
![[SND]](/icons/sound2.gif) | xenophobia.psid | 2008-07-05 15:12 | 4.1K | |
|