![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[SND]](/icons/sound2.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| wind of change.psid | 2010-02-28 13:58 | 3.1K | |
| vag.psid | 2019-08-24 07:23 | 3.3K | |
| uranium dioxide.psid | 2010-02-28 13:58 | 4.1K | |
| trance introzak.psid | 2010-02-28 13:58 | 3.2K | |
| the vagabonds groove.psid | 2008-07-05 15:12 | 3.5K | |
| the underground-rock.psid | 2008-07-05 15:12 | 3.4K | |
| the rumour land.psid | 2008-07-05 15:12 | 3.9K | |
| the musical news.psid | 2008-07-05 15:12 | 8.1K | |
| the lunatic trashcan.psid | 2008-07-05 15:12 | 6.7K | |
| the cowboy song #2.psid | 2008-07-05 15:12 | 11K | |
| sonlasarka dunti.psid | 2010-02-28 13:58 | 6.9K | |
| some genetic jazz.psid | 2018-12-16 11:13 | 3.0K | |
| session tune.psid | 2010-02-28 13:58 | 7.2K | |
| rock around the block.psid | 2018-12-09 11:12 | 12K | |
| rhythm of life.psid | 2018-12-09 11:12 | 12K | |
| raped sid.psid | 2010-02-28 13:58 | 3.9K | |
| pocket funk.psid | 2010-02-28 13:58 | 2.6K | |
| peaceful beauty.psid | 2010-02-28 13:58 | 3.7K | |
| odipus.psid | 2018-12-09 11:12 | 12K | |
| nameless horror.psid | 2010-02-28 13:58 | 7.7K | |
| mother's little arpeggio.psid | 2008-07-05 15:12 | 3.6K | |
| melt your brain.psid | 2010-02-28 13:58 | 3.9K | |
| mega put.psid | 2010-02-28 13:58 | 3.7K | |
| lords of synthesis.psid | 2018-01-02 16:12 | 6.5K | |
| load the power.psid | 2018-01-02 16:12 | 5.7K | |
| lax' up.psid | 2008-07-05 15:12 | 3.9K | |
| laser beat.psid | 2018-12-09 11:12 | 12K | |
| jingle from the ''lenor'' advert.psid | 2008-07-05 15:12 | 3.0K | |
| henry (level 1).psid | 2008-07-05 15:12 | 3.5K | |
| happy cadaver.psid | 2018-12-09 11:12 | 12K | |
| happy birthday.psid | 2010-02-28 13:58 | 2.4K | |
| hallucinations (preview).psid | 2009-05-26 03:43 | 3.6K | |
| genetic jazz.psid | 2010-02-28 13:58 | 3.0K | |
| fur claudia.psid | 2018-12-09 11:12 | 12K | |
| eternal sadness.psid | 2010-02-28 13:58 | 6.3K | |
| dream in space.psid | 2018-12-09 11:12 | 16K | |
| dancing a-head.psid | 2010-02-28 13:58 | 3.6K | |
| cool is fool!.psid | 2008-07-05 15:12 | 2.8K | |
| chords of endlessness.psid | 2018-01-02 16:12 | 8.6K | |
| chips in music.psid | 2018-01-02 16:12 | 3.2K | |
| bass fever.psid | 2018-12-09 11:12 | 12K | |
| baroque parting.psid | 2010-02-28 13:58 | 2.6K | |
| baroque parting (zero page).psid | 2008-07-05 15:12 | 1.9K | |
| back to the future iii.psid | 2010-02-28 13:58 | 5.7K | |
| back to the future iii-title.psid | 2018-01-02 16:12 | 5.7K | |
| bach's domain.psid | 2019-08-24 07:23 | 4.1K | |
| autumn beach.psid | 2010-02-28 13:58 | 9.0K | |
| ancient property.psid | 2010-02-28 13:58 | 6.5K | |
| a groovy night.psid | 2010-02-28 13:58 | 3.5K | |
| ''winter'' from the four seasons.psid | 2008-07-05 15:12 | 2.6K | |