![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|---|
|
|---|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[SND]](/icons/sound2.gif) | absolutely.psid | 2008-07-05 15:11 | 5.3K | |
| at the club.psid | 2018-12-09 11:12 | 2.5K | |
| charlene (i'm right behind you).psid | 2018-01-02 16:12 | 2.7K | |
| fragments.psid | 2008-07-05 15:11 | 3.2K | |
| happy sprite.psid | 2008-07-05 15:11 | 3.9K | |
| hexa.psid | 2008-07-05 15:11 | 4.4K | |
| i wish to sleep.psid | 2018-01-02 16:12 | 3.5K | |
| last lap.psid | 2008-07-05 15:11 | 3.4K | |
| pause to frame.psid | 2018-01-02 16:12 | 3.6K | |
| spectre snare.psid | 2008-07-05 15:11 | 3.5K | |
| the happy sprite.psid | 2018-12-16 11:13 | 3.9K | |
| the last lap.psid | 2018-12-16 11:13 | 3.4K | |
| this strange reaction.psid | 2008-07-05 15:11 | 3.9K | |
| ultimate.psid | 2018-12-09 11:12 | 3.0K | |
| what we had.psid | 2008-07-05 15:11 | 4.7K | |
|
|---|