![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[SND]](/icons/sound2.gif) | 1 lap to go.psid | 2018-01-02 16:12 | 1.9K | |
![[SND]](/icons/sound2.gif) | 1 world not 3.psid | 2008-07-05 15:11 | 1.9K | |
![[SND]](/icons/sound2.gif) | 8 days a week (mix).psid | 2018-01-02 16:12 | 2.6K | |
![[SND]](/icons/sound2.gif) | 9 to 5.psid | 2008-07-05 15:11 | 2.3K | |
![[SND]](/icons/sound2.gif) | aced.psid | 2008-07-05 15:11 | 1.9K | |
![[SND]](/icons/sound2.gif) | achilles.psid | 2018-12-09 11:12 | 1.8K | |
![[SND]](/icons/sound2.gif) | acquiesce.psid | 2008-07-05 15:11 | 2.6K | |
![[SND]](/icons/sound2.gif) | adagio.psid | 2008-07-05 15:11 | 3.4K | |
![[SND]](/icons/sound2.gif) | adobe.psid | 2008-07-05 15:11 | 4.0K | |
![[SND]](/icons/sound2.gif) | adventure.psid | 2008-07-05 15:11 | 2.1K | |
![[SND]](/icons/sound2.gif) | afegafed.psid | 2008-07-05 15:11 | 3.4K | |
![[SND]](/icons/sound2.gif) | afternoon.psid | 2018-12-09 11:12 | 1.8K | |
![[SND]](/icons/sound2.gif) | against all odds.psid | 2008-07-05 15:11 | 2.1K | |
![[SND]](/icons/sound2.gif) | aggro.psid | 2008-07-05 15:11 | 2.3K | |
![[SND]](/icons/sound2.gif) | agog.psid | 2018-12-09 11:12 | 2.3K | |
![[SND]](/icons/sound2.gif) | a hard day's night.psid | 2008-07-05 15:11 | 3.4K | |
![[SND]](/icons/sound2.gif) | alfafa.psid | 2008-07-05 15:11 | 2.1K | |
![[SND]](/icons/sound2.gif) | alice what's the matter.psid | 2018-01-02 16:12 | 3.5K | |
![[SND]](/icons/sound2.gif) | alive.psid | 2008-07-05 15:11 | 2.6K | |
![[SND]](/icons/sound2.gif) | all by myself.psid | 2018-01-02 16:12 | 2.5K | |
![[SND]](/icons/sound2.gif) | all my loving.psid | 2008-07-05 15:11 | 3.0K | |
![[SND]](/icons/sound2.gif) | all right now.psid | 2008-07-05 15:11 | 4.1K | |
![[SND]](/icons/sound2.gif) | all you need is love.psid | 2008-07-05 15:11 | 2.8K | |
![[SND]](/icons/sound2.gif) | alpine.psid | 2018-12-09 11:12 | 2.0K | |
![[SND]](/icons/sound2.gif) | amplex.psid | 2008-07-05 15:11 | 3.2K | |
![[SND]](/icons/sound2.gif) | andante.psid | 2008-07-05 15:11 | 1.8K | |
![[SND]](/icons/sound2.gif) | angela.psid | 2008-07-05 15:11 | 2.1K | |
![[SND]](/icons/sound2.gif) | another one bites the dust.psid | 2018-01-02 16:12 | 3.2K | |
![[SND]](/icons/sound2.gif) | another world (end).psid | 2008-07-05 15:11 | 2.5K | |
![[SND]](/icons/sound2.gif) | another world (intro).psid | 2008-07-05 15:11 | 3.6K | |
![[SND]](/icons/sound2.gif) | another world (main).psid | 2008-07-05 15:11 | 2.1K | |
![[SND]](/icons/sound2.gif) | apathy.psid | 2008-07-05 15:11 | 3.5K | |
![[SND]](/icons/sound2.gif) | arabian.psid | 2008-07-05 15:11 | 2.6K | |
![[SND]](/icons/sound2.gif) | arpegiateur.psid | 2008-07-05 15:11 | 2.6K | |
![[SND]](/icons/sound2.gif) | a sermon.psid | 2008-07-05 15:11 | 2.7K | |
![[SND]](/icons/sound2.gif) | at the hop.psid | 2018-01-02 16:12 | 2.2K | |
![[SND]](/icons/sound2.gif) | auf wiedersehen pet.psid | 2008-07-05 15:11 | 2.3K | |
![[SND]](/icons/sound2.gif) | autumn.psid | 2008-07-05 15:11 | 2.1K | |
![[SND]](/icons/sound2.gif) | ay-ok.psid | 2018-12-09 11:12 | 2.2K | |
![[SND]](/icons/sound2.gif) | baby it's you.psid | 2008-07-05 15:11 | 3.1K | |
![[SND]](/icons/sound2.gif) | back in the ussr.psid | 2018-01-02 16:12 | 3.9K | |
![[SND]](/icons/sound2.gif) | back to the 80's.psid | 2018-12-16 11:13 | 2.0K | |
![[SND]](/icons/sound2.gif) | back to the 80s.psid | 2008-07-05 15:11 | 2.0K | |
![[SND]](/icons/sound2.gif) | badhead.psid | 2008-07-05 15:11 | 2.7K | |
![[SND]](/icons/sound2.gif) | baggy trousers'99.psid | 2008-07-05 15:11 | 4.1K | |
![[SND]](/icons/sound2.gif) | baggy trousers.psid | 2008-07-05 15:11 | 2.8K | |
![[SND]](/icons/sound2.gif) | bang'99 remix.psid | 2008-07-05 15:11 | 2.2K | |
![[SND]](/icons/sound2.gif) | bang.psid | 2018-12-09 11:12 | 2.2K | |
![[SND]](/icons/sound2.gif) | bank holiday.psid | 2008-07-05 15:11 | 2.2K | |
![[SND]](/icons/sound2.gif) | banshee.psid | 2008-07-05 15:11 | 3.3K | |
![[SND]](/icons/sound2.gif) | baroque.psid | 2008-07-05 15:11 | 2.3K | |
![[SND]](/icons/sound2.gif) | barren land.psid | 2008-07-05 15:11 | 2.3K | |
![[SND]](/icons/sound2.gif) | basket case.psid | 2008-07-05 15:11 | 3.6K | |
![[SND]](/icons/sound2.gif) | bead.psid | 2008-07-05 15:11 | 3.4K | |
![[SND]](/icons/sound2.gif) | bed's too big without you.psid | 2008-07-05 15:11 | 2.8K | |
![[SND]](/icons/sound2.gif) | beg.psid | 2018-12-09 11:12 | 1.9K | |
![[SND]](/icons/sound2.gif) | beginning.psid | 2008-07-05 15:11 | 2.1K | |
![[SND]](/icons/sound2.gif) | behind my camel.psid | 2008-07-05 15:11 | 1.8K | |
![[SND]](/icons/sound2.gif) | be my girl.psid | 2008-07-05 15:11 | 2.0K | |
![[SND]](/icons/sound2.gif) | best days.psid | 2018-12-09 11:12 | 3.0K | |
![[SND]](/icons/sound2.gif) | beta.psid | 2018-12-09 11:12 | 2.0K | |
![[SND]](/icons/sound2.gif) | birthday.psid | 2008-07-05 15:11 | 3.2K | |
![[SND]](/icons/sound2.gif) | blackbird.psid | 2008-07-05 15:11 | 2.6K | |
![[SND]](/icons/sound2.gif) | bleak.psid | 2008-07-05 15:11 | 2.1K | |
![[SND]](/icons/sound2.gif) | bliss.psid | 2018-12-09 11:12 | 2.3K | |
![[SND]](/icons/sound2.gif) | bohemian rhapsody.psid | 2008-07-05 15:11 | 5.8K | |
![[SND]](/icons/sound2.gif) | bombs away.psid | 2008-07-05 15:11 | 2.1K | |
![[SND]](/icons/sound2.gif) | bonus bit.psid | 2008-07-05 15:11 | 3.7K | |
![[SND]](/icons/sound2.gif) | borderline.psid | 2008-07-05 15:11 | 3.5K | |
![[SND]](/icons/sound2.gif) | born in the 50's.psid | 2008-07-05 15:11 | 2.5K | |
![[SND]](/icons/sound2.gif) | born under a bad sign.psid | 2008-07-05 15:11 | 2.4K | |
![[SND]](/icons/sound2.gif) | bouncy.psid | 2008-07-05 15:11 | 2.2K | |
![[SND]](/icons/sound2.gif) | bouncy loader.psid | 2018-12-09 11:12 | 1.9K | |
![[SND]](/icons/sound2.gif) | bouree.psid | 2008-07-05 15:11 | 2.1K | |
![[SND]](/icons/sound2.gif) | brand new year.psid | 2008-07-05 15:11 | 2.0K | |
![[SND]](/icons/sound2.gif) | breaker (original mix).psid | 2008-07-05 15:11 | 2.0K | |
![[SND]](/icons/sound2.gif) | breaker (tom-tom mix).psid | 2008-07-05 15:11 | 2.2K | |
![[SND]](/icons/sound2.gif) | breaker (x-files 1996 remix).psid | 2008-07-05 15:11 | 2.3K | |
![[SND]](/icons/sound2.gif) | breezy.psid | 2008-07-05 15:11 | 2.5K | |
![[SND]](/icons/sound2.gif) | bring it on down.psid | 2018-01-02 16:12 | 3.8K | |
![[SND]](/icons/sound2.gif) | bring on the night.psid | 2018-01-02 16:12 | 2.2K | |
![[SND]](/icons/sound2.gif) | burnage.psid | 2008-07-05 15:11 | 3.6K | |
![[SND]](/icons/sound2.gif) | burnout.psid | 2008-07-05 15:11 | 2.8K | |
![[SND]](/icons/sound2.gif) | busy lizzie.psid | 2008-07-05 15:11 | 2.3K | |
![[SND]](/icons/sound2.gif) | buzz-saw.psid | 2008-07-05 15:11 | 2.6K | |
![[SND]](/icons/sound2.gif) | cab.psid | 2008-07-05 15:11 | 2.0K | |
![[SND]](/icons/sound2.gif) | cafe au lait (version 1).psid | 2008-07-05 15:11 | 2.4K | |
![[SND]](/icons/sound2.gif) | cafe au lait (version 2).psid | 2008-07-05 15:11 | 2.4K | |
![[SND]](/icons/sound2.gif) | cafe au lait.psid | 2018-01-02 16:12 | 2.4K | |
![[SND]](/icons/sound2.gif) | caffeine (original version).psid | 2008-07-05 15:11 | 2.2K | |
![[SND]](/icons/sound2.gif) | caffeine+ (remix).psid | 2008-07-05 15:11 | 2.3K | |
![[SND]](/icons/sound2.gif) | caffeine.psid | 2008-07-05 15:11 | 2.3K | |
![[SND]](/icons/sound2.gif) | caged bird.psid | 2008-07-05 15:11 | 3.1K | |
![[SND]](/icons/sound2.gif) | callisto.psid | 2008-07-05 15:11 | 2.3K | |
![[SND]](/icons/sound2.gif) | calm.psid | 2008-07-05 15:11 | 3.2K | |
![[SND]](/icons/sound2.gif) | can't buy me love.psid | 2008-07-05 15:11 | 3.9K | |
![[SND]](/icons/sound2.gif) | can't stand losing you.psid | 2008-07-05 15:11 | 2.9K | |
![[SND]](/icons/sound2.gif) | canary in a coalmine.psid | 2008-07-05 15:11 | 2.7K | |
![[SND]](/icons/sound2.gif) | canyonero theme.psid | 2008-07-05 15:11 | 3.4K | |
![[SND]](/icons/sound2.gif) | caprice (early version).psid | 2008-07-05 15:11 | 2.5K | |
![[SND]](/icons/sound2.gif) | caprice.psid | 2008-07-05 15:11 | 3.8K | |
![[SND]](/icons/sound2.gif) | cardiac arrest.psid | 2008-07-05 15:11 | 2.5K | |
![[SND]](/icons/sound2.gif) | cascade.psid | 2018-12-09 11:12 | 3.5K | |
![[SND]](/icons/sound2.gif) | cashew.psid | 2008-07-05 15:11 | 3.6K | |
![[SND]](/icons/sound2.gif) | castaway on a desert island.psid | 2008-07-05 15:11 | 2.2K | |
![[SND]](/icons/sound2.gif) | cast no shadow.psid | 2008-07-05 15:11 | 3.9K | |
![[SND]](/icons/sound2.gif) | cast no shadow mix.psid | 2008-07-05 15:11 | 3.9K | |
![[SND]](/icons/sound2.gif) | challenge.psid | 2018-12-09 11:12 | 2.1K | |
![[SND]](/icons/sound2.gif) | champagne supernova (edit).psid | 2008-07-05 15:11 | 4.5K | |
![[SND]](/icons/sound2.gif) | champagne supernova.psid | 2008-07-05 15:11 | 4.5K | |
![[SND]](/icons/sound2.gif) | charlie brown.psid | 2008-07-05 15:11 | 3.4K | |
![[SND]](/icons/sound2.gif) | charmless man.psid | 2008-07-05 15:11 | 3.3K | |
![[SND]](/icons/sound2.gif) | chasing cars.psid | 2018-01-02 16:12 | 4.1K | |
![[SND]](/icons/sound2.gif) | chemical world.psid | 2008-07-05 15:11 | 2.7K | |
![[SND]](/icons/sound2.gif) | chimes'99.psid | 2008-07-05 15:11 | 3.3K | |
![[SND]](/icons/sound2.gif) | chimes 97.psid | 2018-12-09 11:12 | 2.4K | |
![[SND]](/icons/sound2.gif) | choosey.psid | 2008-07-05 15:11 | 3.6K | |
![[SND]](/icons/sound2.gif) | chorus.psid | 2008-07-05 15:11 | 2.6K | |
![[SND]](/icons/sound2.gif) | chump.psid | 2008-07-05 15:11 | 3.1K | |
![[SND]](/icons/sound2.gif) | cigarettes & alcohol.psid | 2008-07-05 15:11 | 4.6K | |
![[SND]](/icons/sound2.gif) | cigarettes & alcohol mix.psid | 2008-07-05 15:11 | 4.6K | |
![[SND]](/icons/sound2.gif) | clan (8580).psid | 2008-07-05 15:11 | 1.9K | |
![[SND]](/icons/sound2.gif) | classical (version 2).psid | 2008-07-05 15:11 | 2.0K | |
![[SND]](/icons/sound2.gif) | clear sky.psid | 2008-07-05 15:11 | 2.1K | |
![[SND]](/icons/sound2.gif) | cliche.psid | 2018-12-09 11:12 | 2.2K | |
![[SND]](/icons/sound2.gif) | clocks.psid | 2008-07-05 15:11 | 3.6K | |
![[SND]](/icons/sound2.gif) | closed circuit.psid | 2008-07-05 15:11 | 2.1K | |
![[SND]](/icons/sound2.gif) | cloud 9.psid | 2008-07-05 15:11 | 2.1K | |
![[SND]](/icons/sound2.gif) | cloudburst.psid | 2008-07-05 15:11 | 2.6K | |
![[SND]](/icons/sound2.gif) | clover over dover.psid | 2008-07-05 15:11 | 2.5K | |
![[SND]](/icons/sound2.gif) | coda.psid | 2008-07-05 15:11 | 3.3K | |
![[SND]](/icons/sound2.gif) | coding.psid | 2018-12-09 11:12 | 2.2K | |
![[SND]](/icons/sound2.gif) | colin zeal.psid | 2018-12-09 11:12 | 2.4K | |
![[SND]](/icons/sound2.gif) | columbia (orbiter).psid | 2008-07-05 15:11 | 2.7K | |
![[SND]](/icons/sound2.gif) | columbia.psid | 2018-12-09 11:12 | 2.9K | |
![[SND]](/icons/sound2.gif) | come together.psid | 2008-07-05 15:11 | 3.3K | |
![[SND]](/icons/sound2.gif) | coming clean.psid | 2008-07-05 15:11 | 2.4K | |
![[SND]](/icons/sound2.gif) | commodore conga.psid | 2008-07-05 15:11 | 1.9K | |
![[SND]](/icons/sound2.gif) | commodore faction demo.psid | 2008-07-05 15:11 | 2.0K | |
![[SND]](/icons/sound2.gif) | common people.psid | 2008-07-05 15:11 | 3.1K | |
![[SND]](/icons/sound2.gif) | compus mentus.psid | 2008-07-05 15:11 | 3.1K | |
![[SND]](/icons/sound2.gif) | computer kid.psid | 2008-07-05 15:11 | 1.9K | |
![[SND]](/icons/sound2.gif) | conga.psid | 2008-07-05 15:11 | 1.9K | |
![[SND]](/icons/sound2.gif) | consort (court of henry viii).psid | 2008-07-05 15:11 | 1.9K | |
![[SND]](/icons/sound2.gif) | contact.psid | 2008-07-05 15:11 | 2.2K | |
![[SND]](/icons/sound2.gif) | coping.psid | 2018-12-09 11:12 | 2.4K | |
![[SND]](/icons/sound2.gif) | country house.psid | 2008-07-05 15:11 | 3.5K | |
![[SND]](/icons/sound2.gif) | coup d'etat.psid | 2008-07-05 15:11 | 3.5K | |
![[SND]](/icons/sound2.gif) | crazy little thing called love.psid | 2008-07-05 15:11 | 4.3K | |
![[SND]](/icons/sound2.gif) | creepy.psid | 2008-07-05 15:11 | 2.5K | |
![[SND]](/icons/sound2.gif) | crossroads.psid | 2008-07-05 15:11 | 3.3K | |
![[SND]](/icons/sound2.gif) | cuddly.psid | 2008-07-05 15:11 | 1.9K | |
![[SND]](/icons/sound2.gif) | cumana.psid | 2008-07-05 15:11 | 3.7K | |
![[SND]](/icons/sound2.gif) | cute again.psid | 2008-07-05 15:11 | 2.4K | |
![[SND]](/icons/sound2.gif) | cute as a button.psid | 2018-01-02 16:12 | 1.9K | |
![[SND]](/icons/sound2.gif) | cute blues.psid | 2018-12-09 11:12 | 1.8K | |
![[SND]](/icons/sound2.gif) | cute blues 2.psid | 2008-07-05 15:11 | 1.6K | |
![[SND]](/icons/sound2.gif) | cute game soundtrack.psid | 2008-07-05 15:11 | 4.9K | |
![[SND]](/icons/sound2.gif) | cute platform game.psid | 2008-07-05 15:11 | 1.7K | |
![[SND]](/icons/sound2.gif) | cutie.psid | 2008-07-05 15:11 | 2.2K | |
![[SND]](/icons/sound2.gif) | d'yer wanna be a spaceman.psid | 2018-01-02 16:12 | 2.4K | |
![[SND]](/icons/sound2.gif) | dad's army theme.psid | 2008-07-05 15:11 | 3.0K | |
![[SND]](/icons/sound2.gif) | dan abnormal.psid | 2008-07-05 15:11 | 2.2K | |
![[SND]](/icons/sound2.gif) | dance of the cuckoos'98.psid | 2008-07-05 15:11 | 2.2K | |
![[SND]](/icons/sound2.gif) | dance of the cuckoos.psid | 2008-07-05 15:11 | 2.1K | |
![[SND]](/icons/sound2.gif) | dance of the cuckoos 2000.psid | 2008-07-05 15:11 | 3.7K | |
![[SND]](/icons/sound2.gif) | darkside.psid | 2008-07-05 15:11 | 2.3K | |
![[SND]](/icons/sound2.gif) | datalife.psid | 2008-07-05 15:11 | 2.1K | |
![[SND]](/icons/sound2.gif) | data set.psid | 2008-07-05 15:11 | 3.7K | |
![[SND]](/icons/sound2.gif) | day of the moon.psid | 2008-07-05 15:11 | 2.7K | |
![[SND]](/icons/sound2.gif) | day oh.psid | 2008-07-05 15:11 | 1.9K | |
![[SND]](/icons/sound2.gif) | day tripper.psid | 2008-07-05 15:11 | 2.7K | |
![[SND]](/icons/sound2.gif) | ddt.psid | 2008-07-05 15:11 | 2.4K | |
![[SND]](/icons/sound2.gif) | dead end job.psid | 2008-07-05 15:11 | 2.3K | |
![[SND]](/icons/sound2.gif) | deathwish.psid | 2008-07-05 15:11 | 2.0K | |
![[SND]](/icons/sound2.gif) | debt collector.psid | 2008-07-05 15:11 | 2.1K | |
![[SND]](/icons/sound2.gif) | decaf (caffeine remix).psid | 2008-07-05 15:11 | 2.3K | |
![[SND]](/icons/sound2.gif) | de do do do'99.psid | 2008-07-05 15:11 | 3.9K | |
![[SND]](/icons/sound2.gif) | de do do do (version 1).psid | 2008-07-05 15:11 | 2.8K | |
![[SND]](/icons/sound2.gif) | deep deep trouble.psid | 2008-07-05 15:11 | 1.9K | |
![[SND]](/icons/sound2.gif) | defeatist attitude.psid | 2008-07-05 15:11 | 3.5K | |
![[SND]](/icons/sound2.gif) | delete.psid | 2008-07-05 15:11 | 3.4K | |
![[SND]](/icons/sound2.gif) | demolition man.psid | 2008-07-05 15:11 | 2.0K | |
![[SND]](/icons/sound2.gif) | dented pride.psid | 2008-07-05 15:11 | 2.4K | |
![[SND]](/icons/sound2.gif) | diggsy's dinner.psid | 2008-07-05 15:11 | 3.9K | |
![[SND]](/icons/sound2.gif) | diggsy's dinner mix.psid | 2008-07-05 15:11 | 3.9K | |
![[SND]](/icons/sound2.gif) | direct current.psid | 2008-07-05 15:11 | 2.3K | |
![[SND]](/icons/sound2.gif) | dirty bass.psid | 2018-12-09 11:12 | 1.9K | |
![[SND]](/icons/sound2.gif) | disrespect.psid | 2008-07-05 15:11 | 3.2K | |
![[SND]](/icons/sound2.gif) | dissent.psid | 2008-07-05 15:11 | 3.4K | |
![[SND]](/icons/sound2.gif) | does everyone stare.psid | 2008-07-05 15:11 | 2.0K | |
![[SND]](/icons/sound2.gif) | don't look back in anger (edit).psid | 2018-01-02 16:12 | 4.4K | |
![[SND]](/icons/sound2.gif) | don't look back in anger.psid | 2018-01-02 16:12 | 4.3K | |
![[SND]](/icons/sound2.gif) | don't mean a thing.psid | 2018-01-02 16:12 | 2.6K | |
![[SND]](/icons/sound2.gif) | don't speak.psid | 2008-07-05 15:11 | 4.8K | |
![[SND]](/icons/sound2.gif) | don't stand so close to me.psid | 2018-01-02 16:12 | 2.4K | |
![[SND]](/icons/sound2.gif) | do the bartman.psid | 2018-01-02 16:12 | 2.5K | |
![[SND]](/icons/sound2.gif) | downgrade.psid | 2008-07-05 15:11 | 3.7K | |
![[SND]](/icons/sound2.gif) | downpour.psid | 2008-07-05 15:11 | 3.1K | |
![[SND]](/icons/sound2.gif) | do you want to know a secret.psid | 2018-01-02 16:12 | 2.5K | |
![[SND]](/icons/sound2.gif) | drive my car.psid | 2008-07-05 15:11 | 3.1K | |
![[SND]](/icons/sound2.gif) | driven to tears.psid | 2018-01-02 16:12 | 2.3K | |
![[SND]](/icons/sound2.gif) | driving in my car.psid | 2018-01-02 16:12 | 2.9K | |
![[SND]](/icons/sound2.gif) | drumbreaker.psid | 2008-07-05 15:11 | 2.5K | |
![[SND]](/icons/sound2.gif) | dusk.psid | 2008-07-05 15:11 | 3.3K | |
![[SND]](/icons/sound2.gif) | duststorm.psid | 2008-07-05 15:11 | 1.9K | |
![[SND]](/icons/sound2.gif) | eastern promise.psid | 2008-07-05 15:11 | 2.9K | |
![[SND]](/icons/sound2.gif) | easyeasy.psid | 2008-07-05 15:11 | 3.0K | |
![[SND]](/icons/sound2.gif) | easy steps.psid | 2008-07-05 15:11 | 3.2K | |
![[SND]](/icons/sound2.gif) | echo.psid | 2008-07-05 15:11 | 1.9K | |
![[SND]](/icons/sound2.gif) | edgy.psid | 2008-07-05 15:11 | 3.1K | |
![[SND]](/icons/sound2.gif) | egg-shaped fred.psid | 2008-07-05 15:11 | 2.4K | |
![[SND]](/icons/sound2.gif) | egghead.psid | 2008-07-05 15:11 | 3.2K | |
![[SND]](/icons/sound2.gif) | eight days a week.psid | 2018-01-02 16:12 | 2.6K | |
![[SND]](/icons/sound2.gif) | eleanor rigby.psid | 2008-07-05 15:11 | 2.7K | |
![[SND]](/icons/sound2.gif) | embarrassment.psid | 2008-07-05 15:11 | 2.5K | |
![[SND]](/icons/sound2.gif) | emenius sleepus.psid | 2008-07-05 15:11 | 2.4K | |
![[SND]](/icons/sound2.gif) | ems collection #1 intro.psid | 2008-07-05 15:11 | 3.3K | |
![[SND]](/icons/sound2.gif) | ending.psid | 2008-07-05 15:11 | 2.1K | |
![[SND]](/icons/sound2.gif) | end of a century.psid | 2008-07-05 15:11 | 2.2K | |
![[SND]](/icons/sound2.gif) | end of the war.psid | 2008-07-05 15:11 | 2.6K | |
![[SND]](/icons/sound2.gif) | entertain me.psid | 2008-07-05 15:11 | 2.9K | |
![[SND]](/icons/sound2.gif) | epic theme.psid | 2018-12-09 11:12 | 2.0K | |
![[SND]](/icons/sound2.gif) | equinoxe '95.psid | 2018-12-16 11:13 | 6.1K | |
![[SND]](/icons/sound2.gif) | equinoxe 4.psid | 2008-07-05 15:11 | 2.6K | |
![[SND]](/icons/sound2.gif) | equinoxe 5.psid | 2008-07-05 15:11 | 2.3K | |
![[SND]](/icons/sound2.gif) | equinoxe i (1999 mix).psid | 2008-07-05 15:11 | 2.4K | |
![[SND]](/icons/sound2.gif) | equinoxe i.psid | 2008-07-05 15:11 | 2.0K | |
![[SND]](/icons/sound2.gif) | ernold same.psid | 2008-07-05 15:11 | 2.6K | |
![[SND]](/icons/sound2.gif) | ethereal.psid | 2008-07-05 15:11 | 2.1K | |
![[SND]](/icons/sound2.gif) | ethnic.psid | 2008-07-05 15:11 | 3.3K | |
![[SND]](/icons/sound2.gif) | ethnicolour ii.psid | 2008-07-05 15:11 | 1.8K | |
![[SND]](/icons/sound2.gif) | evening shame.psid | 2018-12-09 11:12 | 3.4K | |
![[SND]](/icons/sound2.gif) | everybody (needs somebody..).psid | 2008-07-05 15:11 | 2.2K | |
![[SND]](/icons/sound2.gif) | every breath you take'99.psid | 2008-07-05 15:11 | 3.9K | |
![[SND]](/icons/sound2.gif) | every breath you take v1.psid | 2008-07-05 15:11 | 3.7K | |
![[SND]](/icons/sound2.gif) | every breath you take v2.psid | 2008-07-05 15:11 | 3.7K | |
![[SND]](/icons/sound2.gif) | every little thing she.psid | 2008-07-05 15:11 | 2.8K | |
![[SND]](/icons/sound2.gif) | evolution.psid | 2018-12-09 11:12 | 2.0K | |
![[SND]](/icons/sound2.gif) | excite.psid | 2008-07-05 15:11 | 2.0K | |
![[SND]](/icons/sound2.gif) | exhausted.psid | 2008-07-05 15:11 | 2.4K | |
![[SND]](/icons/sound2.gif) | expectation.psid | 2018-12-09 11:12 | 2.2K | |
![[SND]](/icons/sound2.gif) | experimenting.psid | 2018-12-09 11:12 | 2.1K | |
![[SND]](/icons/sound2.gif) | exploding fish.psid | 2018-12-16 11:13 | 13K | |
![[SND]](/icons/sound2.gif) | explorer theme #1.psid | 2008-07-05 15:11 | 4.0K | |
![[SND]](/icons/sound2.gif) | explorer theme #2.psid | 2008-07-05 15:11 | 4.0K | |
![[SND]](/icons/sound2.gif) | express train.psid | 2008-07-05 15:11 | 2.3K | |
![[SND]](/icons/sound2.gif) | extreme.psid | 2008-07-05 15:11 | 3.5K | |
![[SND]](/icons/sound2.gif) | f.a.b. #1.psid | 2008-07-05 15:11 | 2.4K | |
![[SND]](/icons/sound2.gif) | f.a.b. 2001.psid | 2008-07-05 15:11 | 2.2K | |
![[SND]](/icons/sound2.gif) | f.o.d.psid | 2008-07-05 15:11 | 3.1K | |
![[SND]](/icons/sound2.gif) | fade (version 2).psid | 2008-07-05 15:11 | 2.0K | |
![[SND]](/icons/sound2.gif) | fade away (blur).psid | 2008-07-05 15:11 | 2.5K | |
![[SND]](/icons/sound2.gif) | fade away (oasis).psid | 2008-07-05 15:11 | 2.8K | |
![[SND]](/icons/sound2.gif) | fading away.psid | 2008-07-05 15:11 | 3.3K | |
![[SND]](/icons/sound2.gif) | fall of darkness.psid | 2008-07-05 15:11 | 3.6K | |
![[SND]](/icons/sound2.gif) | fall out.psid | 2008-07-05 15:11 | 2.2K | |
![[SND]](/icons/sound2.gif) | fantasy land (original mix).psid | 2008-07-05 15:11 | 2.6K | |
![[SND]](/icons/sound2.gif) | fantasy land dmc mix.psid | 2008-07-05 15:11 | 3.5K | |
![[SND]](/icons/sound2.gif) | far out.psid | 2008-07-05 15:11 | 1.9K | |
![[SND]](/icons/sound2.gif) | fastforward.psid | 2008-07-05 15:11 | 3.2K | |
![[SND]](/icons/sound2.gif) | fast track.psid | 2008-07-05 15:11 | 2.1K | |
![[SND]](/icons/sound2.gif) | feint.psid | 2008-07-05 15:11 | 2.1K | |
![[SND]](/icons/sound2.gif) | first attempt.psid | 2008-07-05 15:11 | 3.6K | |
![[SND]](/icons/sound2.gif) | flash!.psid | 2008-07-05 15:11 | 3.2K | |
![[SND]](/icons/sound2.gif) | flexible strategies.psid | 2008-07-05 15:11 | 1.6K | |
![[SND]](/icons/sound2.gif) | fluffy.psid | 2018-12-09 11:12 | 1.9K | |
![[SND]](/icons/sound2.gif) | flying.psid | 2018-12-09 11:12 | 2.9K | |
![[SND]](/icons/sound2.gif) | fog.psid | 2018-12-09 11:12 | 3.7K | |
![[SND]](/icons/sound2.gif) | folly.psid | 2008-07-05 15:11 | 3.7K | |
![[SND]](/icons/sound2.gif) | force.psid | 2008-07-05 15:11 | 3.4K | |
![[SND]](/icons/sound2.gif) | forgotten ninja.psid | 2008-07-05 15:11 | 3.1K | |
![[SND]](/icons/sound2.gif) | for mr chaos!.psid | 2008-07-05 15:11 | 2.5K | |
![[SND]](/icons/sound2.gif) | for tomorrow.psid | 2018-12-09 11:12 | 2.2K | |
![[SND]](/icons/sound2.gif) | freedom.psid | 2008-07-05 15:11 | 3.4K | |
![[SND]](/icons/sound2.gif) | friday.psid | 2018-12-09 11:12 | 2.1K | |
![[SND]](/icons/sound2.gif) | friends.psid | 2008-07-05 15:11 | 2.0K | |
![[SND]](/icons/sound2.gif) | from me to you.psid | 2018-01-02 16:12 | 3.0K | |
![[SND]](/icons/sound2.gif) | frontier (version 1).psid | 2008-07-05 15:11 | 3.4K | |
![[SND]](/icons/sound2.gif) | frontier (version 2).psid | 2008-07-05 15:11 | 3.4K | |
![[SND]](/icons/sound2.gif) | frontier.psid | 2018-01-02 16:12 | 3.4K | |
![[SND]](/icons/sound2.gif) | funky fish'99.psid | 2008-07-05 15:11 | 3.7K | |
![[SND]](/icons/sound2.gif) | funky fish (mix 1).psid | 2008-07-05 15:11 | 2.8K | |
![[SND]](/icons/sound2.gif) | funky fish.psid | 2018-12-09 11:12 | 2.8K | |
![[SND]](/icons/sound2.gif) | gabbamix.psid | 2008-07-05 15:11 | 3.6K | |
![[SND]](/icons/sound2.gif) | gaffer.psid | 2008-07-05 15:11 | 3.3K | |
![[SND]](/icons/sound2.gif) | galliard mix.psid | 2008-07-05 15:11 | 2.2K | |
![[SND]](/icons/sound2.gif) | gallop.psid | 2008-07-05 15:11 | 2.4K | |
![[SND]](/icons/sound2.gif) | ganymede.psid | 2008-07-05 15:11 | 2.2K | |
![[SND]](/icons/sound2.gif) | gas.psid | 2008-07-05 15:11 | 3.5K | |
![[SND]](/icons/sound2.gif) | get back.psid | 2008-07-05 15:11 | 3.5K | |
![[SND]](/icons/sound2.gif) | get up and go!.psid | 2008-07-05 15:11 | 2.1K | |
![[SND]](/icons/sound2.gif) | ghost train.psid | 2008-07-05 15:11 | 3.2K | |
![[SND]](/icons/sound2.gif) | gimme some lovin'.psid | 2008-07-05 15:11 | 2.1K | |
![[SND]](/icons/sound2.gif) | girls and boys.psid | 2008-07-05 15:11 | 2.6K | |
![[SND]](/icons/sound2.gif) | globe alone.psid | 2008-07-05 15:11 | 2.6K | |
![[SND]](/icons/sound2.gif) | god bless the child.psid | 2018-01-02 16:12 | 2.4K | |
![[SND]](/icons/sound2.gif) | good attitude.psid | 2018-12-09 11:12 | 2.2K | |
![[SND]](/icons/sound2.gif) | goodbye theme.psid | 2008-07-05 15:11 | 2.2K | |
![[SND]](/icons/sound2.gif) | good enough '97.psid | 2008-07-05 15:11 | 2.9K | |
![[SND]](/icons/sound2.gif) | good enough first mix.psid | 2008-07-05 15:11 | 2.9K | |
![[SND]](/icons/sound2.gif) | good golly miss molly.psid | 2008-07-05 15:11 | 2.4K | |
![[SND]](/icons/sound2.gif) | goodnight sweetheart.psid | 2018-12-09 11:12 | 2.9K | |
![[SND]](/icons/sound2.gif) | grassman.psid | 2008-07-05 15:11 | 2.8K | |
![[SND]](/icons/sound2.gif) | grave goods.psid | 2008-07-05 15:11 | 3.6K | |
![[SND]](/icons/sound2.gif) | grebnedlog.psid | 2008-07-05 15:11 | 3.8K | |
![[SND]](/icons/sound2.gif) | grey day.psid | 2008-07-05 15:11 | 2.5K | |
![[SND]](/icons/sound2.gif) | grey matter.psid | 2008-07-05 15:11 | 2.6K | |
![[SND]](/icons/sound2.gif) | half the world away.psid | 2018-01-02 16:12 | 2.6K | |
![[SND]](/icons/sound2.gif) | happiness is a warm gun.psid | 2018-01-02 16:12 | 3.2K | |
![[SND]](/icons/sound2.gif) | happy 20th birthday c64.psid | 2008-07-05 15:11 | 2.0K | |
![[SND]](/icons/sound2.gif) | happy ending.psid | 2008-07-05 15:11 | 3.7K | |
![[SND]](/icons/sound2.gif) | happy feet.psid | 2018-12-09 11:12 | 2.4K | |
![[SND]](/icons/sound2.gif) | happy go lucky.psid | 2018-12-09 11:12 | 2.3K | |
![[SND]](/icons/sound2.gif) | hard life.psid | 2008-07-05 15:11 | 3.6K | |
![[SND]](/icons/sound2.gif) | hatful.psid | 2008-07-05 15:11 | 2.2K | |
![[SND]](/icons/sound2.gif) | having a blast.psid | 2018-01-02 16:12 | 3.6K | |
![[SND]](/icons/sound2.gif) | headshrinker.psid | 2008-07-05 15:11 | 3.1K | |
![[SND]](/icons/sound2.gif) | heatwave.psid | 2008-07-05 15:11 | 3.6K | |
![[SND]](/icons/sound2.gif) | hello.psid | 2008-07-05 15:11 | 3.2K | |
![[SND]](/icons/sound2.gif) | hello goodbye.psid | 2008-07-05 15:11 | 3.3K | |
![[SND]](/icons/sound2.gif) | help!.psid | 2008-07-05 15:11 | 3.0K | |
![[SND]](/icons/sound2.gif) | helter skelter.psid | 2008-07-05 15:11 | 4.5K | |
![[SND]](/icons/sound2.gif) | herald.psid | 2008-07-05 15:11 | 3.6K | |
![[SND]](/icons/sound2.gif) | here comes the sun.psid | 2018-01-02 16:12 | 3.5K | |
![[SND]](/icons/sound2.gif) | here there and everywhere.psid | 2008-07-05 15:11 | 2.5K | |
![[SND]](/icons/sound2.gif) | he thought of cars.psid | 2018-01-02 16:12 | 2.4K | |
![[SND]](/icons/sound2.gif) | hey jude.psid | 2008-07-05 15:11 | 4.1K | |
![[SND]](/icons/sound2.gif) | hey now.psid | 2008-07-05 15:11 | 3.3K | |
![[SND]](/icons/sound2.gif) | hole in my life.psid | 2008-07-05 15:11 | 2.5K | |
![[SND]](/icons/sound2.gif) | holler.psid | 2008-07-05 15:11 | 3.9K | |
![[SND]](/icons/sound2.gif) | horizon.psid | 2008-07-05 15:11 | 2.0K | |
![[SND]](/icons/sound2.gif) | horror.psid | 2008-07-05 15:11 | 2.1K | |
![[SND]](/icons/sound2.gif) | house of fun'99.psid | 2008-07-05 15:11 | 4.0K | |
![[SND]](/icons/sound2.gif) | house of fun.psid | 2018-01-02 16:12 | 2.7K | |
![[SND]](/icons/sound2.gif) | house of the rising sun.psid | 2008-07-05 15:11 | 2.7K | |
![[SND]](/icons/sound2.gif) | howard's way theme.psid | 2008-07-05 15:11 | 2.2K | |
![[SND]](/icons/sound2.gif) | hub.psid | 2008-07-05 15:11 | 2.4K | |
![[SND]](/icons/sound2.gif) | hubbard & squeak!.psid | 2008-07-05 15:11 | 2.2K | |
![[SND]](/icons/sound2.gif) | hungry for you.psid | 2008-07-05 15:11 | 2.3K | |
![[SND]](/icons/sound2.gif) | hurry up!.psid | 2008-07-05 15:11 | 2.2K | |
![[SND]](/icons/sound2.gif) | i'm only sleeping.psid | 2008-07-05 15:11 | 3.3K | |
![[SND]](/icons/sound2.gif) | i am the walrus (oasis live).psid | 2018-01-02 16:12 | 4.3K | |
![[SND]](/icons/sound2.gif) | i am the walrus.psid | 2018-01-02 16:12 | 4.4K | |
![[SND]](/icons/sound2.gif) | if u can't dance.psid | 2008-07-05 15:11 | 2.6K | |
![[SND]](/icons/sound2.gif) | i love to see you smile.psid | 2018-01-02 16:12 | 2.8K | |
![[SND]](/icons/sound2.gif) | imagine.psid | 2008-07-05 15:11 | 2.1K | |
![[SND]](/icons/sound2.gif) | indiependent.psid | 2008-07-05 15:11 | 2.3K | |
![[SND]](/icons/sound2.gif) | infected.psid | 2008-07-05 15:11 | 3.2K | |
![[SND]](/icons/sound2.gif) | in pieces.psid | 2008-07-05 15:11 | 3.6K | |
![[SND]](/icons/sound2.gif) | interesting.psid | 2008-07-05 15:11 | 2.2K | |
![[SND]](/icons/sound2.gif) | interstate.psid | 2018-12-16 11:13 | 2.2K | |
![[SND]](/icons/sound2.gif) | in the end.psid | 2018-01-02 16:12 | 2.4K | |
![[SND]](/icons/sound2.gif) | introducing.psid | 2008-07-05 15:11 | 2.1K | |
![[SND]](/icons/sound2.gif) | invisible sun.psid | 2008-07-05 15:11 | 2.7K | |
![[SND]](/icons/sound2.gif) | io.psid | 2018-12-09 11:12 | 2.3K | |
![[SND]](/icons/sound2.gif) | ionosphere.psid | 2018-12-09 11:12 | 2.4K | |
![[SND]](/icons/sound2.gif) | it's after you.psid | 2008-07-05 15:11 | 3.5K | |
![[SND]](/icons/sound2.gif) | it's alright for you.psid | 2018-01-02 16:12 | 2.8K | |
![[SND]](/icons/sound2.gif) | it's better people.psid | 2008-07-05 15:11 | 2.6K | |
![[SND]](/icons/sound2.gif) | it could be you.psid | 2008-07-05 15:11 | 2.6K | |
![[SND]](/icons/sound2.gif) | it must be love.psid | 2008-07-05 15:11 | 2.8K | |
![[SND]](/icons/sound2.gif) | i wanna hold your hand.psid | 2008-07-05 15:11 | 3.2K | |
![[SND]](/icons/sound2.gif) | i will believe.psid | 2008-07-05 15:11 | 2.7K | |
![[SND]](/icons/sound2.gif) | jailhouse rock.psid | 2008-07-05 15:11 | 2.4K | |
![[SND]](/icons/sound2.gif) | jewel in the crown.psid | 2018-01-02 16:12 | 1.8K | |
![[SND]](/icons/sound2.gif) | jingle bells.psid | 2018-12-09 11:12 | 3.1K | |
![[SND]](/icons/sound2.gif) | jolly.psid | 2008-07-05 15:11 | 2.2K | |
![[SND]](/icons/sound2.gif) | jongleurs.psid | 2008-07-05 15:11 | 2.5K | |
![[SND]](/icons/sound2.gif) | joy.psid | 2018-12-09 11:12 | 2.2K | |
![[SND]](/icons/sound2.gif) | joyful.psid | 2008-07-05 15:11 | 2.1K | |
![[SND]](/icons/sound2.gif) | jubilee.psid | 2008-07-05 15:11 | 3.1K | |
![[SND]](/icons/sound2.gif) | jumping bean.psid | 2008-07-05 15:11 | 3.3K | |
![[SND]](/icons/sound2.gif) | jungle run.psid | 2008-07-05 15:11 | 3.9K | |
![[SND]](/icons/sound2.gif) | juno.psid | 2008-07-05 15:11 | 3.4K | |
![[SND]](/icons/sound2.gif) | king of pain (version 2).psid | 2008-07-05 15:11 | 2.4K | |
![[SND]](/icons/sound2.gif) | king of pain.psid | 2018-01-02 16:12 | 3.5K | |
![[SND]](/icons/sound2.gif) | king of pain version 2.psid | 2018-01-02 16:12 | 2.4K | |
![[SND]](/icons/sound2.gif) | lady madonna.psid | 2008-07-05 15:11 | 3.0K | |
![[SND]](/icons/sound2.gif) | landlord.psid | 2008-07-05 15:11 | 2.6K | |
![[SND]](/icons/sound2.gif) | last time lover.psid | 2018-12-09 11:12 | 2.5K | |
![[SND]](/icons/sound2.gif) | latin.psid | 2008-07-05 15:11 | 2.1K | |
![[SND]](/icons/sound2.gif) | leapyear.psid | 2008-07-05 15:11 | 3.6K | |
![[SND]](/icons/sound2.gif) | legend.psid | 2008-07-05 15:11 | 2.3K | |
![[SND]](/icons/sound2.gif) | lessons.psid | 2018-12-09 11:12 | 1.9K | |
![[SND]](/icons/sound2.gif) | let it be.psid | 2008-07-05 15:11 | 4.1K | |
![[SND]](/icons/sound2.gif) | let love lead the way.psid | 2018-01-02 16:12 | 4.2K | |
![[SND]](/icons/sound2.gif) | libertine.psid | 2008-07-05 15:11 | 3.2K | |
![[SND]](/icons/sound2.gif) | liberty.psid | 2008-07-05 15:11 | 2.5K | |
![[SND]](/icons/sound2.gif) | lightfoot.psid | 2018-12-09 11:12 | 2.9K | |
![[SND]](/icons/sound2.gif) | listen up.psid | 2008-07-05 15:11 | 3.0K | |
![[SND]](/icons/sound2.gif) | little train.psid | 2018-12-09 11:12 | 1.9K | |
![[SND]](/icons/sound2.gif) | live forever'99.psid | 2008-07-05 15:11 | 4.8K | |
![[SND]](/icons/sound2.gif) | live forever.psid | 2008-07-05 15:11 | 3.3K | |
![[SND]](/icons/sound2.gif) | lively.psid | 2008-07-05 15:11 | 2.3K | |
![[SND]](/icons/sound2.gif) | london loves.psid | 2008-07-05 15:11 | 2.4K | |
![[SND]](/icons/sound2.gif) | long distance.psid | 2008-07-05 15:11 | 1.9K | |
![[SND]](/icons/sound2.gif) | longsighted.psid | 2018-12-09 11:12 | 2.2K | |
![[SND]](/icons/sound2.gif) | long tall sally.psid | 2008-07-05 15:11 | 3.9K | |
![[SND]](/icons/sound2.gif) | longview.psid | 2008-07-05 15:11 | 2.8K | |
![[SND]](/icons/sound2.gif) | look at all those idiots!.psid | 2008-07-05 15:11 | 2.2K | |
![[SND]](/icons/sound2.gif) | los palmas 7.psid | 2008-07-05 15:11 | 2.9K | |
![[SND]](/icons/sound2.gif) | los palmas 7 remix.psid | 2008-07-05 15:11 | 4.2K | |
![[SND]](/icons/sound2.gif) | lost hubbard soundtrack.psid | 2008-07-05 15:11 | 2.1K | |
![[SND]](/icons/sound2.gif) | lot 105.psid | 2008-07-05 15:11 | 2.1K | |
![[SND]](/icons/sound2.gif) | lot 105 remix.psid | 2008-07-05 15:11 | 2.5K | |
![[SND]](/icons/sound2.gif) | love me do.psid | 2008-07-05 15:11 | 2.8K | |
![[SND]](/icons/sound2.gif) | love thing.psid | 2018-12-09 11:12 | 2.9K | |
![[SND]](/icons/sound2.gif) | low life.psid | 2008-07-05 15:11 | 2.5K | |
![[SND]](/icons/sound2.gif) | lucy in the sky with diamonds.psid | 2018-01-02 16:12 | 2.8K | |
![[SND]](/icons/sound2.gif) | lunacy.psid | 2008-07-05 15:11 | 3.2K | |
![[SND]](/icons/sound2.gif) | madmarch.psid | 2008-07-05 15:11 | 3.4K | |
![[SND]](/icons/sound2.gif) | magical mystery tour.psid | 2008-07-05 15:11 | 3.3K | |
![[SND]](/icons/sound2.gif) | magic america.psid | 2008-07-05 15:11 | 2.8K | |
![[SND]](/icons/sound2.gif) | magic roundabout feekzoid mix.psid | 2008-07-05 15:11 | 3.1K | |
![[SND]](/icons/sound2.gif) | magic trance.psid | 2018-01-02 16:12 | 3.2K | |
![[SND]](/icons/sound2.gif) | magnetic fields '95.psid | 2018-12-16 11:13 | 6.1K | |
![[SND]](/icons/sound2.gif) | magnetic fields 1.psid | 2008-07-05 15:11 | 2.2K | |
![[SND]](/icons/sound2.gif) | magnetic fields 2.psid | 2008-07-05 15:11 | 2.3K | |
![[SND]](/icons/sound2.gif) | magnetic fields 3.psid | 2008-07-05 15:11 | 1.9K | |
![[SND]](/icons/sound2.gif) | magnetic fields 4.psid | 2008-07-05 15:11 | 2.0K | |
![[SND]](/icons/sound2.gif) | makin' merry.psid | 2008-07-05 15:11 | 2.2K | |
![[SND]](/icons/sound2.gif) | making the most of.psid | 2018-01-02 16:12 | 2.9K | |
![[SND]](/icons/sound2.gif) | mama.psid | 2008-07-05 15:11 | 2.8K | |
![[SND]](/icons/sound2.gif) | mama roach.psid | 2008-07-05 15:11 | 3.6K | |
![[SND]](/icons/sound2.gif) | man in a suitcase.psid | 2018-01-02 16:12 | 2.2K | |
![[SND]](/icons/sound2.gif) | marchin' blues.psid | 2008-07-05 15:11 | 2.2K | |
![[SND]](/icons/sound2.gif) | married with children (mix).psid | 2008-07-05 15:11 | 3.5K | |
![[SND]](/icons/sound2.gif) | married with children.psid | 2008-07-05 15:11 | 3.5K | |
![[SND]](/icons/sound2.gif) | masoka tango.psid | 2008-07-05 15:11 | 2.1K | |
![[SND]](/icons/sound2.gif) | matt finish.psid | 2018-12-09 11:12 | 2.4K | |
![[SND]](/icons/sound2.gif) | maybe.psid | 2008-07-05 15:11 | 3.4K | |
![[SND]](/icons/sound2.gif) | mean times.psid | 2018-12-09 11:12 | 2.3K | |
![[SND]](/icons/sound2.gif) | melancholy.psid | 2008-07-05 15:11 | 2.0K | |
![[SND]](/icons/sound2.gif) | melodies haunt you.psid | 2008-07-05 15:11 | 3.1K | |
![[SND]](/icons/sound2.gif) | memories are made of this.psid | 2018-01-02 16:12 | 1.9K | |
![[SND]](/icons/sound2.gif) | menace.psid | 2018-12-09 11:12 | 2.1K | |
![[SND]](/icons/sound2.gif) | message centre.psid | 2008-07-05 15:11 | 2.4K | |
![[SND]](/icons/sound2.gif) | message in a bottle '95.psid | 2018-12-16 11:13 | 5.8K | |
![[SND]](/icons/sound2.gif) | message in a bottle.psid | 2018-01-02 16:12 | 2.6K | |
![[SND]](/icons/sound2.gif) | michael caine.psid | 2008-07-05 15:11 | 2.6K | |
![[SND]](/icons/sound2.gif) | middleman.psid | 2008-07-05 15:11 | 3.6K | |
![[SND]](/icons/sound2.gif) | midtempo.psid | 2008-07-05 15:11 | 2.0K | |
![[SND]](/icons/sound2.gif) | miffy.psid | 2008-07-05 15:11 | 1.8K | |
![[SND]](/icons/sound2.gif) | mighty.psid | 2008-07-05 15:11 | 2.3K | |
![[SND]](/icons/sound2.gif) | military.psid | 2018-12-09 11:12 | 1.9K | |
![[SND]](/icons/sound2.gif) | minidisk.psid | 2008-07-05 15:11 | 2.2K | |
![[SND]](/icons/sound2.gif) | minnie the moocher.psid | 2018-01-02 16:12 | 3.6K | |
![[SND]](/icons/sound2.gif) | minuet by pez (1716).psid | 2008-07-05 15:11 | 1.9K | |
![[SND]](/icons/sound2.gif) | miss gradenko.psid | 2008-07-05 15:11 | 2.8K | |
![[SND]](/icons/sound2.gif) | missing.psid | 2008-07-05 15:11 | 2.9K | |
![[SND]](/icons/sound2.gif) | mitch (& dane) - tribute.psid | 2008-07-05 15:11 | 2.2K | |
![[SND]](/icons/sound2.gif) | mixed spice (single mix).psid | 2008-07-05 15:11 | 3.7K | |
![[SND]](/icons/sound2.gif) | moaning lisa blues.psid | 2008-07-05 15:11 | 3.4K | |
![[SND]](/icons/sound2.gif) | mobyesque.psid | 2008-07-05 15:11 | 2.2K | |
![[SND]](/icons/sound2.gif) | moebius.psid | 2018-12-09 11:12 | 1.9K | |
![[SND]](/icons/sound2.gif) | moebius loop.psid | 2008-07-05 15:11 | 2.1K | |
![[SND]](/icons/sound2.gif) | monday.psid | 2008-07-05 15:11 | 2.1K | |
![[SND]](/icons/sound2.gif) | money.psid | 2008-07-05 15:11 | 3.7K | |
![[SND]](/icons/sound2.gif) | more cute.psid | 2018-12-09 11:12 | 2.1K | |
![[SND]](/icons/sound2.gif) | morning glory.psid | 2008-07-05 15:11 | 3.2K | |
![[SND]](/icons/sound2.gif) | morse.psid | 2008-07-05 15:11 | 2.5K | |
![[SND]](/icons/sound2.gif) | morse code (version 2).psid | 2008-07-05 15:11 | 2.5K | |
![[SND]](/icons/sound2.gif) | morse code.psid | 2018-01-02 16:12 | 2.5K | |
![[SND]](/icons/sound2.gif) | mother.psid | 2008-07-05 15:11 | 2.1K | |
![[SND]](/icons/sound2.gif) | move over.psid | 2008-07-05 15:11 | 3.7K | |
![[SND]](/icons/sound2.gif) | mr. cheerful.psid | 2008-07-05 15:11 | 2.3K | |
![[SND]](/icons/sound2.gif) | mr. mischief.psid | 2008-07-05 15:11 | 3.6K | |
![[SND]](/icons/sound2.gif) | mr. robinson's quango.psid | 2018-12-09 11:12 | 2.6K | |
![[SND]](/icons/sound2.gif) | mr busy (6581).psid | 2008-07-05 15:11 | 2.0K | |
![[SND]](/icons/sound2.gif) | mr busy (8580).psid | 2008-07-05 15:11 | 2.1K | |
![[SND]](/icons/sound2.gif) | mr rush (6581).psid | 2008-07-05 15:11 | 2.2K | |
![[SND]](/icons/sound2.gif) | mr rush (8580).psid | 2008-07-05 15:11 | 2.3K | |
![[SND]](/icons/sound2.gif) | mtv's greatest riffs.psid | 2008-07-05 15:11 | 3.0K | |
![[SND]](/icons/sound2.gif) | musical doodle.psid | 2018-12-09 11:12 | 2.2K | |
![[SND]](/icons/sound2.gif) | music direct.psid | 2018-12-09 11:12 | 1.9K | |
![[SND]](/icons/sound2.gif) | music file.psid | 2008-07-05 15:11 | 3.3K | |
![[SND]](/icons/sound2.gif) | musique de jarre.psid | 2008-07-05 15:11 | 6.2K | |
![[SND]](/icons/sound2.gif) | my girl.psid | 2008-07-05 15:11 | 2.5K | |
![[SND]](/icons/sound2.gif) | naked.psid | 2018-12-09 11:12 | 2.5K | |
![[SND]](/icons/sound2.gif) | nameless.psid | 2018-12-09 11:12 | 2.3K | |
![[SND]](/icons/sound2.gif) | new circuit.psid | 2008-07-05 15:11 | 2.0K | |
![[SND]](/icons/sound2.gif) | new day.psid | 2008-07-05 15:11 | 2.0K | |
![[SND]](/icons/sound2.gif) | new ska.psid | 2008-07-05 15:11 | 2.1K | |
![[SND]](/icons/sound2.gif) | new start.psid | 2018-12-09 11:12 | 2.1K | |
![[SND]](/icons/sound2.gif) | new tempo.psid | 2008-07-05 15:11 | 2.3K | |
![[SND]](/icons/sound2.gif) | next to you.psid | 2018-01-02 16:12 | 3.1K | |
![[SND]](/icons/sound2.gif) | nicad.psid | 2008-07-05 15:11 | 2.2K | |
![[SND]](/icons/sound2.gif) | night boat to cairo'99.psid | 2018-01-02 16:12 | 3.8K | |
![[SND]](/icons/sound2.gif) | night boat to cairo.psid | 2018-01-02 16:12 | 2.7K | |
![[SND]](/icons/sound2.gif) | noel nouvelet.psid | 2008-07-05 15:11 | 1.7K | |
![[SND]](/icons/sound2.gif) | noisy boyz.psid | 2008-07-05 15:11 | 3.3K | |
![[SND]](/icons/sound2.gif) | no surprises.psid | 2008-07-05 15:11 | 2.5K | |
![[SND]](/icons/sound2.gif) | nothing achieving.psid | 2008-07-05 15:11 | 2.1K | |
![[SND]](/icons/sound2.gif) | no time this time.psid | 2008-07-05 15:11 | 2.5K | |
![[SND]](/icons/sound2.gif) | nouveau (version 2).psid | 2008-07-05 15:11 | 2.2K | |
![[SND]](/icons/sound2.gif) | nouveau (version 3).psid | 2008-07-05 15:11 | 2.2K | |
![[SND]](/icons/sound2.gif) | nouveau.psid | 2008-07-05 15:11 | 2.4K | |
![[SND]](/icons/sound2.gif) | nowhere man.psid | 2008-07-05 15:11 | 3.1K | |
![[SND]](/icons/sound2.gif) | ob-la-di ob-la-da.psid | 2008-07-05 15:11 | 3.8K | |
![[SND]](/icons/sound2.gif) | oblivion.psid | 2008-07-05 15:11 | 4.0K | |
![[SND]](/icons/sound2.gif) | octavo (6581).psid | 2008-07-05 15:11 | 2.4K | |
![[SND]](/icons/sound2.gif) | octavo (8580).psid | 2008-07-05 15:11 | 2.4K | |
![[SND]](/icons/sound2.gif) | octavo (grimoire remix).psid | 2008-07-05 15:11 | 2.7K | |
![[SND]](/icons/sound2.gif) | octavo (mix).psid | 2008-07-05 15:11 | 2.7K | |
![[SND]](/icons/sound2.gif) | octavo (old mix).psid | 2008-07-05 15:11 | 2.7K | |
![[SND]](/icons/sound2.gif) | octopus' garden.psid | 2008-07-05 15:11 | 3.6K | |
![[SND]](/icons/sound2.gif) | odie.psid | 2008-07-05 15:11 | 3.2K | |
![[SND]](/icons/sound2.gif) | oily water.psid | 2018-12-09 11:12 | 2.7K | |
![[SND]](/icons/sound2.gif) | old skool.psid | 2018-12-09 11:12 | 2.9K | |
![[SND]](/icons/sound2.gif) | omegaman.psid | 2008-07-05 15:11 | 2.5K | |
![[SND]](/icons/sound2.gif) | o my god.psid | 2008-07-05 15:11 | 3.0K | |
![[SND]](/icons/sound2.gif) | on any other day.psid | 2008-07-05 15:11 | 2.3K | |
![[SND]](/icons/sound2.gif) | one better day.psid | 2008-07-05 15:11 | 2.8K | |
![[SND]](/icons/sound2.gif) | one day.psid | 2008-07-05 15:11 | 3.2K | |
![[SND]](/icons/sound2.gif) | one step beyond.psid | 2008-07-05 15:11 | 2.0K | |
![[SND]](/icons/sound2.gif) | on the beat.psid | 2018-01-02 16:12 | 1.9K | |
![[SND]](/icons/sound2.gif) | open sesame.psid | 2008-07-05 15:11 | 2.5K | |
![[SND]](/icons/sound2.gif) | optimystic.psid | 2018-12-09 11:12 | 2.0K | |
![[SND]](/icons/sound2.gif) | oriental.psid | 2008-07-05 15:11 | 3.4K | |
![[SND]](/icons/sound2.gif) | oriental chimes.psid | 2018-12-09 11:12 | 2.0K | |
![[SND]](/icons/sound2.gif) | oriental magic.psid | 2018-01-02 16:12 | 3.0K | |
![[SND]](/icons/sound2.gif) | orient express.psid | 2008-07-05 15:11 | 2.6K | |
![[SND]](/icons/sound2.gif) | origin.psid | 2008-07-05 15:11 | 2.5K | |
![[SND]](/icons/sound2.gif) | other way of stopping.psid | 2018-01-02 16:12 | 1.8K | |
![[SND]](/icons/sound2.gif) | our house.psid | 2008-07-05 15:11 | 2.4K | |
![[SND]](/icons/sound2.gif) | overtaking.psid | 2008-07-05 15:11 | 2.5K | |
![[SND]](/icons/sound2.gif) | oxygene '95.psid | 2018-12-16 11:13 | 5.6K | |
![[SND]](/icons/sound2.gif) | oxygene 2.psid | 2008-07-05 15:11 | 2.6K | |
![[SND]](/icons/sound2.gif) | oxygene 4.psid | 2008-07-05 15:11 | 2.2K | |
![[SND]](/icons/sound2.gif) | oxygene 6.psid | 2008-07-05 15:11 | 2.1K | |
![[SND]](/icons/sound2.gif) | oxygene ii.psid | 2008-07-05 15:11 | 2.3K | |
![[SND]](/icons/sound2.gif) | page 202.psid | 2018-01-02 16:12 | 2.1K | |
![[SND]](/icons/sound2.gif) | paperback writer.psid | 2008-07-05 15:11 | 2.9K | |
![[SND]](/icons/sound2.gif) | parade.psid | 2008-07-05 15:11 | 3.7K | |
![[SND]](/icons/sound2.gif) | parklife.psid | 2018-12-09 11:12 | 1.9K | |
![[SND]](/icons/sound2.gif) | party animal.psid | 2018-12-09 11:12 | 1.9K | |
![[SND]](/icons/sound2.gif) | peanuts.psid | 2008-07-05 15:11 | 2.3K | |
![[SND]](/icons/sound2.gif) | peggy sue.psid | 2008-07-05 15:11 | 3.0K | |
![[SND]](/icons/sound2.gif) | penguin.psid | 2008-07-05 15:11 | 2.9K | |
![[SND]](/icons/sound2.gif) | penny lane.psid | 2008-07-05 15:11 | 3.9K | |
![[SND]](/icons/sound2.gif) | pessimism (version 2).psid | 2008-07-05 15:11 | 2.4K | |
![[SND]](/icons/sound2.gif) | pessimism.psid | 2018-01-02 16:12 | 2.4K | |
![[SND]](/icons/sound2.gif) | peter gunn theme.psid | 2008-07-05 15:11 | 1.9K | |
![[SND]](/icons/sound2.gif) | phase 2.psid | 2008-07-05 15:11 | 2.7K | |
![[SND]](/icons/sound2.gif) | plateau.psid | 2018-12-09 11:12 | 2.9K | |
![[SND]](/icons/sound2.gif) | play the fool.psid | 2018-01-02 16:12 | 3.5K | |
![[SND]](/icons/sound2.gif) | please mr postman.psid | 2008-07-05 15:11 | 4.0K | |
![[SND]](/icons/sound2.gif) | pony trekkin'.psid | 2008-07-05 15:11 | 2.1K | |
![[SND]](/icons/sound2.gif) | popscene.psid | 2018-12-09 11:12 | 2.5K | |
![[SND]](/icons/sound2.gif) | possibly yes.psid | 2018-12-09 11:12 | 2.9K | |
![[SND]](/icons/sound2.gif) | potts.psid | 2008-07-05 15:11 | 2.0K | |
![[SND]](/icons/sound2.gif) | pressure on j.psid | 2018-12-09 11:12 | 2.4K | |
![[SND]](/icons/sound2.gif) | pretend best friend.psid | 2008-07-05 15:11 | 3.5K | |
![[SND]](/icons/sound2.gif) | primary star invitro.psid | 2008-07-05 15:11 | 2.3K | |
![[SND]](/icons/sound2.gif) | progress.psid | 2008-07-05 15:11 | 3.4K | |
![[SND]](/icons/sound2.gif) | public action.psid | 2008-07-05 15:11 | 3.4K | |
![[SND]](/icons/sound2.gif) | pulling teeth.psid | 2008-07-05 15:11 | 2.7K | |
![[SND]](/icons/sound2.gif) | pulse.psid | 2008-07-05 15:11 | 2.2K | |
![[SND]](/icons/sound2.gif) | puppet on a string.psid | 2018-01-02 16:12 | 2.5K | |
![[SND]](/icons/sound2.gif) | puzzled.psid | 2008-07-05 15:11 | 3.6K | |
![[SND]](/icons/sound2.gif) | pyromaniac'99.psid | 2008-07-05 15:11 | 3.7K | |
![[SND]](/icons/sound2.gif) | pyromaniac (burn mix).psid | 2018-12-09 11:12 | 2.5K | |
![[SND]](/icons/sound2.gif) | pyromaniac (buzz mix).psid | 2008-07-05 15:11 | 2.4K | |
![[SND]](/icons/sound2.gif) | pyromaniac.psid | 2018-12-09 11:12 | 2.4K | |
![[SND]](/icons/sound2.gif) | quick march.psid | 2008-07-05 15:11 | 2.3K | |
![[SND]](/icons/sound2.gif) | quiet vale.psid | 2008-07-05 15:11 | 3.2K | |
![[SND]](/icons/sound2.gif) | rapide (version 1).psid | 2008-07-05 15:11 | 2.1K | |
![[SND]](/icons/sound2.gif) | rapide (version 2).psid | 2008-07-05 15:11 | 2.1K | |
![[SND]](/icons/sound2.gif) | rapide.psid | 2018-01-02 16:12 | 2.1K | |
![[SND]](/icons/sound2.gif) | rasterline.psid | 2008-07-05 15:11 | 2.3K | |
![[SND]](/icons/sound2.gif) | red red robin.psid | 2008-07-05 15:11 | 2.2K | |
![[SND]](/icons/sound2.gif) | regatta de blanc.psid | 2008-07-05 15:11 | 2.1K | |
![[SND]](/icons/sound2.gif) | rehumanise yourself.psid | 2008-07-05 15:11 | 2.6K | |
![[SND]](/icons/sound2.gif) | reminder.psid | 2008-07-05 15:11 | 3.5K | |
![[SND]](/icons/sound2.gif) | rendez-vous 3.psid | 2018-01-02 16:12 | 1.8K | |
![[SND]](/icons/sound2.gif) | rendez-vous 4.psid | 2018-01-02 16:12 | 2.1K | |
![[SND]](/icons/sound2.gif) | rendezvous '95.psid | 2018-12-16 11:13 | 6.3K | |
![[SND]](/icons/sound2.gif) | rendezvous '98.psid | 2008-07-05 15:11 | 1.9K | |
![[SND]](/icons/sound2.gif) | rendezvous 2.psid | 2008-07-05 15:11 | 3.0K | |
![[SND]](/icons/sound2.gif) | reorder.psid | 2018-01-02 16:12 | 3.2K | |
![[SND]](/icons/sound2.gif) | retrotype.psid | 2018-01-02 16:12 | 2.1K | |
![[SND]](/icons/sound2.gif) | revenge (track 1).psid | 2008-07-05 15:11 | 3.4K | |
![[SND]](/icons/sound2.gif) | revenge (track 2).psid | 2008-07-05 15:11 | 3.3K | |
![[SND]](/icons/sound2.gif) | rivers of babylon.psid | 2018-01-02 16:12 | 2.0K | |
![[SND]](/icons/sound2.gif) | rock 'n' role music.psid | 2008-07-05 15:11 | 3.8K | |
![[SND]](/icons/sound2.gif) | rock'n'roll star.psid | 2008-07-05 15:11 | 3.6K | |
![[SND]](/icons/sound2.gif) | rock'n role #26 (intro).psid | 2018-01-02 16:12 | 2.1K | |
![[SND]](/icons/sound2.gif) | rock'n role 25 intro.psid | 2008-07-05 15:11 | 2.1K | |
![[SND]](/icons/sound2.gif) | rock and roll music.psid | 2008-07-05 15:11 | 3.0K | |
![[SND]](/icons/sound2.gif) | rockin' chair.psid | 2008-07-05 15:11 | 2.4K | |
![[SND]](/icons/sound2.gif) | rocknrole.psid | 2008-07-05 15:11 | 3.8K | |
![[SND]](/icons/sound2.gif) | rolling on.psid | 2008-07-05 15:11 | 3.3K | |
![[SND]](/icons/sound2.gif) | roll with it'97.psid | 2018-01-02 16:12 | 4.4K | |
![[SND]](/icons/sound2.gif) | roll with it (old version).psid | 2018-01-02 16:12 | 3.6K | |
![[SND]](/icons/sound2.gif) | roll with it.psid | 2018-01-02 16:12 | 4.4K | |
![[SND]](/icons/sound2.gif) | ron's piece.psid | 2008-07-05 15:11 | 3.4K | |
![[SND]](/icons/sound2.gif) | round are way.psid | 2008-07-05 15:11 | 2.4K | |
![[SND]](/icons/sound2.gif) | roxanne.psid | 2008-07-05 15:11 | 2.6K | |
![[SND]](/icons/sound2.gif) | rush hour.psid | 2018-12-09 11:12 | 2.0K | |
![[SND]](/icons/sound2.gif) | rustic dance.psid | 2008-07-05 15:11 | 1.8K | |
![[SND]](/icons/sound2.gif) | sadness.psid | 2008-07-05 15:11 | 2.2K | |
![[SND]](/icons/sound2.gif) | sad planet.psid | 2008-07-05 15:11 | 2.3K | |
![[SND]](/icons/sound2.gif) | saga of the cute things.psid | 2008-07-05 15:11 | 3.0K | |
![[SND]](/icons/sound2.gif) | sassafra's roots.psid | 2008-07-05 15:11 | 2.9K | |
![[SND]](/icons/sound2.gif) | say you'll be there.psid | 2008-07-05 15:11 | 2.8K | |
![[SND]](/icons/sound2.gif) | scene world #1.psid | 2008-07-05 15:11 | 2.3K | |
![[SND]](/icons/sound2.gif) | school days.psid | 2008-07-05 15:11 | 2.5K | |
![[SND]](/icons/sound2.gif) | secret journey.psid | 2008-07-05 15:11 | 2.4K | |
![[SND]](/icons/sound2.gif) | see sharp.psid | 2008-07-05 15:11 | 1.6K | |
![[SND]](/icons/sound2.gif) | semisad.psid | 2008-07-05 15:11 | 2.8K | |
![[SND]](/icons/sound2.gif) | sentinel's return.psid | 2008-07-05 15:11 | 2.1K | |
![[SND]](/icons/sound2.gif) | sentinel returns trance.psid | 2008-07-05 15:11 | 3.4K | |
![[SND]](/icons/sound2.gif) | sgt pepper's lonely hearts club.psid | 2008-07-05 15:11 | 4.4K | |
![[SND]](/icons/sound2.gif) | shadow.psid | 2008-07-05 15:11 | 3.4K | |
![[SND]](/icons/sound2.gif) | shadows in the rain.psid | 2018-01-02 16:12 | 2.1K | |
![[SND]](/icons/sound2.gif) | shake a tailfeather.psid | 2018-01-02 16:12 | 3.3K | |
![[SND]](/icons/sound2.gif) | shake a tailfeather 2000.psid | 2018-01-02 16:12 | 3.3K | |
![[SND]](/icons/sound2.gif) | shake it.psid | 2008-07-05 15:11 | 1.8K | |
![[SND]](/icons/sound2.gif) | shakermaker.psid | 2008-07-05 15:11 | 3.4K | |
![[SND]](/icons/sound2.gif) | shambell.psid | 2008-07-05 15:11 | 1.9K | |
![[SND]](/icons/sound2.gif) | she's electric (electric mix).psid | 2018-12-09 11:12 | 3.3K | |
![[SND]](/icons/sound2.gif) | she's electric (mix).psid | 2008-07-05 15:11 | 3.3K | |
![[SND]](/icons/sound2.gif) | she's electric.psid | 2008-07-05 15:11 | 3.3K | |
![[SND]](/icons/sound2.gif) | she's so high.psid | 2018-12-09 11:12 | 2.5K | |
![[SND]](/icons/sound2.gif) | she.psid | 2008-07-05 15:11 | 2.8K | |
![[SND]](/icons/sound2.gif) | she caught the katy.psid | 2018-01-02 16:12 | 3.4K | |
![[SND]](/icons/sound2.gif) | she loves you.psid | 2008-07-05 15:11 | 3.1K | |
![[SND]](/icons/sound2.gif) | shogun.psid | 2008-07-05 15:11 | 3.7K | |
![[SND]](/icons/sound2.gif) | shut up.psid | 2008-07-05 15:11 | 2.6K | |
![[SND]](/icons/sound2.gif) | sibling rivalry.psid | 2008-07-05 15:11 | 4.2K | |
![[SND]](/icons/sound2.gif) | silent night.psid | 2008-07-05 15:11 | 3.4K | |
![[SND]](/icons/sound2.gif) | simpsons theme & do the bartman.psid | 2018-01-02 16:12 | 3.9K | |
![[SND]](/icons/sound2.gif) | simpsons treehouse'horror.psid | 2008-07-05 15:11 | 3.1K | |
![[SND]](/icons/sound2.gif) | sing.psid | 2018-12-09 11:12 | 2.2K | |
![[SND]](/icons/sound2.gif) | sinister (2000).psid | 2008-07-05 15:11 | 4.0K | |
![[SND]](/icons/sound2.gif) | sinister.psid | 2018-12-09 11:12 | 2.2K | |
![[SND]](/icons/sound2.gif) | ska's back (mix) (6581).psid | 2008-07-05 15:11 | 2.4K | |
![[SND]](/icons/sound2.gif) | ska's back (mix) (8580).psid | 2008-07-05 15:11 | 2.4K | |
![[SND]](/icons/sound2.gif) | ska is back.psid | 2018-12-09 11:12 | 2.2K | |
![[SND]](/icons/sound2.gif) | skandal.psid | 2018-12-09 11:12 | 2.4K | |
![[SND]](/icons/sound2.gif) | ska to the world.psid | 2008-07-05 15:11 | 3.7K | |
![[SND]](/icons/sound2.gif) | sleepy hollow.psid | 2008-07-05 15:11 | 2.1K | |
![[SND]](/icons/sound2.gif) | slide away.psid | 2008-07-05 15:11 | 4.2K | |
![[SND]](/icons/sound2.gif) | slight return.psid | 2008-07-05 15:11 | 2.9K | |
![[SND]](/icons/sound2.gif) | slowcoach.psid | 2018-12-09 11:12 | 2.2K | |
![[SND]](/icons/sound2.gif) | slow down.psid | 2018-12-09 11:12 | 2.4K | |
![[SND]](/icons/sound2.gif) | snoopy.psid | 2008-07-05 15:11 | 3.7K | |
![[SND]](/icons/sound2.gif) | soft 'n' gentle (6581).psid | 2008-07-05 15:11 | 1.9K | |
![[SND]](/icons/sound2.gif) | soft 'n' gentle (8580).psid | 2008-07-05 15:11 | 1.9K | |
![[SND]](/icons/sound2.gif) | software.psid | 2008-07-05 15:11 | 3.4K | |
![[SND]](/icons/sound2.gif) | so let me go far.psid | 2008-07-05 15:11 | 2.8K | |
![[SND]](/icons/sound2.gif) | so lonely.psid | 2008-07-05 15:11 | 2.8K | |
![[SND]](/icons/sound2.gif) | some might say.psid | 2008-07-05 15:11 | 4.2K | |
![[SND]](/icons/sound2.gif) | some people say.psid | 2008-07-05 15:11 | 2.9K | |
![[SND]](/icons/sound2.gif) | something kinda funny.psid | 2008-07-05 15:11 | 2.6K | |
![[SND]](/icons/sound2.gif) | souvenir '95.psid | 2018-12-16 11:13 | 4.6K | |
![[SND]](/icons/sound2.gif) | souvenir de chine.psid | 2008-07-05 15:11 | 1.8K | |
![[SND]](/icons/sound2.gif) | souvenir de chine 1999.psid | 2008-07-05 15:11 | 3.4K | |
![[SND]](/icons/sound2.gif) | speednik.psid | 2008-07-05 15:11 | 2.0K | |
![[SND]](/icons/sound2.gif) | spinoff.psid | 2018-12-09 11:12 | 2.3K | |
![[SND]](/icons/sound2.gif) | spiral.psid | 2008-07-05 15:11 | 2.2K | |
![[SND]](/icons/sound2.gif) | spirits in the material world.psid | 2018-01-02 16:12 | 2.2K | |
![[SND]](/icons/sound2.gif) | spring.psid | 2008-07-05 15:11 | 3.6K | |
![[SND]](/icons/sound2.gif) | springfield soul stew.psid | 2008-07-05 15:11 | 2.1K | |
![[SND]](/icons/sound2.gif) | springtime.psid | 2008-07-05 15:11 | 3.2K | |
![[SND]](/icons/sound2.gif) | squeezebox.psid | 2008-07-05 15:11 | 2.5K | |
![[SND]](/icons/sound2.gif) | stand by me.psid | 2018-01-02 16:12 | 2.3K | |
![[SND]](/icons/sound2.gif) | stardust.psid | 2008-07-05 15:11 | 1.5K | |
![[SND]](/icons/sound2.gif) | starload.psid | 2008-07-05 15:11 | 3.0K | |
![[SND]](/icons/sound2.gif) | star trek original tv theme.psid | 2008-07-05 15:11 | 2.1K | |
![[SND]](/icons/sound2.gif) | staying out for the summer.psid | 2018-01-02 16:12 | 3.0K | |
![[SND]](/icons/sound2.gif) | step out.psid | 2018-12-09 11:12 | 2.7K | |
![[SND]](/icons/sound2.gif) | stereotypes.psid | 2008-07-05 15:11 | 2.8K | |
![[SND]](/icons/sound2.gif) | stop.psid | 2008-07-05 15:11 | 4.0K | |
![[SND]](/icons/sound2.gif) | strawberry fields forever.psid | 2008-07-05 15:11 | 3.6K | |
![[SND]](/icons/sound2.gif) | subway.psid | 2008-07-05 15:11 | 1.9K | |
![[SND]](/icons/sound2.gif) | sultans of swing.psid | 2018-01-02 16:12 | 5.9K | |
![[SND]](/icons/sound2.gif) | summer.psid | 2008-07-05 15:11 | 3.5K | |
![[SND]](/icons/sound2.gif) | summer breeze.psid | 2018-12-09 11:12 | 2.0K | |
![[SND]](/icons/sound2.gif) | summer fever.psid | 2008-07-05 15:11 | 2.4K | |
![[SND]](/icons/sound2.gif) | sun and the rain.psid | 2018-01-02 16:12 | 3.1K | |
![[SND]](/icons/sound2.gif) | sunday sunday.psid | 2018-12-09 11:12 | 2.6K | |
![[SND]](/icons/sound2.gif) | sunshine.psid | 2018-12-16 11:13 | 3.2K | |
![[SND]](/icons/sound2.gif) | supercalifragilistic.psid | 2008-07-05 15:11 | 2.1K | |
![[SND]](/icons/sound2.gif) | supersonic'97.psid | 2008-07-05 15:11 | 3.8K | |
![[SND]](/icons/sound2.gif) | supersonic (old version).psid | 2008-07-05 15:11 | 2.7K | |
![[SND]](/icons/sound2.gif) | supersonic.psid | 2008-07-05 15:11 | 3.8K | |
![[SND]](/icons/sound2.gif) | sweet home chicago.psid | 2008-07-05 15:11 | 3.7K | |
![[SND]](/icons/sound2.gif) | synchotron.psid | 2008-07-05 15:11 | 2.5K | |
![[SND]](/icons/sound2.gif) | synchronicity i.psid | 2008-07-05 15:11 | 2.6K | |
![[SND]](/icons/sound2.gif) | synchronicity ii.psid | 2008-07-05 15:11 | 4.1K | |
![[SND]](/icons/sound2.gif) | take me away.psid | 2008-07-05 15:11 | 2.6K | |
![[SND]](/icons/sound2.gif) | take two.psid | 2018-12-09 11:12 | 2.4K | |
![[SND]](/icons/sound2.gif) | tales of draggo.psid | 2018-01-02 16:12 | 3.5K | |
![[SND]](/icons/sound2.gif) | talk tonight.psid | 2008-07-05 15:11 | 2.7K | |
![[SND]](/icons/sound2.gif) | tangent.psid | 2008-07-05 15:11 | 3.2K | |
![[SND]](/icons/sound2.gif) | taxman.psid | 2008-07-05 15:11 | 2.6K | |
![[SND]](/icons/sound2.gif) | tea in the sahara.psid | 2018-01-02 16:12 | 2.6K | |
![[SND]](/icons/sound2.gif) | techno can-can.psid | 2008-07-05 15:11 | 3.5K | |
![[SND]](/icons/sound2.gif) | teddy bear.psid | 2008-07-05 15:11 | 2.1K | |
![[SND]](/icons/sound2.gif) | teddy bears' picnic.psid | 2008-07-05 15:11 | 3.1K | |
![[SND]](/icons/sound2.gif) | temper.psid | 2018-12-09 11:12 | 2.9K | |
![[SND]](/icons/sound2.gif) | that old landmark.psid | 2008-07-05 15:11 | 3.5K | |
![[SND]](/icons/sound2.gif) | the a-team theme (2001).psid | 2008-07-05 15:11 | 2.5K | |
![[SND]](/icons/sound2.gif) | the a-team theme.psid | 2008-07-05 15:11 | 2.2K | |
![[SND]](/icons/sound2.gif) | the blues brothers album part 1.psid | 2018-12-16 11:13 | 7.9K | |
![[SND]](/icons/sound2.gif) | the blues brothers album part 2.psid | 2018-12-16 11:13 | 9.1K | |
![[SND]](/icons/sound2.gif) | the chad who loved me.psid | 2008-07-05 15:11 | 3.3K | |
![[SND]](/icons/sound2.gif) | the clan (6581).psid | 2008-07-05 15:11 | 1.9K | |
![[SND]](/icons/sound2.gif) | the clan.psid | 2018-01-02 16:12 | 1.9K | |
![[SND]](/icons/sound2.gif) | the continuing story of bungalo.psid | 2018-01-02 16:12 | 3.0K | |
![[SND]](/icons/sound2.gif) | the court.psid | 2008-07-05 15:11 | 2.0K | |
![[SND]](/icons/sound2.gif) | the darkness.psid | 2008-07-05 15:11 | 2.7K | |
![[SND]](/icons/sound2.gif) | the dream.psid | 2008-07-05 15:11 | 2.2K | |
![[SND]](/icons/sound2.gif) | the duke.psid | 2008-07-05 15:11 | 1.9K | |
![[SND]](/icons/sound2.gif) | the fall.psid | 2008-07-05 15:11 | 2.4K | |
![[SND]](/icons/sound2.gif) | the haunting.psid | 2008-07-05 15:11 | 2.3K | |
![[SND]](/icons/sound2.gif) | the howling.psid | 2018-12-09 11:12 | 2.2K | |
![[SND]](/icons/sound2.gif) | the jester.psid | 2008-07-05 15:11 | 3.7K | |
![[SND]](/icons/sound2.gif) | the kid.psid | 2008-07-05 15:11 | 3.4K | |
![[SND]](/icons/sound2.gif) | the laboratory (experimenting).psid | 2008-07-05 15:11 | 2.9K | |
![[SND]](/icons/sound2.gif) | the laboratory.psid | 2008-07-05 15:11 | 2.4K | |
![[SND]](/icons/sound2.gif) | the long and winding road.psid | 2008-07-05 15:11 | 3.0K | |
![[SND]](/icons/sound2.gif) | the lullaby.psid | 2008-07-05 15:11 | 2.3K | |
![[SND]](/icons/sound2.gif) | the magic roundabout (gabba).psid | 2008-07-05 15:11 | 1.9K | |
![[SND]](/icons/sound2.gif) | the magic roundabout (jarre).psid | 2008-07-05 15:11 | 3.0K | |
![[SND]](/icons/sound2.gif) | the magic roundabout(teletubby).psid | 2008-07-05 15:11 | 2.3K | |
![[SND]](/icons/sound2.gif) | the masterplan.psid | 2008-07-05 15:11 | 2.8K | |
![[SND]](/icons/sound2.gif) | theme from rawhide.psid | 2018-01-02 16:12 | 3.2K | |
![[SND]](/icons/sound2.gif) | the other way of stopping.psid | 2008-07-05 15:11 | 1.8K | |
![[SND]](/icons/sound2.gif) | the phage (vidiian remix).psid | 2008-07-05 15:11 | 2.9K | |
![[SND]](/icons/sound2.gif) | the phage.psid | 2008-07-05 15:11 | 3.1K | |
![[SND]](/icons/sound2.gif) | the prince.psid | 2008-07-05 15:11 | 2.9K | |
![[SND]](/icons/sound2.gif) | there's no other way'99.psid | 2008-07-05 15:11 | 2.1K | |
![[SND]](/icons/sound2.gif) | there's no other way (remix).psid | 2008-07-05 15:11 | 2.4K | |
![[SND]](/icons/sound2.gif) | there's no other way.psid | 2018-12-09 11:12 | 2.4K | |
![[SND]](/icons/sound2.gif) | the royle family theme.psid | 2008-07-05 15:11 | 4.1K | |
![[SND]](/icons/sound2.gif) | the show must go on.psid | 2008-07-05 15:11 | 4.5K | |
![[SND]](/icons/sound2.gif) | the simpsons (theme).psid | 2008-07-05 15:11 | 3.1K | |
![[SND]](/icons/sound2.gif) | the struggle.psid | 2008-07-05 15:11 | 2.3K | |
![[SND]](/icons/sound2.gif) | the universal.psid | 2008-07-05 15:11 | 2.5K | |
![[SND]](/icons/sound2.gif) | the wanderer.psid | 2008-07-05 15:11 | 2.6K | |
![[SND]](/icons/sound2.gif) | think!.psid | 2008-07-05 15:11 | 3.1K | |
![[SND]](/icons/sound2.gif) | this is a low.psid | 2018-01-02 16:12 | 2.4K | |
![[SND]](/icons/sound2.gif) | three lions.psid | 2018-12-09 11:12 | 2.7K | |
![[SND]](/icons/sound2.gif) | ticket to ride.psid | 2018-01-02 16:12 | 3.0K | |
![[SND]](/icons/sound2.gif) | timer.psid | 2008-07-05 15:11 | 2.3K | |
![[SND]](/icons/sound2.gif) | titan.psid | 2018-01-02 16:12 | 2.5K | |
![[SND]](/icons/sound2.gif) | to be free.psid | 2008-07-05 15:11 | 2.8K | |
![[SND]](/icons/sound2.gif) | together.psid | 2008-07-05 15:11 | 2.6K | |
![[SND]](/icons/sound2.gif) | toggle.psid | 2018-12-09 11:12 | 2.2K | |
![[SND]](/icons/sound2.gif) | tomorrow's just another day.psid | 2008-07-05 15:11 | 2.9K | |
![[SND]](/icons/sound2.gif) | too dismal (unreleased).psid | 2008-07-05 15:11 | 2.0K | |
![[SND]](/icons/sound2.gif) | too much.psid | 2008-07-05 15:11 | 4.0K | |
![[SND]](/icons/sound2.gif) | too much information.psid | 2008-07-05 15:11 | 1.9K | |
![[SND]](/icons/sound2.gif) | top man.psid | 2008-07-05 15:11 | 2.7K | |
![[SND]](/icons/sound2.gif) | to the end.psid | 2018-01-02 16:12 | 2.4K | |
![[SND]](/icons/sound2.gif) | track 3.psid | 2008-07-05 15:11 | 2.9K | |
![[SND]](/icons/sound2.gif) | tracy jacks.psid | 2008-07-05 15:11 | 2.2K | |
![[SND]](/icons/sound2.gif) | traffic.psid | 2008-07-05 15:11 | 3.6K | |
![[SND]](/icons/sound2.gif) | trainz.psid | 2008-07-05 15:11 | 3.1K | |
![[SND]](/icons/sound2.gif) | trance (hypnosis remix).psid | 2008-07-05 15:11 | 2.5K | |
![[SND]](/icons/sound2.gif) | trance (remix).psid | 2008-07-05 15:11 | 2.3K | |
![[SND]](/icons/sound2.gif) | trance.psid | 2018-12-09 11:12 | 2.0K | |
![[SND]](/icons/sound2.gif) | trial.psid | 2018-12-09 11:12 | 2.2K | |
![[SND]](/icons/sound2.gif) | tribute to mark cooksey.psid | 2008-07-05 15:11 | 2.3K | |
![[SND]](/icons/sound2.gif) | trio by naudot.psid | 2008-07-05 15:11 | 2.1K | |
![[SND]](/icons/sound2.gif) | triumph (extended re-mix).psid | 2018-12-09 11:12 | 2.2K | |
![[SND]](/icons/sound2.gif) | triumph (original mix).psid | 2008-07-05 15:11 | 2.1K | |
![[SND]](/icons/sound2.gif) | trolly lolly.psid | 2008-07-05 15:11 | 2.0K | |
![[SND]](/icons/sound2.gif) | truth hits everybody.psid | 2008-07-05 15:11 | 2.6K | |
![[SND]](/icons/sound2.gif) | tutti fruiti.psid | 2008-07-05 15:11 | 2.7K | |
![[SND]](/icons/sound2.gif) | twinkie.psid | 2008-07-05 15:11 | 3.5K | |
![[SND]](/icons/sound2.gif) | twist and shout.psid | 2008-07-05 15:11 | 3.8K | |
![[SND]](/icons/sound2.gif) | two become one.psid | 2008-07-05 15:11 | 2.9K | |
![[SND]](/icons/sound2.gif) | uncle sam.psid | 2008-07-05 15:11 | 2.4K | |
![[SND]](/icons/sound2.gif) | underneath the sky.psid | 2018-01-02 16:12 | 2.5K | |
![[SND]](/icons/sound2.gif) | up in the sky (mix).psid | 2018-01-02 16:12 | 2.9K | |
![[SND]](/icons/sound2.gif) | up in the sky.psid | 2018-01-02 16:12 | 2.9K | |
![[SND]](/icons/sound2.gif) | variate.psid | 2018-12-09 11:12 | 2.3K | |
![[SND]](/icons/sound2.gif) | variation.psid | 2008-07-05 15:11 | 3.2K | |
![[SND]](/icons/sound2.gif) | verbatim.psid | 2018-12-09 11:12 | 2.1K | |
![[SND]](/icons/sound2.gif) | villain.psid | 2008-07-05 15:11 | 2.1K | |
![[SND]](/icons/sound2.gif) | visions in the night.psid | 2018-01-02 16:12 | 2.5K | |
![[SND]](/icons/sound2.gif) | viva forever.psid | 2008-07-05 15:11 | 3.6K | |
![[SND]](/icons/sound2.gif) | voices inside my head.psid | 2008-07-05 15:11 | 1.8K | |
![[SND]](/icons/sound2.gif) | voodoo.psid | 2008-07-05 15:11 | 3.7K | |
![[SND]](/icons/sound2.gif) | wacky.psid | 2008-07-05 15:11 | 2.5K | |
![[SND]](/icons/sound2.gif) | waiting.psid | 2008-07-05 15:11 | 2.7K | |
![[SND]](/icons/sound2.gif) | waiting for the day.psid | 2018-01-02 16:12 | 3.2K | |
![[SND]](/icons/sound2.gif) | walking in your footsteps.psid | 2018-01-02 16:12 | 2.5K | |
![[SND]](/icons/sound2.gif) | walking on the moon (v1).psid | 2018-01-02 16:12 | 2.2K | |
![[SND]](/icons/sound2.gif) | walking on the moon (v2).psid | 2018-12-09 11:12 | 2.3K | |
![[SND]](/icons/sound2.gif) | wannabe (backwards).psid | 2018-12-09 11:12 | 2.6K | |
![[SND]](/icons/sound2.gif) | wannabe (karaoke mix).psid | 2018-12-16 11:13 | 2.3K | |
![[SND]](/icons/sound2.gif) | wannabe.psid | 2008-07-05 15:11 | 2.8K | |
![[SND]](/icons/sound2.gif) | warbler (6581).psid | 2008-07-05 15:11 | 2.0K | |
![[SND]](/icons/sound2.gif) | warbler (8580).psid | 2008-07-05 15:11 | 2.0K | |
![[SND]](/icons/sound2.gif) | warbler.psid | 2018-01-02 16:12 | 2.0K | |
![[SND]](/icons/sound2.gif) | water temple remix.psid | 2018-12-09 11:12 | 4.3K | |
![[SND]](/icons/sound2.gif) | we are the champions.psid | 2018-01-02 16:12 | 3.3K | |
![[SND]](/icons/sound2.gif) | we are together.psid | 2008-07-05 15:11 | 3.0K | |
![[SND]](/icons/sound2.gif) | welcome to paradise.psid | 2018-01-02 16:12 | 3.0K | |
![[SND]](/icons/sound2.gif) | we will rock you.psid | 2008-07-05 15:11 | 2.4K | |
![[SND]](/icons/sound2.gif) | whatever.psid | 2008-07-05 15:11 | 3.5K | |
![[SND]](/icons/sound2.gif) | what goes up.psid | 2008-07-05 15:11 | 2.2K | |
![[SND]](/icons/sound2.gif) | what i have done wrong.psid | 2008-07-05 15:11 | 2.2K | |
![[SND]](/icons/sound2.gif) | when i'm 64.psid | 2008-07-05 15:11 | 3.2K | |
![[SND]](/icons/sound2.gif) | when i come around.psid | 2008-07-05 15:11 | 2.7K | |
![[SND]](/icons/sound2.gif) | when the world is running down.psid | 2018-01-02 16:12 | 2.0K | |
![[SND]](/icons/sound2.gif) | who do you think you are.psid | 2008-07-05 15:11 | 2.8K | |
![[SND]](/icons/sound2.gif) | whole lot easier.psid | 2008-07-05 15:11 | 2.6K | |
![[SND]](/icons/sound2.gif) | wide open space (acoustic).psid | 2008-07-05 15:11 | 2.9K | |
![[SND]](/icons/sound2.gif) | wiggly.psid | 2018-12-09 11:12 | 1.7K | |
![[SND]](/icons/sound2.gif) | winding trail.psid | 2018-12-09 11:12 | 1.8K | |
![[SND]](/icons/sound2.gif) | wings of a dove.psid | 2018-01-02 16:12 | 2.6K | |
![[SND]](/icons/sound2.gif) | wipeout!.psid | 2018-12-09 11:12 | 3.0K | |
![[SND]](/icons/sound2.gif) | with a little help f. my friends.psid | 2018-12-16 11:13 | 3.4K | |
![[SND]](/icons/sound2.gif) | with a little help from my frie.psid | 2018-01-02 16:12 | 3.4K | |
![[SND]](/icons/sound2.gif) | wonder.psid | 2008-07-05 15:11 | 3.6K | |
![[SND]](/icons/sound2.gif) | wonderwall (mix 1).psid | 2008-07-05 15:11 | 3.8K | |
![[SND]](/icons/sound2.gif) | wonderwall (mix 2).psid | 2008-07-05 15:11 | 3.8K | |
![[SND]](/icons/sound2.gif) | wonderwall.psid | 2008-07-05 15:11 | 2.7K | |
![[SND]](/icons/sound2.gif) | woodstock.psid | 2008-07-05 15:11 | 3.9K | |
![[SND]](/icons/sound2.gif) | wrapped around your finger.psid | 2008-07-05 15:11 | 2.9K | |
![[SND]](/icons/sound2.gif) | yellow submarine.psid | 2008-07-05 15:11 | 2.7K | |
![[SND]](/icons/sound2.gif) | yesterday's men.psid | 2008-07-05 15:11 | 2.5K | |
![[SND]](/icons/sound2.gif) | yesterday.psid | 2008-07-05 15:11 | 2.4K | |
![[SND]](/icons/sound2.gif) | yuko and hiro.psid | 2008-07-05 15:11 | 2.5K | |
![[SND]](/icons/sound2.gif) | zany (6581).psid | 2008-07-05 15:11 | 2.3K | |
![[SND]](/icons/sound2.gif) | zany (8580).psid | 2008-07-05 15:11 | 2.3K | |
![[SND]](/icons/sound2.gif) | zoolook '95.psid | 2018-12-16 11:13 | 5.2K | |
![[SND]](/icons/sound2.gif) | zoolook.psid | 2018-12-09 11:12 | 2.5K | |
![[SND]](/icons/sound2.gif) | zoolookologie'99.psid | 2008-07-05 15:11 | 3.4K | |
![[SND]](/icons/sound2.gif) | zoolookologie.psid | 2018-12-09 11:12 | 2.0K | |
|