![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[SND]](/icons/sound2.gif) | 2 1'2 hours.psid | 2008-07-05 15:08 | 4.7K | |
![[SND]](/icons/sound2.gif) | 2 1-2 hours.psid | 2018-01-02 16:12 | 4.7K | |
![[SND]](/icons/sound2.gif) | 20cc-shit.psid | 2008-07-05 15:08 | 2.3K | |
![[SND]](/icons/sound2.gif) | a-demo tune.psid | 2008-07-05 15:08 | 2.3K | |
![[SND]](/icons/sound2.gif) | aggresjon.psid | 2018-01-02 16:12 | 2.4K | |
![[SND]](/icons/sound2.gif) | animal (part 1).psid | 2008-07-05 15:08 | 2.1K | |
![[SND]](/icons/sound2.gif) | animal (tune 4).psid | 2018-01-02 16:12 | 2.4K | |
![[SND]](/icons/sound2.gif) | antimon tune (1991).psid | 2018-12-23 11:12 | 4.8K | |
![[SND]](/icons/sound2.gif) | b-demo tune.psid | 2008-07-05 15:08 | 2.2K | |
![[SND]](/icons/sound2.gif) | bigbop tepperens.psid | 2018-01-02 16:12 | 2.6K | |
![[SND]](/icons/sound2.gif) | c-demo tune.psid | 2008-07-05 15:08 | 2.3K | |
![[SND]](/icons/sound2.gif) | clouds.psid | 2018-01-02 16:12 | 2.4K | |
![[DIR]](/icons/folder.gif) | coop-Richard Nygaard/ | 2008-07-05 15:08 | - | |
![[SND]](/icons/sound2.gif) | digital delight #1.psid | 2018-01-02 16:12 | 2.3K | |
![[SND]](/icons/sound2.gif) | digital delight #2.psid | 2018-01-02 16:12 | 2.2K | |
![[SND]](/icons/sound2.gif) | digital delight #3.psid | 2018-01-02 16:12 | 2.3K | |
![[SND]](/icons/sound2.gif) | dyster.psid | 2018-12-23 11:12 | 1.6K | |
![[SND]](/icons/sound2.gif) | ecstatic code.psid | 2008-07-05 15:08 | 3.4K | |
![[SND]](/icons/sound2.gif) | exquisite (part 5).psid | 2008-07-05 15:08 | 1.6K | |
![[SND]](/icons/sound2.gif) | foucault's pendel.psid | 2008-07-05 15:08 | 2.1K | |
![[SND]](/icons/sound2.gif) | fright intro.psid | 2018-01-02 16:12 | 2.9K | |
![[SND]](/icons/sound2.gif) | frukt yoghurt.psid | 2018-12-16 11:12 | 6.5K | |
![[SND]](/icons/sound2.gif) | funky fighter.psid | 2018-01-02 16:12 | 7.2K | |
![[SND]](/icons/sound2.gif) | game example.psid | 2018-01-02 16:12 | 3.6K | |
![[SND]](/icons/sound2.gif) | game music.psid | 2018-12-23 11:12 | 2.4K | |
![[SND]](/icons/sound2.gif) | glejazz.psid | 2018-01-02 16:12 | 2.1K | |
![[SND]](/icons/sound2.gif) | grattis zaffy.psid | 2018-01-02 16:12 | 2.7K | |
![[SND]](/icons/sound2.gif) | gul-lars.psid | 2018-01-02 16:12 | 3.8K | |
![[SND]](/icons/sound2.gif) | happy birthday abnormal.psid | 2008-07-05 15:08 | 1.7K | |
![[SND]](/icons/sound2.gif) | henning rokling - 02.psid | 2008-07-05 15:08 | 7.1K | |
![[SND]](/icons/sound2.gif) | henning rokling - 03.psid | 2008-07-05 15:08 | 2.6K | |
![[SND]](/icons/sound2.gif) | illusion crack intro.psid | 2018-01-02 16:12 | 3.1K | |
![[SND]](/icons/sound2.gif) | intro umpteen.psid | 2018-12-16 11:12 | 2.1K | |
![[SND]](/icons/sound2.gif) | jingle bells.psid | 2018-01-02 16:12 | 9.7K | |
![[SND]](/icons/sound2.gif) | manowar-creatures.psid | 2008-07-05 15:08 | 3.1K | |
![[SND]](/icons/sound2.gif) | maximum retaliation.psid | 2018-12-16 11:12 | 5.4K | |
![[SND]](/icons/sound2.gif) | maximum retaliation v1.psid | 2018-12-23 11:12 | 2.6K | |
![[SND]](/icons/sound2.gif) | mobelhandler.psid | 2012-02-05 11:37 | 2.4K | |
![[SND]](/icons/sound2.gif) | musical delight 1.psid | 2018-01-02 16:12 | 2.5K | |
![[SND]](/icons/sound2.gif) | musical delight 2.psid | 2018-01-02 16:12 | 2.8K | |
![[SND]](/icons/sound2.gif) | musical delight 3.psid | 2018-01-02 16:12 | 3.1K | |
![[SND]](/icons/sound2.gif) | musical delight 4.psid | 2018-01-02 16:12 | 2.8K | |
![[SND]](/icons/sound2.gif) | musical delight 5.psid | 2018-01-02 16:12 | 2.9K | |
![[SND]](/icons/sound2.gif) | musical delight 6.psid | 2018-01-02 16:12 | 3.0K | |
![[SND]](/icons/sound2.gif) | musical delight 7.psid | 2008-07-05 15:08 | 2.9K | |
![[SND]](/icons/sound2.gif) | ode to jeroen.psid | 2018-01-02 16:12 | 2.9K | |
![[SND]](/icons/sound2.gif) | oglejazz.psid | 2012-02-05 11:37 | 2.1K | |
![[SND]](/icons/sound2.gif) | oriental music.psid | 2018-01-02 16:12 | 3.3K | |
![[SND]](/icons/sound2.gif) | panoram2.psid | 2008-07-05 15:08 | 2.4K | |
![[SND]](/icons/sound2.gif) | piece of cake 3 (part 2).psid | 2008-07-05 15:08 | 3.4K | |
![[SND]](/icons/sound2.gif) | rastertime eating tune.psid | 2018-01-02 16:12 | 3.4K | |
![[SND]](/icons/sound2.gif) | reaction.psid | 2018-01-02 16:12 | 4.8K | |
![[SND]](/icons/sound2.gif) | saturday breakfast.psid | 2018-01-02 16:12 | 2.6K | |
![[SND]](/icons/sound2.gif) | scout remix.psid | 2018-01-02 16:12 | 3.7K | |
![[SND]](/icons/sound2.gif) | scratching.psid | 2018-01-02 16:12 | 6.5K | |
![[SND]](/icons/sound2.gif) | shitty.psid | 2008-07-05 15:08 | 2.2K | |
![[SND]](/icons/sound2.gif) | short jazz.psid | 2018-01-02 16:12 | 3.2K | |
![[SND]](/icons/sound2.gif) | sonicblast.psid | 2008-07-05 15:08 | 6.5K | |
![[SND]](/icons/sound2.gif) | sound sample 2.psid | 2018-12-23 11:12 | 2.8K | |
![[SND]](/icons/sound2.gif) | sound sample 5.psid | 2018-12-23 11:12 | 2.6K | |
![[SND]](/icons/sound2.gif) | spaze duell.psid | 2018-01-02 16:12 | 10K | |
![[SND]](/icons/sound2.gif) | squeezer (sonicblast).psid | 2018-01-02 16:12 | 6.1K | |
![[SND]](/icons/sound2.gif) | squeezer.psid | 2018-12-16 11:12 | 4.6K | |
![[SND]](/icons/sound2.gif) | strobe.psid | 2018-01-02 16:12 | 7.8K | |
![[SND]](/icons/sound2.gif) | that's the name.psid | 2018-01-02 16:12 | 2.8K | |
![[SND]](/icons/sound2.gif) | the final symphony.psid | 2008-07-05 15:08 | 2.9K | |
![[SND]](/icons/sound2.gif) | the painting is already broken.psid | 2018-01-02 16:12 | 2.1K | |
![[SND]](/icons/sound2.gif) | this year 2 (tune 2).psid | 2018-01-02 16:12 | 3.2K | |
![[SND]](/icons/sound2.gif) | too bad (og kjokken).psid | 2008-07-05 15:08 | 2.6K | |
![[SND]](/icons/sound2.gif) | unicess intro.psid | 2018-01-02 16:12 | 2.6K | |
![[SND]](/icons/sound2.gif) | unnamed.psid | 2018-12-23 11:12 | 2.7K | |
|