![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[SND]](/icons/sound2.gif) | adriana.psid | 2018-12-09 11:12 | 5.8K | |
![[SND]](/icons/sound2.gif) | a new beginning.psid | 2018-12-09 11:12 | 4.7K | |
![[SND]](/icons/sound2.gif) | antti hannula - 01.psid | 2008-07-05 15:07 | 2.2K | |
![[SND]](/icons/sound2.gif) | armageddon.psid | 2018-01-02 16:12 | 4.8K | |
![[SND]](/icons/sound2.gif) | artlight zone.psid | 2018-01-02 16:12 | 1.9K | |
![[SND]](/icons/sound2.gif) | ata.psid | 2018-12-09 11:12 | 3.1K | |
![[SND]](/icons/sound2.gif) | aviator.psid | 2018-01-02 16:12 | 3.0K | |
![[SND]](/icons/sound2.gif) | b-ball.psid | 2018-01-02 16:12 | 3.2K | |
![[SND]](/icons/sound2.gif) | belmondo.psid | 2018-01-02 16:12 | 3.0K | |
![[SND]](/icons/sound2.gif) | beyond grave.psid | 2018-01-02 16:12 | 3.0K | |
![[SND]](/icons/sound2.gif) | bisquit.psid | 2018-01-02 16:12 | 2.7K | |
![[SND]](/icons/sound2.gif) | bubble wobble intro.psid | 2018-12-09 11:12 | 4.5K | |
![[SND]](/icons/sound2.gif) | celestial fantasia.psid | 2018-12-09 11:12 | 8.8K | |
![[SND]](/icons/sound2.gif) | centuries.psid | 2018-01-02 16:12 | 3.8K | |
![[SND]](/icons/sound2.gif) | chime.psid | 2018-01-02 16:12 | 4.8K | |
![[SND]](/icons/sound2.gif) | chinchilla.psid | 2018-12-09 11:12 | 5.9K | |
![[SND]](/icons/sound2.gif) | compact.psid | 2018-01-02 16:12 | 2.6K | |
![[SND]](/icons/sound2.gif) | conflex.psid | 2018-01-02 16:12 | 2.1K | |
![[SND]](/icons/sound2.gif) | contest demo.psid | 2018-12-09 11:12 | 3.4K | |
![[DIR]](/icons/folder.gif) | coop-Juzdie/ | 2018-12-09 11:12 | - | |
![[DIR]](/icons/folder.gif) | coop-Zardax/ | 2018-01-02 16:12 | - | |
![[SND]](/icons/sound2.gif) | cooperation.psid | 2018-01-02 16:12 | 2.9K | |
![[SND]](/icons/sound2.gif) | crackwhore.psid | 2018-12-09 11:12 | 2.3K | |
![[SND]](/icons/sound2.gif) | crime city.psid | 2018-12-09 11:12 | 5.2K | |
![[SND]](/icons/sound2.gif) | dance attack.psid | 2018-01-02 16:12 | 3.5K | |
![[SND]](/icons/sound2.gif) | dash my boulder.psid | 2018-01-02 16:12 | 4.2K | |
![[SND]](/icons/sound2.gif) | days of creation.psid | 2019-08-24 07:22 | 5.2K | |
![[SND]](/icons/sound2.gif) | deadline.psid | 2018-12-09 11:12 | 4.3K | |
![[SND]](/icons/sound2.gif) | demo tune 10.psid | 2018-12-09 11:12 | 5.3K | |
![[SND]](/icons/sound2.gif) | diamonds.psid | 2018-01-02 16:12 | 2.5K | |
![[SND]](/icons/sound2.gif) | discoland.psid | 2018-01-02 16:12 | 3.2K | |
![[SND]](/icons/sound2.gif) | dream girl.psid | 2018-01-02 16:12 | 3.7K | |
![[SND]](/icons/sound2.gif) | driver's dog.psid | 2018-01-02 16:12 | 3.7K | |
![[SND]](/icons/sound2.gif) | echoes of neon.psid | 2018-12-09 11:12 | 4.0K | |
![[SND]](/icons/sound2.gif) | eleven sins.psid | 2018-12-09 11:12 | 3.0K | |
![[SND]](/icons/sound2.gif) | entering.psid | 2018-01-02 16:12 | 3.2K | |
![[SND]](/icons/sound2.gif) | eternity.psid | 2018-12-09 11:12 | 7.3K | |
![[SND]](/icons/sound2.gif) | fanfarewell.psid | 2018-01-02 16:12 | 2.1K | |
![[SND]](/icons/sound2.gif) | fantasia.psid | 2018-01-02 16:12 | 4.5K | |
![[SND]](/icons/sound2.gif) | fast lane.psid | 2018-01-02 16:12 | 5.7K | |
![[SND]](/icons/sound2.gif) | fatamorgana.psid | 2018-12-09 11:12 | 7.4K | |
![[SND]](/icons/sound2.gif) | feelin'blue.psid | 2018-12-09 11:12 | 2.0K | |
![[SND]](/icons/sound2.gif) | fields.psid | 2018-01-02 16:12 | 2.9K | |
![[SND]](/icons/sound2.gif) | fireflies.psid | 2018-01-02 16:12 | 2.7K | |
![[SND]](/icons/sound2.gif) | flexhibition.psid | 2018-12-09 11:12 | 5.0K | |
![[SND]](/icons/sound2.gif) | foreign affair.psid | 2018-01-02 16:12 | 2.7K | |
![[SND]](/icons/sound2.gif) | forever.psid | 2018-01-02 16:12 | 2.7K | |
![[SND]](/icons/sound2.gif) | forever 2012.psid | 2018-01-02 16:12 | 3.9K | |
![[SND]](/icons/sound2.gif) | frazze.psid | 2018-01-02 16:12 | 2.2K | |
![[SND]](/icons/sound2.gif) | frequency 69.psid | 2018-01-02 16:12 | 2.2K | |
![[SND]](/icons/sound2.gif) | full throttle.psid | 2018-12-09 11:12 | 6.5K | |
![[SND]](/icons/sound2.gif) | funmuzax 1 (tune 1).psid | 2018-01-02 16:12 | 2.8K | |
![[SND]](/icons/sound2.gif) | funmuzax 1 (tune 2).psid | 2018-01-02 16:12 | 2.7K | |
![[SND]](/icons/sound2.gif) | funmuzax 1 (tune 3).psid | 2018-01-02 16:12 | 2.8K | |
![[SND]](/icons/sound2.gif) | funmuzax 1 (tune 4).psid | 2018-01-02 16:12 | 2.8K | |
![[SND]](/icons/sound2.gif) | funmuzax 1 (tune 6).psid | 2018-01-02 16:12 | 2.7K | |
![[SND]](/icons/sound2.gif) | future goat.psid | 2019-08-24 07:22 | 1.9K | |
![[SND]](/icons/sound2.gif) | fuzion.psid | 2018-01-02 16:12 | 2.5K | |
![[SND]](/icons/sound2.gif) | game over.psid | 2018-01-02 16:12 | 3.0K | |
![[SND]](/icons/sound2.gif) | ghettoblaster.psid | 2018-01-02 16:12 | 2.3K | |
![[SND]](/icons/sound2.gif) | gold dust.psid | 2018-01-02 16:12 | 4.4K | |
![[SND]](/icons/sound2.gif) | golden intro memories.psid | 2018-12-09 11:12 | 8.7K | |
![[SND]](/icons/sound2.gif) | goodmood.psid | 2018-12-09 11:12 | 5.1K | |
![[SND]](/icons/sound2.gif) | hawkeye 2018.psid | 2019-08-24 07:22 | 9.1K | |
![[SND]](/icons/sound2.gif) | hero's song.psid | 2018-01-02 16:12 | 2.3K | |
![[SND]](/icons/sound2.gif) | high roller.psid | 2018-12-09 11:12 | 6.3K | |
![[SND]](/icons/sound2.gif) | high score man.psid | 2018-01-02 16:12 | 2.6K | |
![[SND]](/icons/sound2.gif) | homeboy.psid | 2018-01-02 16:12 | 3.1K | |
![[SND]](/icons/sound2.gif) | hypnopompa.psid | 2018-12-09 11:12 | 6.3K | |
![[SND]](/icons/sound2.gif) | jammin'.psid | 2018-12-09 11:12 | 2.1K | |
![[SND]](/icons/sound2.gif) | joyrider.psid | 2018-01-02 16:12 | 4.2K | |
![[SND]](/icons/sound2.gif) | kungsgatan 5d81.psid | 2018-01-02 16:12 | 3.2K | |
![[SND]](/icons/sound2.gif) | laid back sunday.psid | 2018-12-09 11:12 | 4.5K | |
![[SND]](/icons/sound2.gif) | logo 1989.psid | 2018-01-02 16:12 | 3.4K | |
![[SND]](/icons/sound2.gif) | lovely daze.psid | 2018-01-02 16:12 | 4.2K | |
![[SND]](/icons/sound2.gif) | maniac.psid | 2018-01-02 16:12 | 3.9K | |
![[SND]](/icons/sound2.gif) | mello-d pop.psid | 2018-01-02 16:12 | 2.4K | |
![[SND]](/icons/sound2.gif) | midsummer melancholy.psid | 2018-12-09 11:12 | 7.7K | |
![[SND]](/icons/sound2.gif) | million smiles.psid | 2018-01-02 16:12 | 4.5K | |
![[SND]](/icons/sound2.gif) | mindblowing.psid | 2018-01-02 16:12 | 2.3K | |
![[SND]](/icons/sound2.gif) | minimal.psid | 2018-01-02 16:12 | 1.8K | |
![[SND]](/icons/sound2.gif) | moneyfest.psid | 2018-01-02 16:12 | 3.7K | |
![[SND]](/icons/sound2.gif) | mortal.psid | 2018-12-09 11:12 | 5.7K | |
![[SND]](/icons/sound2.gif) | my first introtune.psid | 2018-01-02 16:12 | 2.8K | |
![[SND]](/icons/sound2.gif) | nekomata.psid | 2018-12-09 11:12 | 6.2K | |
![[SND]](/icons/sound2.gif) | neon (original extended version).psid | 2018-12-09 11:12 | 5.5K | |
![[SND]](/icons/sound2.gif) | neon.psid | 2018-12-09 11:12 | 5.4K | |
![[SND]](/icons/sound2.gif) | night of the raven.psid | 2018-01-02 16:12 | 3.9K | |
![[SND]](/icons/sound2.gif) | north star.psid | 2018-01-02 16:12 | 3.0K | |
![[SND]](/icons/sound2.gif) | notorious.psid | 2018-12-09 11:12 | 5.0K | |
![[SND]](/icons/sound2.gif) | no worries.psid | 2018-01-02 16:12 | 3.8K | |
![[SND]](/icons/sound2.gif) | obsession.psid | 2018-12-09 11:12 | 5.8K | |
![[SND]](/icons/sound2.gif) | o holy night.psid | 2018-01-02 16:12 | 3.1K | |
![[SND]](/icons/sound2.gif) | oldskool soundrips.psid | 2018-12-09 11:12 | 6.3K | |
![[SND]](/icons/sound2.gif) | oldskool soundrips 2.psid | 2018-12-09 11:12 | 5.0K | |
![[SND]](/icons/sound2.gif) | onward ride (c64 remix).psid | 2018-12-09 11:12 | 4.5K | |
![[SND]](/icons/sound2.gif) | onward ride (c64 remix) v2.psid | 2018-12-23 11:12 | 5.0K | |
![[SND]](/icons/sound2.gif) | peggy (remix).psid | 2018-01-02 16:12 | 2.5K | |
![[SND]](/icons/sound2.gif) | peggy.psid | 2018-01-02 16:12 | 2.6K | |
![[SND]](/icons/sound2.gif) | proven flashbacks.psid | 2018-01-02 16:12 | 4.1K | |
![[SND]](/icons/sound2.gif) | quite acid.psid | 2018-01-02 16:12 | 1.7K | |
![[SND]](/icons/sound2.gif) | reflection.psid | 2018-01-02 16:12 | 2.0K | |
![[SND]](/icons/sound2.gif) | rockin knockin.psid | 2018-01-02 16:12 | 2.0K | |
![[SND]](/icons/sound2.gif) | russian.psid | 2018-01-02 16:12 | 1.9K | |
![[SND]](/icons/sound2.gif) | scrollex.psid | 2018-01-02 16:12 | 2.7K | |
![[SND]](/icons/sound2.gif) | sledgehammer.psid | 2018-12-09 11:12 | 5.8K | |
![[SND]](/icons/sound2.gif) | sleepwalker.psid | 2018-01-02 16:12 | 2.6K | |
![[SND]](/icons/sound2.gif) | space debris.psid | 2018-12-09 11:12 | 9.5K | |
![[SND]](/icons/sound2.gif) | special tape.psid | 2018-12-09 11:12 | 3.5K | |
![[SND]](/icons/sound2.gif) | stardust.psid | 2018-01-02 16:12 | 4.0K | |
![[SND]](/icons/sound2.gif) | starfall remix.psid | 2018-12-09 11:12 | 3.4K | |
![[SND]](/icons/sound2.gif) | superhero.psid | 2018-01-02 16:12 | 2.9K | |
![[SND]](/icons/sound2.gif) | superstitious.psid | 2018-01-02 16:12 | 2.5K | |
![[SND]](/icons/sound2.gif) | swing it!.psid | 2018-01-02 16:12 | 2.2K | |
![[SND]](/icons/sound2.gif) | swing it 2!.psid | 2018-01-02 16:12 | 2.3K | |
![[SND]](/icons/sound2.gif) | tekno a-sid.psid | 2018-01-02 16:12 | 2.2K | |
![[SND]](/icons/sound2.gif) | the needle.psid | 2018-01-02 16:12 | 2.2K | |
![[SND]](/icons/sound2.gif) | the theme.psid | 2018-01-02 16:12 | 3.0K | |
![[SND]](/icons/sound2.gif) | the zoo parade.psid | 2018-12-09 11:12 | 3.6K | |
![[SND]](/icons/sound2.gif) | top gun anthem.psid | 2018-01-02 16:12 | 3.5K | |
![[SND]](/icons/sound2.gif) | tristesse again.psid | 2018-12-09 11:12 | 3.7K | |
![[SND]](/icons/sound2.gif) | vandalized paradize.psid | 2018-01-02 16:12 | 3.9K | |
![[SND]](/icons/sound2.gif) | vertigo.psid | 2018-12-09 11:12 | 4.1K | |
![[SND]](/icons/sound2.gif) | walk.psid | 2018-01-02 16:12 | 5.7K | |
![[SND]](/icons/sound2.gif) | weekend.psid | 2018-01-02 16:12 | 2.5K | |
![[SND]](/icons/sound2.gif) | whiplash.psid | 2019-08-24 07:22 | 7.3K | |
![[SND]](/icons/sound2.gif) | wicked thing.psid | 2018-01-02 16:12 | 2.6K | |
![[SND]](/icons/sound2.gif) | wings of icarus.psid | 2019-08-24 07:22 | 3.2K | |
![[SND]](/icons/sound2.gif) | wonderland.psid | 2018-01-02 16:12 | 2.2K | |
![[SND]](/icons/sound2.gif) | yes.psid | 2018-12-09 11:12 | 5.9K | |
![[SND]](/icons/sound2.gif) | you deserve gold.psid | 2018-12-09 11:12 | 3.8K | |
|