![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[SND]](/icons/sound2.gif) | aestethic.psid | 2018-01-02 16:12 | 2.6K | |
![[SND]](/icons/sound2.gif) | alltogether.psid | 2018-01-02 16:12 | 2.5K | |
![[SND]](/icons/sound2.gif) | amigos.psid | 2018-01-02 16:12 | 2.9K | |
![[SND]](/icons/sound2.gif) | broken dreams.psid | 2018-01-02 16:12 | 2.3K | |
![[SND]](/icons/sound2.gif) | conqueror.psid | 2008-07-05 15:03 | 5.8K | |
![[SND]](/icons/sound2.gif) | cosmic dance.psid | 2018-01-02 16:12 | 2.8K | |
![[SND]](/icons/sound2.gif) | cyberotica.psid | 2018-01-02 16:12 | 2.9K | |
![[SND]](/icons/sound2.gif) | dance trial.psid | 2018-01-02 16:12 | 2.7K | |
![[SND]](/icons/sound2.gif) | dancing queen.psid | 2018-01-02 16:12 | 2.6K | |
![[SND]](/icons/sound2.gif) | das model.psid | 2018-01-02 16:12 | 2.4K | |
![[SND]](/icons/sound2.gif) | datura.psid | 2008-07-05 15:03 | 3.6K | |
![[SND]](/icons/sound2.gif) | destruktor.psid | 2008-07-05 15:03 | 3.0K | |
![[SND]](/icons/sound2.gif) | discontented.psid | 2018-01-02 16:12 | 3.0K | |
![[SND]](/icons/sound2.gif) | electro baset.psid | 2008-07-05 15:03 | 3.4K | |
![[SND]](/icons/sound2.gif) | energy.psid | 2018-01-02 16:12 | 2.9K | |
![[SND]](/icons/sound2.gif) | eternity.psid | 2018-01-02 16:12 | 4.1K | |
![[SND]](/icons/sound2.gif) | fiction.psid | 2018-01-02 16:12 | 3.0K | |
![[SND]](/icons/sound2.gif) | forever young.psid | 2018-01-02 16:12 | 2.5K | |
![[SND]](/icons/sound2.gif) | future generation.psid | 2018-01-02 16:12 | 2.9K | |
![[SND]](/icons/sound2.gif) | hard zone.psid | 2018-01-02 16:12 | 3.0K | |
![[SND]](/icons/sound2.gif) | hopper.psid | 2008-07-05 15:03 | 5.6K | |
![[SND]](/icons/sound2.gif) | i have a dream.psid | 2018-01-02 16:12 | 3.0K | |
![[SND]](/icons/sound2.gif) | max-mix.psid | 2018-01-02 16:12 | 4.3K | |
![[SND]](/icons/sound2.gif) | mental machine.psid | 2008-07-05 15:03 | 3.3K | |
![[SND]](/icons/sound2.gif) | mystery invaders.psid | 2018-01-02 16:12 | 3.2K | |
![[SND]](/icons/sound2.gif) | no pressure.psid | 2018-01-02 16:12 | 3.0K | |
![[SND]](/icons/sound2.gif) | o.k.psid | 2008-07-05 15:03 | 2.5K | |
![[SND]](/icons/sound2.gif) | ode 2 m. b.psid | 2018-01-02 16:12 | 2.8K | |
![[SND]](/icons/sound2.gif) | omega.psid | 2008-07-05 15:03 | 4.2K | |
![[SND]](/icons/sound2.gif) | planetoida.psid | 2008-07-05 15:03 | 4.3K | |
![[SND]](/icons/sound2.gif) | power machine.psid | 2018-01-02 16:12 | 2.4K | |
![[SND]](/icons/sound2.gif) | power rave.psid | 2008-07-05 15:03 | 4.2K | |
![[SND]](/icons/sound2.gif) | radiation.psid | 2018-01-02 16:12 | 2.6K | |
![[SND]](/icons/sound2.gif) | ravenous.psid | 2008-07-05 15:03 | 4.1K | |
![[SND]](/icons/sound2.gif) | reaction.psid | 2018-01-02 16:12 | 3.4K | |
![[SND]](/icons/sound2.gif) | relax it's beautiful.psid | 2018-01-02 16:12 | 2.4K | |
![[SND]](/icons/sound2.gif) | scuter.psid | 2008-07-05 15:03 | 3.2K | |
![[SND]](/icons/sound2.gif) | secrets.psid | 2018-01-02 16:12 | 2.7K | |
![[SND]](/icons/sound2.gif) | silient running.psid | 2008-07-05 15:03 | 3.4K | |
![[SND]](/icons/sound2.gif) | space invaders.psid | 2018-01-02 16:12 | 3.3K | |
![[SND]](/icons/sound2.gif) | space voyager.psid | 2008-07-05 15:03 | 5.1K | |
![[SND]](/icons/sound2.gif) | speedway.psid | 2008-07-05 15:03 | 3.2K | |
![[SND]](/icons/sound2.gif) | techno mix.psid | 2018-01-02 16:12 | 3.1K | |
![[SND]](/icons/sound2.gif) | techno road.psid | 2018-01-02 16:12 | 3.2K | |
![[SND]](/icons/sound2.gif) | tekkno.psid | 2008-07-05 15:03 | 3.1K | |
![[SND]](/icons/sound2.gif) | terror.psid | 2008-07-05 15:03 | 2.7K | |
![[SND]](/icons/sound2.gif) | the real thing.psid | 2018-01-02 16:12 | 2.8K | |
![[SND]](/icons/sound2.gif) | time to move.psid | 2018-01-02 16:12 | 3.1K | |
![[SND]](/icons/sound2.gif) | trance mix.psid | 2018-01-02 16:12 | 3.3K | |
![[SND]](/icons/sound2.gif) | tron.psid | 2008-07-05 15:03 | 6.2K | |
![[SND]](/icons/sound2.gif) | ucieczka z tropiku 1.psid | 2018-01-02 16:12 | 2.6K | |
![[SND]](/icons/sound2.gif) | ucieczka z tropiku 2.psid | 2018-01-02 16:12 | 2.7K | |
![[SND]](/icons/sound2.gif) | visitors.psid | 2008-07-05 15:03 | 3.4K | |
|