![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| free your.xm | 2008-07-03 13:41 | 71K | |
| fly in the sky.xm | 2008-07-03 13:41 | 95K | |
| keep the fire.xm | 2008-07-03 13:41 | 105K | |
| chasm.xm | 2008-07-03 13:41 | 126K | |
| see saw.xm | 2008-07-03 13:42 | 140K | |
| trance-acid 18-.xm | 2018-01-02 15:54 | 159K | |
| irish infection.xm | 2008-07-03 13:41 | 168K | |
| to france.xm | 2008-07-03 13:42 | 198K | |
| intrude.xm | 2008-07-03 13:41 | 253K | |
| drew-no.xm | 2008-07-03 13:41 | 282K | |
| hipop.xm | 2008-07-03 13:41 | 315K | |
| confrontation.xm | 2008-07-03 13:41 | 335K | |
| cirrus minor.xm | 2008-07-03 13:41 | 341K | |
| betoszczel 2.xm | 2008-07-03 13:41 | 346K | |
| fable.xm | 2008-07-03 13:41 | 358K | |
| sky shield.xm | 2008-07-03 13:42 | 391K | |
| jedziem na wielbark.xm | 2008-07-03 13:41 | 395K | |
| out of choices.xm | 2008-07-03 13:41 | 426K | |
| ann.xm | 2008-07-03 13:41 | 465K | |
| cluster one.xm | 2008-07-03 13:41 | 517K | |
| on the rail.xm | 2008-07-03 13:41 | 521K | |
| killer 2(000).xm | 2008-07-03 13:41 | 540K | |
| isosceles triangle.xm | 2008-07-03 13:41 | 540K | |
| pearl girl.xm | 2008-07-03 13:42 | 594K | |
| -ki- flowing.xm | 2008-07-03 13:41 | 613K | |
| no shelter.xm | 2008-07-03 13:41 | 626K | |
| synthetic minds.xm | 2008-07-03 13:42 | 776K | |
| it feels good.xm | 2008-07-03 13:41 | 805K | |
| chemical floor.xm | 2008-07-03 13:41 | 842K | |
| overtaken clouds.xm | 2008-07-03 13:42 | 852K | |
| rizer.xm | 2008-07-03 13:42 | 889K | |
| acid eruption.xm | 2008-07-03 13:41 | 925K | |
| doors of perception.xm | 2008-07-03 13:41 | 1.2M | |
| robotica.xm | 2008-07-03 13:42 | 1.2M | |
| sphere.xm | 2008-07-03 13:42 | 1.5M | |