![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|---|
|
|---|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[ ]](/icons/unknown.gif) | acid 738 - dead in tension remix.xm | 2011-08-14 13:32 | 816K | |
| acid 738 - throw da chimic remix.xm | 2011-08-14 13:32 | 663K | |
| acid 738 - trainspotters mix.xm | 2011-08-14 13:32 | 1.4M | |
| acidimin kick.xm | 2008-07-03 11:39 | 599K | |
| acoustic earterror.xm | 2008-07-03 11:39 | 252K | |
| alien on my console.xm | 2008-07-03 11:39 | 1.2M | |
| armed sequences rmx.xm | 2008-07-03 11:40 | 1.7M | |
| astral motion remix.xm | 2008-07-03 11:40 | 834K | |
| atomic birds.xm | 2008-07-03 11:40 | 1.2M | |
| baby chocolaty.xm | 2008-07-03 11:40 | 454K | |
| bass toys.xm | 2008-07-03 11:40 | 787K | |
| clockworks.xm | 2008-07-03 11:40 | 852K | |
| computer love remake.xm | 2008-07-03 11:40 | 487K | |
![[DIR]](/icons/folder.gif) | coop-Charlie D/ | 2011-08-14 13:37 | - | |
| coop-Ronald van Aggelen/ | 2011-08-14 13:37 | - | |
| coop-Ronny/ | 2021-04-17 07:18 | - | |
| coop-Wybrova/ | 2008-07-03 11:45 | - | |
| crossing of the energizer man.xm | 2011-08-14 13:33 | 721K | |
| difference of reality.xm | 2008-07-03 11:40 | 279K | |
| digital pitch pump.xm | 2008-07-03 11:40 | 531K | |
| dream halucination.xm | 2008-07-03 11:41 | 2.5M | |
| dust and blue sky.xm | 2008-07-03 11:41 | 1.1M | |
| edge of the limits.xm | 2008-07-03 11:41 | 350K | |
| encapsulated (edit one).xm | 2011-08-14 13:33 | 265K | |
| energy groove.xm | 2011-08-14 13:33 | 857K | |
| entranced dimension.xm | 2008-07-03 11:41 | 1.2M | |
| facelift part one.xm | 2008-07-03 11:41 | 866K | |
| facelift part three.xm | 2008-07-03 11:41 | 1.6M | |
| facelift part two.xm | 2008-07-03 11:41 | 1.1M | |
| flowers dont grow in concrete.xm | 2011-08-14 13:33 | 1.3M | |
| grey locust.xm | 2008-07-03 11:42 | 364K | |
| imitations.xm | 2008-07-03 11:42 | 739K | |
| indigo mood.xm | 2023-11-18 04:52 | 392K | |
| kolbenfresser remix.xm | 2008-07-03 11:42 | 895K | |
| liverpool (trashis mix).xm | 2011-08-14 13:33 | 903K | |
| m-tone mix vol 1.xm | 2011-08-14 13:34 | 2.5M | |
| molecular distorsion.xm | 2008-07-03 11:42 | 823K | |
| mouvais et beau.xm | 2011-08-14 13:34 | 1.2M | |
| neohardophilic.xm | 2008-07-03 11:42 | 332K | |
| noise research.xm | 2008-07-03 11:42 | 359K | |
| obscure spectre.xm | 2008-07-03 11:43 | 6.6M | |
| outer chill.xm | 2023-11-18 04:52 | 100K | |
| out source (r).xm | 2011-08-14 13:34 | 185K | |
| phony ride (2).xm | 2008-07-03 11:43 | 1.3M | |
| porno na-tosh (boys mix).xm | 2011-08-14 13:34 | 853K | |
| porno na-tosh (girls mix).xm | 2011-08-14 13:35 | 886K | |
| pothole.xm | 2011-08-14 13:35 | 194K | |
| pressure 1 remix.xm | 2008-07-03 11:43 | 1.1M | |
| pressure 4 remix.xm | 2008-07-03 11:43 | 1.4M | |
| puppets own love song (extended mix).xm | 2011-08-14 13:35 | 2.0M | |
| puppets own love song (original mix).xm | 2011-08-14 13:35 | 592K | |
| rainbow funk.xm | 2023-11-18 04:52 | 590K | |
| remember our cute electric whistle (slique clone mix).xm | 2011-08-14 13:35 | 1.2M | |
| remember our cute electric whistle (technollypop clone mix).xm | 2011-08-14 13:35 | 1.4M | |
| retro boogie.xm | 2008-07-03 11:43 | 1.3M | |
| size box.xm | 2008-07-03 11:44 | 644K | |
| slidfunkers.xm | 2011-08-14 13:36 | 475K | |
| sound kindergarden.xm | 2008-07-03 11:44 | 756K | |
| subframe 3.3 remix.xm | 2011-08-14 13:36 | 418K | |
| subraum.xm | 2023-11-18 04:52 | 639K | |
| sun over chaos.xm | 2008-07-03 11:44 | 2.4M | |
| sunshine on.xm | 2008-07-03 11:44 | 2.1M | |
| t... rmx.xm | 2008-07-03 11:44 | 569K | |
| the beat terminator.xm | 2011-08-14 13:36 | 796K | |
| the final movement.xm | 2008-07-03 11:44 | 2.2M | |
| the mother fucka way.xm | 2008-07-03 11:44 | 872K | |
| the way i think.xm | 2008-07-03 11:44 | 554K | |
| things you like to hear.xm | 2011-08-14 13:36 | 854K | |
| tubular cells.xm | 2011-08-14 13:36 | 259K | |
| warm pulses.xm | 2008-07-03 11:44 | 718K | |
| we have some weird technology.xm | 2008-07-03 11:45 | 679K | |
|
|---|