![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
![[DIR]](/icons/folder.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| (^^,).xm | 2011-04-24 12:34 | 29K | |
| (brown)sugar addict.xm | 2010-03-28 13:51 | 100K | |
| 069.xm | 2011-04-24 12:34 | 1.5M | |
| 2k8.xm | 2011-04-24 12:34 | 193K | |
| aceman of spades.xm | 2011-04-24 12:35 | 2.1M | |
| adhd.xm | 2011-04-24 12:35 | 862K | |
| atomic dreams ingame.xm | 2008-07-03 00:19 | 89K | |
| at spes non fracta.xm | 2011-04-24 12:36 | 3.3M | |
| awake.xm | 2010-03-28 13:51 | 10K | |
| bez sensu.xm | 2011-04-24 12:36 | 196K | |
| braindead.xm | 2011-04-24 12:36 | 471K | |
| brain defect.xm | 2011-04-24 12:36 | 963K | |
| butterfly.xm | 2008-07-03 00:19 | 42K | |
| chaotic evil.xm | 2011-04-24 12:36 | 710K | |
| chemical laboratory.xm | 2008-07-03 00:19 | 954K | |
| chippie.xm | 2011-04-24 12:36 | 107K | |
| chippie 2.xm | 2011-04-24 12:36 | 146K | |
| chippy's dreamer elektro.xm | 2011-04-24 12:36 | 1.4M | |
| cleansing.xm | 2021-05-15 06:44 | 1.9M | |
| clintonomics robo.xm | 2008-07-03 00:19 | 415K | |
| confused.xm | 2011-04-24 12:37 | 2.4M | |
| coop-Corny/ | 2018-01-02 15:50 | - | |
| coop-Pip Malt/ | 2011-04-24 13:07 | - | |
| copper.xm | 2008-07-03 00:19 | 38K | |
| cosmic lifeforms.xm | 2011-04-24 12:37 | 3.1M | |
| crapique.xm | 2010-05-30 13:48 | 32K | |
| crazy integrals.xm | 2011-04-24 12:37 | 64K | |
| deaf to the bone.xm | 2011-04-24 12:38 | 3.0M | |
| death amplify.xm | 2011-04-24 12:38 | 637K | |
| dectective mystery.xm | 2011-04-24 12:39 | 373K | |
| der traum.xm | 2011-04-24 12:39 | 2.2M | |
| deserts.xm | 2011-04-24 12:39 | 590K | |
| dextromethorphan.xm | 2011-04-24 12:40 | 1.3M | |
| dimenhydrinate.xm | 2011-04-24 12:40 | 611K | |
| discoman.xm | 2008-07-03 00:19 | 299K | |
| diszko.xm | 2018-01-02 15:50 | 559K | |
| dngnatic.xm | 2011-04-24 12:40 | 61K | |
| do it patternstyle!.xm | 2011-04-24 12:40 | 275K | |
| do it patternstyle 2.xm | 2010-09-19 14:03 | 862K | |
| ekopiryna.xm | 2009-04-28 17:42 | 36K | |
| emotional void.xm | 2011-04-24 12:41 | 2.7M | |
| emotracking.xm | 2011-04-24 12:41 | 94K | |
| epica.xm | 2008-07-03 00:19 | 404K | |
| epica 2.xm | 2008-07-03 00:19 | 734K | |
| epica 3.xm | 2011-04-24 12:41 | 1.5M | |
| epica 4.xm | 2011-04-24 12:41 | 1.1M | |
| epica 5.xm | 2011-04-24 12:46 | 13M | |
| every.xm | 2010-09-05 13:54 | 49K | |
| fabryka guzikow #1.xm | 2018-01-02 15:50 | 29K | |
| fabryka guzikow #2.xm | 2018-01-02 15:50 | 17K | |
| fabryka guzikow #3.xm | 2018-01-02 15:50 | 69K | |
| fabryka guzikow #4.xm | 2018-01-02 15:50 | 50K | |
| fabryka guzikow #5.xm | 2018-01-02 15:50 | 90K | |
| feel the funk.xm | 2011-04-24 12:48 | 4.6M | |
| flying dreams.xm | 2008-07-03 00:19 | 349K | |
| folkchip.xm | 2008-07-03 00:19 | 20K | |
| forest.xm | 2008-07-03 00:19 | 437K | |
| fountains.xm | 2008-07-03 00:19 | 1.0K | |
| frosted autumn.xm | 2011-04-24 12:48 | 105K | |
| funique.xm | 2011-04-24 12:48 | 696K | |
| galatea of the spheres.xm | 2011-04-24 12:48 | 1.2M | |
| glad och dum.xm | 2011-04-24 12:48 | 55K | |
| glass rythm.xm | 2011-04-24 12:48 | 892K | |
| grav.xm | 2011-04-24 12:48 | 281K | |
| guru meditation.xm | 2011-04-24 12:48 | 21K | |
| hardcorowy kulu.xm | 2011-04-24 12:49 | 2.5M | |
| i'm falling down.xm | 2011-04-24 12:50 | 3.5M | |
| ich will! ich muss!.xm | 2011-04-24 12:50 | 270K | |
| il palloncino.xm | 2011-04-24 12:50 | 206K | |
| important message.xm | 2011-04-24 12:50 | 17K | |
| jade hunk.xm | 2011-07-03 12:35 | 490K | |
| jazzie.xm | 2011-04-24 12:50 | 524K | |
| jazzneveragain.xm | 2011-04-24 12:51 | 2.8M | |
| jekyll, hyde, hyde and another hyde.xm | 2011-04-24 12:52 | 1.7M | |
| just try to say no!.xm | 2011-04-24 12:52 | 1.5M | |
| keep fucking.xm | 2009-04-28 17:42 | 16K | |
| komzx.xm | 2008-07-03 00:19 | 35K | |
| lair.xm | 2008-07-03 00:19 | 322K | |
| lazy bastard.xm | 2011-04-24 12:52 | 100K | |
| lazytune.xm | 2011-04-24 12:52 | 23K | |
| lemonade.xm | 2008-07-03 00:19 | 154K | |
| little fred.xm | 2008-07-03 00:19 | 6.6K | |
| lonely soul.xm | 2011-04-24 12:52 | 481K | |
| lost souls.xm | 2008-07-03 00:19 | 254K | |
| lost souls 2.xm | 2011-04-24 12:52 | 811K | |
| magnetizer ingame.xm | 2011-04-24 12:52 | 1.1M | |
| market of wonders.xm | 2011-04-24 12:53 | 902K | |
| menusik.xm | 2011-04-24 12:53 | 390K | |
| midi comes back.xm | 2011-04-24 12:53 | 403K | |
| mind(s)trip.xm | 2011-04-24 12:53 | 2.1M | |
| mindless.xm | 2010-07-25 13:50 | 43K | |
| mod.undjazz remix.xm | 2011-04-24 12:53 | 341K | |
| moddysee.xm | 2011-04-24 12:54 | 1.2M | |
| moogie in metro.xm | 2011-04-24 12:54 | 499K | |
| moogie with synths.xm | 2011-04-24 12:54 | 620K | |
| muffled happiness.xm | 2011-04-24 12:54 | 1.3M | |
| my pure evil.xm | 2011-04-24 12:55 | 1.6M | |
| my way.xm | 2011-04-24 12:55 | 1.2M | |
| nie wierze i wiem.xm | 2018-01-02 15:50 | 3.0M | |
| niezapomniana.xm | 2011-04-24 12:56 | 1.3M | |
| night club.xm | 2008-07-03 00:19 | 223K | |
| no idea.xm | 2011-04-24 12:56 | 46K | |
| noisezinmyheadz.xm | 2011-04-24 12:57 | 1.2M | |
| no one is ready.xm | 2011-04-24 12:57 | 1.9M | |
| norbie.xm | 2011-04-24 12:57 | 499K | |
| one important thing.xm | 2011-04-24 12:57 | 714K | |
| only once.xm | 2011-04-24 12:57 | 14K | |
| open the book.xm | 2011-04-24 12:57 | 1.2M | |
| ortalion dreams.xm | 2008-07-03 00:19 | 517K | |
| overheated cpu.xm | 2011-04-24 12:57 | 32K | |
| palace.xm | 2008-07-03 00:19 | 169K | |
| party-question psk.xm | 2011-04-24 12:58 | 1.4M | |
| piano on the floor.xm | 2011-04-24 12:58 | 70K | |
| plastic chip.xm | 2008-07-03 00:19 | 24K | |
| pr0nl3ss pr1nc3ss.xm | 2011-04-24 12:58 | 155K | |
| predictably unexpected.xm | 2011-04-24 12:59 | 2.5M | |
| pure demoscene crap.xm | 2011-04-24 12:59 | 143K | |
| retreat into music.xm | 2011-04-24 12:59 | 59K | |
| running.xm | 2011-04-24 12:59 | 731K | |
| running 2.xm | 2011-04-24 12:59 | 1.3M | |
| running death.xm | 2008-07-03 00:19 | 159K | |
| shortie.xm | 2011-04-24 13:00 | 562K | |
| shyzofrenia.xm | 2011-04-24 13:00 | 732K | |
| smilin'.xm | 2009-04-28 17:42 | 71K | |
| snow.xm | 2011-04-24 13:00 | 119K | |
| spalmy kota!!!.xm | 2011-04-24 13:01 | 5.1M | |
| specific mood.xm | 2011-04-24 13:01 | 513K | |
| stanley on da street.xm | 2011-04-24 13:01 | 153K | |
| stereothematic.xm | 2011-04-24 13:01 | 7.8K | |
| story about f sharp.xm | 2011-04-24 13:01 | 248K | |
| studium falszu.xm | 2010-05-30 13:48 | 90K | |
| summer bitch.xm | 2008-07-03 00:19 | 74K | |
| syntie.xm | 2011-04-24 13:01 | 447K | |
| take a bite.xm | 2010-05-30 13:48 | 64K | |
| the killer is me.xm | 2011-04-24 13:02 | 1.2M | |
| the ultimate time machine.xm | 2011-04-24 13:02 | 1.6M | |
| the wheels of fate.xm | 2011-07-03 12:35 | 251K | |
| timager.xm | 2011-04-24 13:02 | 733K | |
| trauma.xm | 2008-07-03 00:19 | 237K | |
| unbeatable.xm | 2010-07-25 13:50 | 1.7M | |
| underground.xm | 2011-04-24 13:02 | 1.1M | |
| upadl mi parasol.xm | 2008-07-03 00:19 | 31K | |
| upadl mi parasol 2.xm | 2011-04-24 13:02 | 79K | |
| valium candies.xm | 2011-04-24 13:02 | 53K | |
| voodka people.xm | 2011-04-24 13:03 | 1.8M | |
| we are aliens.xm | 2011-04-24 13:03 | 687K | |
| what about menu.xm | 2011-04-24 13:03 | 525K | |
| whatever it means.xm | 2010-05-30 13:48 | 58K | |
| whatify.xm | 2010-03-28 13:51 | 100K | |
| who wants to live with a bullet in the head.xm | 2011-04-24 13:03 | 1.7M | |
| wiosenny poranek.xm | 2009-04-28 17:42 | 85K | |
| wormatic.xm | 2011-04-24 13:03 | 566K | |
| wormhole.xm | 2011-04-24 13:04 | 1.1M | |
| wt3 - journey.xm | 2011-04-24 13:04 | 1.2M | |
| wt3 - theme.xm | 2011-04-24 13:04 | 1.8M | |